|
Poldervaartite |
 |
Dai Y S, Harlow G E, McGhie A R |
 |
American Mineralogist 78 (1993) 1082-1087 |
|
Poldervaartite, Ca(Ca0.5Mn0.5)(SiO3OH)(OH), a new acid nesosilicate from the |
|
Kalahari manganese field, South Africa: Crystal structure and description |
|
_database_code_amcsd 0001615 |
|
9.398 9.139 10.535 90 90 90 Pbca |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ca1 .15406 .49326 .39021 .0090 .0101 .0084 -.0004 .0007 .0003 |
|
Ca2 .51266 .33390 .43048 .67 .0101 .0104 .0098 -.0022 -.0003 -.0004 |
|
Mn .51266 .33390 .43048 .33 .0101 .0104 .0098 -.0022 -.0003 -.0004 |
|
Si .32973 .21515 .65939 .0076 .0075 .0069 .0002 -.0002 -.0004 |
|
Oh1 .2518 .3502 .5735 .028 .0104 .0140 .0046 -.0084 -.0005 |
|
O2 -.0559 .3590 .4368 .0092 .0145 .0117 -.0019 -.0002 -.0042 |
|
O3 .1020 .7101 .2829 .0160 .0134 .0087 .0022 .0045 .0043 |
|
Oh4 .3965 .5492 .3980 .0118 .019 .016 -.0012 -.0002 .0063 |
|
O5 .2019 .3986 .1893 .0146 .0145 .0129 .0044 .0018 -.0016 |
|
H1 .257 .074 .117 .03 |
|
H2 -.084 .588 .173 .03 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
Multiple datasets can be concatenated into a single downloadable file by
selecting the datasets and then hitting the "Download Selected Data" button.
