|
CrFe(C5H5)(C11H80)Cl(NO)2 |
| |
Wang Y P, Hwu J M, Wang S L |
 |
Acta Crystallographica C46 (1990) 2305-2308 |
|
Structure of Cl(NO)2Cr(n5-C5H4)C(O)(n5-C5H4)Fe(n5-C5H5) |
|
_database_code_amcsd 0010221 |
|
10.938 12.487 12.460 90 111.43 90 P2_1/c |
|
atom x y z Uiso |
|
Fe .7531 .5788 .1087 .026 |
|
Cr .2491 .6076 .4403 .030 |
|
Cl .4493 .6507 .5802 .075 |
|
O .9799 .8174 .2615 .050 |
|
O1 .0747 .6954 .5396 .084 |
|
O2 .2030 .3899 .4879 .085 |
|
N1 .1535 .6622 .5088 .045 |
|
N2 .2315 .4779 .4785 .047 |
|
C .9855 .7193 .2628 .032 |
|
C11 .8700 .6548 .2545 .032 |
|
C12 .7422 .7000 .2156 .036 |
|
C13 .6512 .6170 .2144 .038 |
|
C14 .7246 .5208 .2528 .035 |
|
C15 .8584 .5421 .2759 .032 |
|
C21 .1140 .6699 .2751 .032 |
|
C22 .2305 .7337 .3103 .040 |
|
C23 .3364 .6659 .3128 .050 |
|
C24 .2857 .5610 .2813 .045 |
|
C25 .1506 .5634 .2586 .035 |
|
C31 .8324 .5987 -.0141 .055 |
|
C32 .7069 .6422 -.0529 .048 |
|
C33 .6173 .5594 -.0552 .041 |
|
C34 .6907 .4649 -.0183 .040 |
|
C35 .8235 .4885 .0076 .049 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
Multiple datasets can be concatenated into a single downloadable file by
selecting the datasets and then hitting the "Download Selected Data" button.
