|
Quetzalcoatlite |
 |
Burns P C, Pluth J J, Smith J V, Eng P, Steele I M, Housley R M |
 |
American Mineralogist 85 (2000) 604-607 |
|
Quetzalcoatlite: New octahedral-tetrahedral structure from 2x2x40 micron |
|
crystal at the Advanced Photon Source-GSE-CARS Facility |
|
_database_code_amcsd 0002428 |
|
10.145 10.145 4.9925 90 90 120 P-31m |
|
atom x y z occ Uiso |
|
Te 1/3 2/3 1/2 .0095 |
|
Zn .20371 .4074 0 .0140 |
|
Cu 1/2 0 1/2 .0180 |
|
O .3508 .5190 .2850 .0143 |
|
OH 0 .2772 .158 .0290 |
|
Ag 0 0 0 .24 .0594 |
|
Pb 0 0 0 .30 .0594 |
|
Cl 0 0 1/2 .84 .0211 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Ottoite |
| |
Kampf A R, Housley R M, Mills S J, Marty J, Thorne B |
| |
American Mineralogist 95 (2010) 1329-1336 |
|
Lead-tellurium oxysalts from Otto Mountain near Baker, California: |
|
I. Ottoite, Pb2TeO5, a new mineral with chains of tellurate octahedra |
|
Locality: Otto Mountain, Baker, California, USA |
|
_database_code_amcsd 0017558 |
|
7.5353 5.7142 10.8981 90 91.330 90 I2/a |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .34125 .00490 .33909 .0125 .0089 .0134 .0152 .0010 -.0003 .0012 |
|
Te .5 .5 .5 .0063 .0052 .0069 .0069 -.0002 .0008 .0007 |
|
O1 .5726 .7973 .4417 .013 .010 .008 .021 -.002 -.002 .010 |
|
O2 .4653 .3854 .3373 .014 .016 .020 .006 -.007 .000 -.003 |
|
O3 .25 .6256 .5 .010 .002 .010 .017 .000 .002 .000 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Thorneite |
| |
Kampf A R, Housley R M, Marty J |
| |
American Mineralogist 95 (2010) 1548-1553 |
|
Lead-tellurium oxysalts from Otto Mountain near Baker, California: III. |
|
Thorneite, Pb6(Te6+2O10)(CO3)Cl2(H2O), the first mineral with |
|
edge-sharing octahedral tellurate dimers |
|
Locality: Otto Mountain, Baker, California |
|
_database_code_amcsd 0017719 |
|
21.305 11.059 7.564 90 101.112 90 C2/c |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .63753 .09635 .15303 .0186 .0139 .0241 .0165 .0015 -.0005 -.0012 |
|
Pb2 .69515 .41296 .96922 .0220 .0218 .0233 .0195 -.0020 .0007 -.0021 |
|
Pb3 .55264 .24366 .52254 .0283 .0177 .0376 .0279 .0056 .0006 -.0047 |
|
Te .78842 .30010 .36271 .0134 .0114 .0160 .0128 -.0030 .0024 -.0008 |
|
C .5 .9822 .25 .025 .028 .017 .025 .0 -.010 .0 |
|
Cl .5884 .3933 .1682 .75 .057 .032 .080 .059 .006 .009 -.002 |
|
OH .5884 .3933 .1682 .25 .057 .032 .080 .059 .006 .009 -.002 |
|
O1 .5 .0990 .25 .052 .034 .033 .079 .0 -.015 .0 |
|
O2 .5487 .9265 .2183 .044 .022 .049 .063 .001 .013 -.009 |
|
O3 .7815 .4526 .2479 .026 .024 .028 .021 -.011 -.006 .008 |
|
O4 .6451 .2717 .7367 .020 .016 .028 .016 -.008 .003 -.012 |
|
O5 .7269 .2338 .1654 .016 .013 .019 .014 -.004 -.004 .004 |
|
O6 .6435 .1381 .4534 .014 .008 .025 .010 -.001 .003 -.002 |
|
O7 .7201 .3460 .4937 .012 .011 .013 .014 .002 .008 -.003 |
|
Owat .5 .391 .75 .089 .095 .094 .081 .0 .022 .0 |
|
H .525 .442 .829 .08 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Markcooperite |
| |
Kampf A R, Mills S J, Housley R M, Marty J, Thorne B |
| |
American Mineralogist 95 (2010) 1554-1559 |
|
Lead-tellurium oxysalts from Otto Mountain near Baker, California: IV. |
|
Markcooperite, Pb(UO2)Te6+O6, the first natural uranyl tellurate |
|
Locality: Otto Mountain, Baker, California |
|
_database_code_amcsd 0017720 |
|
5.722 7.7478 7.889 90 90.833 90 P2_1/c |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .4972 .1689 .6919 .0531 .044 .051 .064 -.003 -.003 .002 |
|
U1 0 0 0 .75 .0386 .035 .039 .042 .003 .003 .002 |
|
Te1 0 0 0 .25 .0386 .035 .039 .042 .003 .003 .002 |
|
Te2 0 .5 0 .0339 .029 .034 .039 -.003 -.001 .002 |
|
O1 .699 -.068 -.061 .054 .05 .05 .07 .01 -.03 .01 |
|
O2 -.137 .234 .505 .038 .06 .02 .03 .00 -.02 .00 |
|
O3 .295 .085 .429 .045 .02 .05 .06 .00 .00 .03 |
|
O4 -.114 .532 -.237 .040 .03 .02 .07 -.00 -.01 .01 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Timroseite |
| |
Kampf A R, Mills S J, Housley R M, Marty J, Thorne B |
| |
American Mineralogist 95 (2010) 1560-1568 |
|
Lead-tellurium oxysalts from Otto Mountain near Baker, California: V. |
|
Timroseite, Pb2Cu2+5(Te6+O6)2(OH)2, and paratimroseite, |
|
Pb2Cu2+4(Te6+O6)2(H2O)2, two new tellurates with Te-Cu polyhedral sheets |
|
Locality: Otto Mountain, Baker, California |
|
_database_code_amcsd 0017721 |
|
5.2000 9.6225 11.5340 90 90 90 P2_1nm |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .1230 .0356 0 .94 .0229 .0198 .0213 .0277 .0041 0 0 |
|
Pb1a .125 .077 0 .09 .060 .11 .037 .035 .032 0 0 |
|
Pb2 .3820 .38682 .5 .84 .0208 .0170 .0178 .0277 .0013 0 0 |
|
Pb2a .279 .396 .5 .17 .062 .07 .075 .045 -.018 0 0 |
|
Cu1 .6694 .89920 .18488 .0146 .0131 .0093 .0214 .0003 .0017 -.0021 |
|
Cu2 .7204 .59878 .32206 .0155 .0136 .0108 .0220 -.0026 .0036 -.0022 |
|
Cu3 .1304 .7144 .5 .0222 .0194 .0267 .0204 .0026 0 0 |
|
Te .2005 .74917 .24990 .0122 .0109 .0092 .0165 -.0004 .0001 .0003 |
|
O1 .3817 .6747 .3817 .0160 .006 .021 .021 .009 .004 .001 |
|
O2 .0013 .8259 .1236 .0143 .015 .014 .014 -.005 -.005 .006 |
|
O3 .3533 .9309 .2788 .0189 .021 .010 .025 -.004 -.005 -.002 |
|
O4 .9192 .7716 .3612 .0135 .010 .014 .016 -.006 -.003 .002 |
|
O5 .0365 .5718 .2178 .0160 .011 .006 .031 .005 .008 -.001 |
|
O6 .5044 .7173 .1587 .018 .022 .005 .026 -.005 .007 -.009 |
|
OH1 .530 .9473 0 .021 .017 .023 .023 .002 0 0 |
|
OH2 .798 .5066 .5 .024 .010 .040 .022 .003 0 0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Paratimroseite |
| |
Kampf A R, Mills S J, Housley R M, Marty J, Thorne B |
| |
American Mineralogist 95 (2010) 1560-1568 |
|
Lead-tellurium oxysalts from Otto Mountain near Baker, California: V. |
|
Timroseite, Pb2Cu2+5(Te6+O6)2(OH)2, and paratimroseite, |
|
Pb2Cu2+4(Te6+O6)2(H2O)2, two new tellurates with Te-Cu polyhedral sheets |
|
Locality: Otto Mountain, Baker, California |
|
_database_code_amcsd 0017722 |
|
5.1943 9.6198 11.6746 90 90 90 P2_12_12_1 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .48658 .37646 .71849 .0199 .0182 .0224 .0192 .0012 .0004 .0041 |
|
Cu1 .3802 .6442 .5457 .0148 .0090 .0157 .0196 .0007 -.0011 .0012 |
|
Cu2 .4205 .3513 .4222 .0145 .0090 .0159 .0184 -.0012 -.0015 .0005 |
|
Te .8986 .49499 .49034 .0124 .0100 .0117 .0155 .0000 -.0003 -.0003 |
|
O1 .608 .5291 .3914 .016 .018 .015 .016 -.007 -.012 .002 |
|
O2 .195 .4730 .5870 .012 |
|
O3 .544 .8222 .5322 .023 |
|
O4 .741 .3179 .5188 .022 .018 .007 .041 -.010 .003 .005 |
|
O5 .415 .5715 .8624 .017 .007 .032 .012 .000 .000 -.003 |
|
O6 .696 .5660 .6193 .019 .018 .028 .011 .001 .010 -.002 |
|
Wat .473 .7477 .2604 .024 .043 .008 .020 -.003 .008 -.005 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Telluroperite |
| |
Kampf A R, Mills S J, Housley R M, Marty J, Thorne B |
| |
American Mineralogist 95 (2010) 1569-1573 |
|
Lead-tellurium oxysalts from Otto Mountain near Baker, California: |
|
VI. Telluroperite, Pb3Te4+O4Cl2, the Te analog of perite and nadorite |
|
Locality: Otto Mountain, Baker, California |
|
_database_code_amcsd 0017747 |
|
5.5649 5.5565 12.4750 90 90 90 Bmmb |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 0 .25 .3892 .021 .016 .018 .028 0 0 0 |
|
Pb2 0 .25 .0961 .50 .025 .013 .010 .052 0 0 0 |
|
Te2 0 .25 .0961 .50 .025 .013 .010 .052 0 0 0 |
|
O .763 0 0 .018 .016 .021 .018 0 0 -.001 |
|
Cl 0 .25 .7473 .013 .019 .018 .000 0 0 0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Fluorphosphohedyphane |
| |
Kampf A R, Housley R M |
| |
American Mineralogist 96 (2011) 423-429 |
|
Fluorphosphohedyphane, Ca2Pb3(PO4)3F, the first apatite supergroup mineral |
|
with essential Pb and F |
|
Locality: Blue Bell claims, near Baker, San Bernardino County, California, USA |
|
_database_code_amcsd 0018322 |
|
9.6402 9.6402 7.0121 90 90 120 P6_3/m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ca1 1/3 2/3 .0046 .0085 .0093 .0093 .0068 .0047 0 0 |
|
Pb2 .23960 .00873 .25 .882 .0118 .0099 .0094 .0149 .0038 0 0 |
|
Ca2 .23960 .00873 .25 .118 .0118 .0099 .0094 .0149 .0038 0 0 |
|
P .4183 .3880 .25 .0099 .0101 .0076 .0120 .0043 0 0 |
|
O1 .3592 .5078 .25 .016 .020 .014 .016 .011 0 0 |
|
O2 .6047 .4731 .25 .016 .011 .016 .024 .007 0 0 |
|
O3 .3610 .2780 .0733 .0188 .029 .016 .017 .014 -.007 -.005 |
|
F 0 0 .5 .057 .048 .048 .076 .024 0 0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Plumbophyllite |
| |
Kampf A R, Rossman G R, Housley R M |
| |
American Mineralogist 94 (2009) 1198-1204 |
|
Plumbophyllite, a new species from the Blue Bell claims near Baker, San Bernardino |
|
County, California |
|
Locality: Blue Bell claims near Baker, San Bernardino County, California, USA |
|
_database_code_amcsd 0004972 |
|
13.2083 9.7832 8.6545 90 90 90 Pbcn |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .53131 .18997 .46446 .01220 .0096 .0135 .0135 .00025 .00015 -.00134 |
|
Si1 .2749 .1825 .3184 .0071 .0071 .0067 .0075 .0009 .0004 .0005 |
|
Si2 .3044 .0755 .6398 .0072 .0070 .0070 .0075 .0015 .0012 -.0002 |
|
O1 .3926 .2162 .3017 .0134 .011 .017 .012 -.001 .000 .002 |
|
O2 .2433 -.0594 .6989 .0118 .012 .011 .013 -.001 .001 .003 |
|
O3 .2996 .1899 .7771 .0135 .015 .013 .013 .006 -.005 -.003 |
|
O4 .2416 .1370 .4927 .0108 .012 .014 .006 .001 .002 .004 |
|
O5 .4179 .0378 .5937 .0140 .011 .012 .019 .004 .005 .003 |
|
Wat .4610 .4439 .6173 .5 .071 .012 .043 .159 .007 .043 -.026 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Kuksite |
|
Mills S J, Kampf A R, Kolitsch U, Housley R M, Raudsepp M |
| |
American Mineralogist 95 (2010) 933-938 |
|
The crystal chemistry and crystal structure of kuksite, Pb3Zn3Te6+P2O14, |
|
and a note on the crystal structure of yafsoanite, (Ca,Pb)3Zn(TeO6)2 |
|
Locality: Black Pine mine, NW of Philipsburg, Granite County, Montana, USA |
|
_database_code_amcsd 0005047 |
|
8.392 8.392 5.204 90 90 120 P321 |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .40881 0 0 .0295 .0322 .0299 .0255 .01497 .00031 .0006 |
|
Te 0 0 0 .0224 .0254 .0254 .0164 .0127 0 0 |
|
Zn 0 -.2478 .5 .0260 .0232 .0314 .0208 .0116 .0023 .0012 |
|
P 1/3 2/3 .5314 .797 .0261 .0264 .0264 .026 .0132 0 0 |
|
As 1/3 2/3 .5314 .202 .0261 .0264 .0264 .026 .0132 0 0 |
|
O1 -.1224 -.2161 .7878 .036 .038 .040 .027 .017 .005 -.015 |
|
O2 .5251 -.1969 .6560 .056 .037 .067 .026 -.001 .009 -.009 |
|
O3 1/3 2/3 .238 .038 .035 .035 .042 .018 0 0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Kuksite |
|
Mills S J, Kampf A R, Kolitsch U, Housley R M, Raudsepp M |
| |
American Mineralogist 95 (2010) 933-938 |
|
The crystal chemistry and crystal structure of kuksite, Pb3Zn3Te6+P2O14, |
|
and a note on the crystal structure of yafsoanite, (Ca,Pb)3Zn(TeO6)2 |
|
Locality: Blue Bell claims, Baker, San Bernardino County, California, USA |
|
_database_code_amcsd 0005048 |
|
8.3942 8.3942 5.1847 90 90 120 P321 |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .4087 0 0 .0307 .0316 .0409 .0228 .0205 .0016 .0032 |
|
Te 0 0 0 .0194 .0248 .0248 .0086 .0124 0 0 |
|
Zn 0 -.2509 .5 .0214 .0229 .0249 .0156 .0114 .0011 -.0005 |
|
P 1/3 2/3 .5329 .67 .022 .020 .020 .024 .010 0 0 |
|
As 1/3 2/3 .5329 .33 .022 .020 .020 .024 .010 0 0 |
|
O1 -.1229 -.2174 .7884 .034 .032 .041 .030 .018 -.001 -.007 |
|
O2 .5224 -.2023 .6613 .064 .046 .060 .051 .001 .004 -.006 |
|
O3 1/3 2/3 .2456 .038 .039 .039 .035 .020 0 0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Yafsoanite |
|
Mills S J, Kampf A R, Kolitsch U, Housley R M, Raudsepp M |
| |
American Mineralogist 95 (2010) 933-938 |
|
The crystal chemistry and crystal structure of kuksite, Pb3Zn3Te6+P2O14, |
|
and a note on the crystal structure of yafsoanite, (Ca,Pb)3Zn(TeO6)2 |
|
Locality: Delbe orebody, Aldan Shield, Saha Republic, Russia |
|
_database_code_amcsd 0005049 |
|
12.6350 12.6350 12.6350 90 90 90 Ia3d |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ca 0 .25 .125 .912 .0179 .0160 .0160 .0217 .0034 0 0 |
|
Pb 0 .25 .125 .088 .0179 .0160 .0160 .0217 .0034 0 0 |
|
Te 0 0 0 .0097 .0097 .0097 .0097 .0007 .0007 .0007 |
|
Zn 0 .25 .375 .957 .0131 .0141 .0141 .0111 0 0 0 |
|
O -.0273 .0489 .1419 .0149 .012 .017 .016 .000 .003 -.001 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Munakataite |
| |
Kampf A R, Mills S J, Housley R M |
| |
Mineralogical Magazine 74 (2010) 991-998 |
|
The crystal structure of munakataite, Pb2Cu2(Se4+O3)(SO4)(OH)4, |
|
from Otto Mountain, San Bernardino County, California, USA |
|
Locality: Otto Mountain, San Bernardino County, California, USA |
|
_database_code_amcsd 0018306 |
|
9.802 5.675 9.281 90 102.443 90 P2_1/m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .31694 .25 .41854 .976 .0219 .0208 .0198 .0232 0 .0008 0 |
|
Pb2 .33579 .25 .97549 .958 .0329 .0195 .0331 .0436 0 .0010 0 |
|
Cu .9886 -.0002 .24421 .947 .0148 .0221 .0079 .0137 -.0011 .0024 .0001 |
|
Se .3597 .75 .2215 .85 .0174 .0190 .0146 .0191 0 .0054 0 |
|
S .3597 .75 .2215 .15 .0174 .0190 .0146 .0191 0 .0054 0 |
|
S .3349 .75 .6883 .0172 .016 .010 .026 0 .006 0 |
|
O11 .376 .75 .0476 .045 .064 .049 .026 0 .020 0 |
|
O12 .2514 .5148 .2152 .023 .019 .021 .027 -.002 .003 .003 |
|
O21 .4828 .75 .7514 .028 .019 .039 .027 0 .009 0 |
|
O22 .3154 .75 .5248 .035 .041 .062 .000 0 .001 0 |
|
O23 .2690 .963 .7326 .031 .036 .026 .031 .008 .006 .006 |
|
OH1 .0260 .75 .3883 .018 .017 .014 .019 0 -.004 0 |
|
H1 .119 .75 .40 .050 |
|
OH2 .0775 .25 .3780 .016 .023 .016 .008 0 .000 0 |
|
H2 .06 .25 .470 .050 |
|
OH3 .0529 .75 .8975 .019 .007 .021 .023 0 -.009 0 |
|
H3 .141 .75 .95 .050 |
|
OH4 .0881 .25 .8924 .019 .029 .024 .002 0 -.004 0 |
|
H4 .07 .25 .984 .050 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Anorpiment |
| |
Kampf A R, Downs R T, Housley R M, Jenkins R A, Hyrsl J |
| |
Mineralogical Magazine 75 (2011) 2857-2867 |
|
Anorpiment, As2S3, the triclinic dimorph of orpiment |
|
Locality: Palomo mine, Castrovirreyna Province, Huancavelica Department, Peru |
|
_database_code_amcsd 0018526 |
|
5.7577 8.7169 10.2682 78.152 75.817 89.861 P-1 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
As1 .39108 .36238 .67225 .02442 .0243 .0206 .0277 -.00155 -.00473 -.00577 |
|
As2 .81064 .17527 .83715 .02433 .0265 .0212 .0283 .00289 -.00749 -.01095 |
|
As3 .37392 .67873 .83354 .02455 .0268 .0210 .0286 .00398 -.00738 -.01117 |
|
As4 .93519 .86377 .66860 .02401 .0267 .0201 .0271 .00446 -.00934 -.00593 |
|
S1 .90075 .92003 .87870 .0284 .0382 .0220 .0268 .0064 -.0107 -.0060 |
|
S2 .49936 .11754 .75544 .0304 .0245 .0219 .0492 .0035 -.0131 -.0124 |
|
S3 .75475 .61916 .74806 .0300 .0239 .0211 .0484 .0032 -.0105 -.0133 |
|
S4 .05571 .27458 .62594 .0271 .0284 .0279 .0273 .0003 -.0102 -.0070 |
|
S5 .31075 .77483 .62295 .0275 .0245 .0290 .0283 .0037 -.0047 -.0065 |
|
S6 .24319 .42417 .88062 .0290 .0358 .0232 .0264 -.0036 -.0044 -.0058 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Schieffelinite |
|
Kampf A R, Mills S J, Housley R M, Rumsey M S, Spratt J |
| |
American Mineralogist 97 (2012) 212-219 |
|
Lead-tellurium oxysalts from Otto Mountain near Baker, California: |
|
VII. Chromschieffelinite, Pb10Te6O20(OH)14(CrO4)(H2O)5, |
|
the chromate analog of schieffelinite |
|
Locality: Otto Mountain near Baker, California, USA |
|
_database_code_amcsd 0018765 |
|
9.6581 19.5833 10.5027 90 90 90 C222_1 |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .5 .73650 .25 .0318 .0276 .0239 .0440 .000 .0057 .000 |
|
Pb2 .85073 .65799 .37439 .02931 .0267 .0246 .0366 -.0003 .0054 -.0003 |
|
Pb3 .78502 .84797 .49090 .03594 .0603 .0240 .0235 -.0046 -.0084 .0030 |
|
Te1 .5 .55838 .25 .0198 .0258 .0174 .0164 .000 .0006 .000 |
|
Te2 .84780 .79060 .15087 .0179 .0164 .0193 .0179 -.0008 -.0018 .0005 |
|
S .0640 .5036 .4652 .25 .044 |
|
O1 .6317 .6271 .2089 .024 .027 .022 .023 -.005 -.001 .012 |
|
OH2 .5713 .5540 .4240 .029 .039 .027 .022 -.004 -.006 -.001 |
|
OH3 .3724 .4866 .2976 .039 .043 .034 .041 -.020 -.003 -.010 |
|
O4 .9163 .7005 .1304 .023 .013 .025 .030 -.003 .000 .002 |
|
O5 .8153 .7347 .5610 .021 .015 .029 .019 -.005 .004 .003 |
|
O6 .7653 .7637 .3071 .023 .029 .026 .015 .004 -.005 .001 |
|
O7 .5580 .6813 .4976 .5 .024 .026 .029 .018 .000 -.002 -.003 |
|
OH7 .5580 .6813 .4976 .5 .024 .026 .029 .018 .000 -.002 -.003 |
|
O8 0 .8279 .25 .029 .020 .021 .046 .000 -.022 .000 |
|
OH9 .7676 .8815 .1632 .026 .021 .022 .037 .004 -.002 .004 |
|
O10 .214 .5 .5 .5 .067 |
|
O11 .488 .9372 .045 .5 .19 |
|
O12 .046 .526 .329 .25 .10 |
|
Wat1 -.114 .5 .5 .5 .14 |
|
Wat2 .482 .8803 .179 .5 .055 |
|
Wat3 .097 .534 .360 .5 .112 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Chromschieffelinite |
| |
Kampf A R, Mills S J, Housley R M, Rumsey M S, Spratt J |
| |
American Mineralogist 97 (2012) 212-219 |
|
Lead-tellurium oxysalts from Otto Mountain near Baker, California: |
|
VII. Chromschieffelinite, Pb10Te6O20(OH)14(CrO4)(H2O)5, |
|
the chromate analog of schieffelinite |
|
Locality: Otto Mountain near Baker, California, USA |
|
_database_code_amcsd 0018766 |
|
9.6646 19.4962 10.5101 90 90 90 C222_1 |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .5000 .73669 .2500 .02636 .0210 .0188 .0393 .000 .0048 .000 |
|
Pb2 .85091 .65778 .37381 .02338 .0188 .0200 .0314 -.0010 .0048 .0018 |
|
Pb3 .78519 .84795 .49042 .03141 .0551 .0189 .0202 -.0062 -.0102 .0037 |
|
Te1 .5000 .55833 .2500 .0149 .0183 .0134 .0131 .000 -.0005 .000 |
|
Te2 .84797 .79074 .15086 .01206 .0096 .0139 .0127 -.0005 -.0015 .0003 |
|
Cr .0584 .5030 .4555 .25 .050 |
|
O1 .6286 .6271 .2077 .0170 .020 .011 .020 .006 .003 .000 |
|
OH2 .5707 .5544 .4228 .028 .032 .029 .023 -.003 -.010 -.002 |
|
OH3 .3728 .4860 .2998 .034 .053 .013 .036 -.014 -.001 -.002 |
|
O4 .9161 .6999 .1306 .0181 .010 .014 .030 .005 -.001 .004 |
|
O5 .8150 .7336 .5598 .0152 .026 .005 .014 .003 .008 .003 |
|
O6 .7655 .7640 .3088 .0137 .010 .020 .011 .000 .004 .004 |
|
O7 .5579 .6818 .4978 .5 .023 .023 .023 .022 -.002 -.011 -.002 |
|
OH7 .5579 .6818 .4978 .5 .023 .023 .023 .022 -.002 -.011 -.002 |
|
O8 .0000 .8272 .2500 .021 .008 .021 .033 .000 -.011 .000 |
|
OH9 .7667 .8820 .1633 .0204 .016 .022 .023 .003 -.004 .004 |
|
O10 .221 .5000 .5000 .5 .072 |
|
O11 .516 .9325 .050 .5 .130 |
|
O12 .054 .538 .313 .25 .033 |
|
Wat1 -.139 .5000 .5000 .5 .14 |
|
Wat2 .480 .8803 .176 .5 .078 |
|
Wat3 .124 .532 .386 .5 .102 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
Multiple datasets can be concatenated into a single downloadable file by
selecting the datasets and then hitting the "Download Selected Data" button.
