|
Nickelaustinite |
 |
Cesbron F P, Ginderow D, Giraud R, Pelisson P, Pillard F |
 |
The Canadian Mineralogist 25 (1987) 401-407 |
|
La nickelaustinite Ca(Ni,Zn)(AsO4)(OH): Nouvelle espece minerale du |
|
district cobalto-nickelifere de Bou-Azzer, Maroc |
|
Note: signs changed on y-coordinates of O1 and O2 |
|
_database_code_amcsd 0005215 |
|
7.455 8.955 5.916 90 90 90 P2_12_12_1 |
|
atom x y z occ Biso |
|
Ca .3687 .1704 .4761 .8 |
|
Ni .2405 .5049 .2558 .67 .8 |
|
Zn .2405 .5049 .2558 .22 .8 |
|
Co .2405 .5049 .2558 .04 .8 |
|
Mg .2405 .5049 .2558 .06 .8 |
|
Cu .2405 .5049 .2558 .01 .8 |
|
As .1182 .1812 .0165 .6 |
|
O1 -.0549 .0627 -.0106 1.1 |
|
O2 .2839 .0668 .0842 1.1 |
|
O3 .1463 .2749 -.2322 .8 |
|
O4 .1024 .2960 .2430 .9 |
|
O5 .3978 .4255 .4967 .7 |
|
H .475 .971 .010 .7 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Aubertite |
|
Ginderow D, Cesbron F |
 |
Acta Crystallographica B35 (1979) 2499-2502 |
|
Structure cristalline de l'aubertite, AlCuCl(SO4)2*14H2O |
|
Note: anisotropic displacement parameters obtained from ICSD |
|
_database_code_amcsd 0009692 |
|
6.282 13.192 6.260 91.85 94.70 82.46 P-1 |
|
atom x y z Biso B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
Cu .5 .5 0 1.8 .0095 .0032 .0121 -.0005 .0007 .0014 |
|
Al .5 0 .5 1.0 .0059 .0016 .0056 .0001 .0005 .0005 |
|
S .9838 .1895 .0647 1.1 .0071 .0018 .0066 .0001 -.0003 .0005 |
|
O1 .0495 .2922 .0883 2.0 .0120 .0023 .0175 -.0013 -.0016 .0007 |
|
O2 .9497 .1527 .2769 2.0 .0090 .0046 .0102 .0002 .0026 .0033 |
|
O3 .1586 .1201 .9740 2.1 .0167 .0039 .0078 .0041 .0027 .0007 |
|
O4 .7847 .1926 .9245 2.1 .0122 .0027 .0158 -.0008 -.0075 .0007 |
|
O5 .5765 .1221 .4043 1.7 .0094 .0017 .0153 -.0004 .0035 .0014 |
|
O6 .2371 .0710 .5760 1.5 .0078 .0032 .0072 .0016 .0012 .0006 |
|
O7 .6241 .0246 .7783 1.5 .0120 .0020 .0074 -.0002 -.0027 .0003 |
|
O8 .5852 .4419 .2818 3.1 .0160 .0069 .0130 -.0053 -.0052 .0054 |
|
O9 .7929 .4557 .9183 2.6 .0101 .0043 .0208 .0013 .0065 .0044 |
|
O10 .4085 .3358 .8865 2.4 .0118 .0035 .0191 -.0005 .0033 .0018 |
|
O11 .3643 .3042 .4479 2.2 .0146 .0025 .0160 .0001 .0004 .0007 |
|
Cl 0 .5 .5 2.4 .0109 .0052 .0124 -.0008 .0000 -.0001 |
|
H5 .713 .128 .362 2. |
|
H5' .492 .175 .406 2. |
|
H6 .145 .095 .490 2. |
|
H6' .204 .090 .715 2. |
|
H7 .675 .079 .799 2. |
|
H7' .302 .030 .143 2. |
|
H8 .504 .386 .357 2. |
|
H8' .701 .457 .370 2. |
|
H9 .159 .531 .192 2. |
|
H9' .911 .407 .996 2. |
|
H10 .299 .316 .965 2. |
|
H10' .492 .286 .919 2. |
|
H11 .360 .320 .600 2. |
|
H11' .257 .306 .392 2. |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Mapimite |
|
Ginderow D, Cesbron F |
|
Acta Crystallographica B37 (1981) 1040-1043 |
|
Structure de la mapimite, Zn2Fe3(AsO4)3(OH)4*10H2O |
|
Locality: Ojuela, Mapimi, Durango, Mexico |
|
Note: anisoB's from ICSD |
|
_database_code_amcsd 0009743 |
|
11.415 11.259 8.661 90 107.74 90 Cm |
|
atom x y z Biso B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
Zn1 .2970 0 .6227 .7 .0015 .0017 .0013 0 .0001 0 |
|
Zn2 .7528 0 .6755 1.0 .0016 .0034 .0015 0 -.0001 0 |
|
Fe1 .0171 0 .6334 .4 .0010 .0013 .0002 0 .0002 0 |
|
Fe2 .0839 .1417 .3508 .4 .001 .0011 .0003 -.0001 .0001 -.0001 |
|
As1 0 0 0 .6 .0015 .0017 .0001 0 -.0001 0 |
|
As2 .8616 .2433 .4864 .5 .0009 .0011 .001 -.0003 .0002 -.0002 |
|
O1 .8492 0 .9065 1.0 .0015 .0040 .0011 0 -.0005 0 |
|
O2 .0810 0 .8667 1.0 .0021 .0040 .0001 0 .0001 0 |
|
O3 .0378 .1246 .1145 1.0 .0037 .0018 .0001 -.0004 .0002 -.0003 |
|
O4 .7124 .2405 .3729 .7 .0013 .0017 .0024 .0005 -.0005 -.0006 |
|
O5 .9482 .2449 .3584 1.3 .0023 .0028 .0027 -.0011 .0018 -.0012 |
|
O6 .8832 .1204 .6036 .9 .0017 .0016 .0025 .0004 .0011 .0011 |
|
O7 .9004 .3612 .6079 .9 .0017 .0017 .0033 -.0003 -.0001 .0010 |
|
OH1 .9791 0 .3771 .5 .0006 .0017 .0013 0 -.0002 0 |
|
OH2 .2028 0 .3771 .5 .0012 .0012 .0008 0 .0005 0 |
|
OH3 .1407 .1181 .6042 .7 .0020 .0016 .0008 -.0009 .0005 -.0005 |
|
Wat11 .3473 0 .8678 2.9 .0069 .0096 .0015 0 -.0003 0 |
|
Wat12 .6398 0 .4392 1.7 .0030 .0052 .0036 0 -.0004 0 |
|
Wat13 .6491 .1418 .7230 1.6 .0026 .0041 .0034 .0009 .0009 .0008 |
|
Wat14 .3771 0 .2254 3.9 .0036 .0133 .0073 0 .0031 0 |
|
Wat15 .7430 0 .1634 3.9 .0034 .0135 .0095 0 .0011 0 |
|
Wat16 .2559 .2413 .0151 14.2 .0434 .0374 .0098 -.0258 -.0083 .0133 |
|
Wat17 .0391 .3545 .0234 16.4 .0309 .0265 .0657 .0034 -.0007 -.0126 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Demesmaekerite |
|
Ginderow D, Cesbron F |
|
Acta Crystallographica C39 (1983) 824-827 |
|
Structure de la demesmaekerite,Pb2Cu5(SeO3)6(UO2)2(OH)6*2H2O |
|
Locality: Musoni, Kolwezi, Shaba, Zaire |
|
Note: anisoB's from ICSD |
|
_database_code_amcsd 0009977 |
|
11.955 10.039 5.639 89.78 100.36 91.34 P-1 |
|
atom x y z Biso B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
Pb .1946 .6890 .3282 1.13 .0023 .0027 .0079 -.0002 .0009 -.0001 |
|
Cu1 .5 .5 .5 .9 .0015 .0028 .0062 .0002 .0006 -.0006 |
|
Cu2 .3850 .5767 .9350 1.1 .0013 .0037 .0077 .0002 .0005 -.0017 |
|
Cu3 .9537 .4432 .2080 .9 .0021 .0022 .0059 -.0001 .0014 .0001 |
|
Se1 .5121 .1688 .7260 1.1 .0014 .0028 .0114 .0000 .0006 -.0003 |
|
Se2 .2214 .3749 .5940 .9 .0017 .0021 .0078 .0005 .0000 .0000 |
|
Se3 .9539 .1108 .2123 .7 .0012 .0017 .0064 .0002 .0002 .0003 |
|
U .74743 .9163 .7608 .64 .0010 .0015 .0058 .0001 .0004 .0001 |
|
O1 .3019 .1365 .9843 2.2 .0059 .0035 .0149 -.0012 .0000 .0032 |
|
O2 .1974 .0302 .4933 1.9 .0052 .0055 .0042 -.0006 .0016 .0019 |
|
O3 .8381 .1161 .9822 1.0 .0016 .0016 .0119 .0003 .0006 -.0010 |
|
O4 .6312 .0986 .6580 1.6 .0026 .0021 .0211 .0011 .0008 -.0016 |
|
O5 .5738 .8285 .5454 1.8 .0020 .0033 .0215 .0000 -.0018 .0026 |
|
O6 .7771 .6924 .6789 1.3 .0022 .0023 .0142 .0004 .0012 -.0021 |
|
O7 .9372 .8646 .9488 1.0 .0012 .0021 .0105 -.0005 -.0004 .0019 |
|
O8 .4439 .6702 .2607 1.7 .0029 .0049 .0112 .0009 -.0010 -.0033 |
|
O9 .3326 .4828 .6133 1.5 .0015 .0048 .0145 -.0009 .0170 -.0031 |
|
O10 .1134 .4851 .5178 .9 .0020 .0019 .0065 .0003 .0003 -.0007 |
|
O11 .0565 .7391 .6598 1.0 .0018 .0022 .0088 .0002 .0016 -.0021 |
|
OH1 .5251 .5931 .8038 1.0 .0014 .0027 .0091 -.0007 .0011 -.0010 |
|
OH2 .7619 .4587 .9689 1.1 .0013 .0036 .0083 .0000 .0009 -.0008 |
|
OH3 .0063 .6171 .0965 1.0 .0016 .0031 .0075 .0001 .0023 -.0004 |
|
Wat .3403 .7971 .7985 2.5 .0042 .0075 .0186 .0026 .0017 -.0030 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Derriksite |
|
Ginderow D, Cesbron F |
|
Acta Crystallographica C39 (1983) 1605-1607 |
|
Structure da la derriksite, Cu4(UO2)(SeO3)2(OH)6 |
|
Locality: Musoni, Shaba, Ziare |
|
Note: anisoB's from ICSD |
|
_database_code_amcsd 0009986 |
|
5.570 19.088 5.965 90 90 90 Pn2_1m |
|
atom x y z Biso B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
Cu1 .6033 .2512 0 .83 .0059 .0009 .0034 .0004 0 0 |
|
Cu2 .3877 .7535 0 .78 .0045 .0009 .0036 .0002 0 0 |
|
Cu3 .1080 .2455 .2498 .85 .0049 .0009 .0044 .0000 .0004 -.0002 |
|
U .6848 0 0 1.15 .0152 .0005 .0062 .0009 0 0 |
|
Se1 -.0079 .4172 0 1.29 .0141 .0006 .0088 .0005 0 0 |
|
Se2 .6389 .5797 0 1.35 .0149 .0006 .0088 -.0004 0 0 |
|
O1 .4119 -.0477 0 2.8 .0178 .0013 .0301 -.0018 0 0 |
|
O2 .9525 .0509 0 2.8 .0303 .0012 .0214 -.0007 0 0 |
|
O3 .9419 .3326 0 1.3 .0115 .0007 .0104 -.0013 0 0 |
|
O4 .6926 .6648 0 1.4 .0137 .0011 .0064 -.0008 0 0 |
|
O5 .1809 .4271 .2207 2.2 .0302 .0010 .0089 -.0018 -.0071 -.0005 |
|
O6 .4420 .5739 .2173 2.4 .0284 .0014 .0108 -.0022 .0063 .0007 |
|
OH1 .0093 .7993 0 .9 .0065 .0007 .0058 .0006 0 0 |
|
OH2 .2282 .1946 0 .9 .0065 .0010 .0032 .0014 0 0 |
|
OH3 .7804 .2062 .2467 .8 .0046 .0008 .0034 .0004 .0012 .0001 |
|
OH4 .4292 .2954 .2516 .9 .0060 .0007 .0061 .0005 -.0004 .0001 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Roubaultite |
|
Ginderow D, Cesbron F |
|
Acta Crystallographica C41 (1985) 654-657 |
|
Structure de la roubaultite, Cu2(UO2)3(CO3)2O2(OH)2(H2O)4 |
|
Locality: Shinkolobwe, Province du Shaba, Zaire |
|
Note: anisoB's from ICSD |
|
_database_code_amcsd 0010005 |
|
7.767 6.924 7.850 92.16 90.89 93.48 P-1 |
|
atom x y z Biso B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
Cu .4994 .2604 .4929 1.1 .0063 .0046 .0034 -.0017 -.0012 -.0012 |
|
U1 0 0 0 .81 .0050 .0022 .0033 -.0002 -.0014 -.0005 |
|
U2 .1377 .5179 .1947 .70 .0041 .0026 .0025 -.0002 -.0013 -.0005 |
|
C .2305 .0284 .3134 1.0 .0058 .0035 .0043 -.0013 -.0029 -.0022 |
|
O1 .1884 -.0006 .8649 1.9 .0101 .0069 .0079 -.0015 .0011 -.0007 |
|
O2 .3332 .5375 .0721 1.8 .0049 .0150 .0052 .0003 -.0002 -.0025 |
|
O3 -.0477 .5010 .3241 1.7 .0063 .0125 .0052 -.0005 .0009 -.0001 |
|
O4 .1659 -.1314 .2480 1.8 .0131 .0000 .0090 -.0018 -.0046 -.0009 |
|
O5 .0030 .3143 .9977 1.5 .0088 .0072 .0051 -.0052 -.0019 -.0007 |
|
O6 .1839 .1789 .2406 2.2 .0134 .0061 .0085 .0014 -.0085 -.0008 |
|
O7 .3411 .0345 .4409 1.2 .0052 .0057 .0055 -.0016 -.0039 -.0001 |
|
O8 .3219 .5412 .4391 1.1 .0038 .0083 .0033 -.0020 .0000 .0000 |
|
O9 .4075 .2789 .7261 1.8 .0092 .0108 .0044 -.0042 .0000 -.0019 |
|
O10 .4210 .7470 .7476 1.9 .0105 .0099 .0053 -.0002 -.0003 -.0001 |
|
H1 .235 .448 .503 3.3 |
|
H2 .354 .208 .779 2.9 |
|
H3 .481 .333 .812 1.5 |
|
H4 .403 .663 .800 2.2 |
|
H5 .321 .831 .739 3.9 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Khademite |
|
Bachet B, Cesbron F, Chevalier R |
| |
Bulletin de Mineralogie 104 (1981) 19-22 |
|
Structure cristalline de la khademite Al(SO4)F*5H2O |
|
_database_code_amcsd 0012072 |
|
11.181 13.048 10.885 90 90 90 Pcab |
|
atom x y z Biso |
|
Al1 0 .5 .5 .4 |
|
Al2 0 .5 0 .5 |
|
S .2384 .2475 .2468 .6 |
|
O1 .1686 .2549 .1320 1.7 |
|
O2 .3055 .1500 .2462 2.0 |
|
O3 .1579 .2501 .3545 1.6 |
|
O4 .3209 .3357 .2536 2.0 |
|
F .0294 .5099 .1559 1.1 |
|
Ow2 .0098 .3756 .5882 1.1 |
|
Ow3 .1438 .4151 -.0207 1.2 |
|
Ow4 -.0943 .3821 .0288 1.5 |
|
Ow5 .0689 .4359 .3657 1.2 |
|
Ow6 -.1544 .4637 .4420 1.2 |
|
H2d .057 .357 .648 2 |
|
H2b -.047 .324 .598 2 |
|
H3d .139 .359 .034 2 |
|
H3b .149 .388 -.092 2 |
|
H4d -.120 .340 -.032 2 |
|
H4b -.121 .371 .103 2 |
|
H5d .060 .459 .284 2 |
|
H5b .102 .375 .365 2 |
|
H6d -.168 .430 .373 2 |
|
H6b .216 .495 .467 2 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Curienite |
|
Borene J, Cesbron F |
| |
Bulletin de la Societe Francaise de Mineralogie et de Cristallographie 94 (1971) 8-14 |
|
Structure cristalline de la curienite Pb(UO2)2(VO4)2(H2O)5 |
|
Locality: Mounana, Gabon |
|
_database_code_amcsd 0012133 |
|
10.419 8.494 16.405 90 90 90 Pcan |
|
atom x y z Biso B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
Pb .3526 0 -.25 .0044 .0051 .0006 0 0 -.0003 |
|
U .1857 .0227 .0028 -.0006 .0021 .0001 .0001 0 .0002 |
|
V -.0308 .6542 .0436 -.0013 .0008 0 .0006 0 .0006 |
|
O1 .1018 .5655 -.0231 -.8 |
|
O2 .0055 .6389 .1394 1.7 |
|
O3 .0168 .8497 .0164 1.3 |
|
O4 -.1963 .7022 .0196 3.4 |
|
O5 .1801 .0778 .1006 -1.1 |
|
O6 .1937 -.0328 -.0940 .4 |
|
Wat1 .2357 .2851 -.2245 1.6 |
|
Wat2 .5323 -.1880 -.1878 2.0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
Multiple datasets can be concatenated into a single downloadable file by
selecting the datasets and then hitting the "Download Selected Data" button.
