|
Sursassite |
 |
Nagashima M, Akasaka M, Minakawa T, Libowitzky E, Armbruster T |
| |
American Mineralogist 94 (2009) 1440-1449 |
|
Sursassite: hydrogen bonding, cation order, and pumpellyite intergrowth |
|
Locality: Falotta, Switzerland |
|
Sample Number: 1 |
|
_database_code_amcsd 0004986 |
|
8.7201 5.8053 9.8075 90 109.011 90 P2_1/m |
|
atom x y z occ |
|
Mn1 .16884 .25 .31355 |
|
Mn2 .27223 .25 .67531 |
|
Al1 .5 0 .5 |
|
Al2 .5 0 0 |
|
Al3 0 .5 0 |
|
Si1 .30787 .75 .19109 |
|
Si2 .20691 .75 .80740 |
|
Si3 .15557 .75 .49480 |
|
O1 .2608 .5139 .5013 |
|
O2 .1916 .5248 .1631 |
|
O3 .3146 .5180 .8332 |
|
O4 .4148 .75 .0810 |
|
O5 .4491 .75 .3517 |
|
O6 .0844 .25 .9289 |
|
O7 .4379 .25 .3690 |
|
O8 .0718 .75 .8926 |
|
O9 .0902 .75 .6360 |
|
O10 -.0103 .75 .3573 |
|
O11 .4114 .25 .0713 |
|
H6A .05 .25 .8235 .5 |
|
H6B .203 .25 .952 .5 |
|
H7 .454 .25 .275 |
|
H11A .294 .25 .052 .5 |
|
H11B .40 .254 .168 .25 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Sursassite |
|
Nagashima M, Akasaka M, Minakawa T, Libowitzky E, Armbruster T |
| |
American Mineralogist 94 (2009) 1440-1449 |
|
Sursassite: hydrogen bonding, cation order, and pumpellyite intergrowth |
|
Locality: New Brunswick, Canada |
|
Sample Number: 2 |
|
_database_code_amcsd 0004987 |
|
8.709 5.7939 9.779 90 108.953 90 P2_1/m |
|
atom x y z |
|
Mn1 .1700 .25 .3131 |
|
Mn2 .2717 .25 .6748 |
|
Al1 .5 0 .5 |
|
Al2 .5 0 0 |
|
Al3 0 .5 0 |
|
Si1 .3072 .75 .1917 |
|
Si2 .2065 .75 .8067 |
|
Si3 .1545 .75 .4941 |
|
O1 .2601 .5132 .5005 |
|
O2 .1907 .5246 .1630 |
|
O3 .3142 .5177 .8332 |
|
O4 .4141 .75 .0807 |
|
O5 .4487 .75 .3515 |
|
O6 .0848 .25 .9294 |
|
O7 .4373 .25 .3690 |
|
O8 .0714 .75 .8935 |
|
O9 .0893 .75 .6366 |
|
O10 -.0112 .75 .3565 |
|
O11 .4121 .25 .0728 |
|
H6A .06 .25 .824 |
|
H7 .44 .25 .269 |
|
H11A .2932 .25 .034 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Sursassite |
|
Nagashima M, Akasaka M, Minakawa T, Libowitzky E, Armbruster T |
| |
American Mineralogist 94 (2009) 1440-1449 |
|
Sursassite: hydrogen bonding, cation order, and pumpellyite intergrowth |
|
Locality: Kamisugai, Japan |
|
Sample Number: 3 |
|
_database_code_amcsd 0004988 |
|
8.7278 5.8065 9.8121 90 109.060 90 P2_1/m |
|
atom x y z |
|
Mn1 .1706 .25 .31322 |
|
Mn2 .2763 .25 .67528 |
|
Al1 .5 0 .5 |
|
Al2 .5 0 0 |
|
Al3 0 .5 0 |
|
Si1 .3071 .75 .1906 |
|
Si2 .2071 .75 .8072 |
|
Si3 .1532 .75 .4952 |
|
O1 .2566 .5130 .5004 |
|
O2 .1908 .5258 .1628 |
|
O3 .3151 .5191 .8328 |
|
O4 .4142 .75 .0800 |
|
O5 .4492 .75 .3492 |
|
OH6 .0841 .25 .9283 |
|
OH7 .4373 .25 .3682 |
|
O8 .0726 .75 .8938 |
|
O9 .0886 .75 .6369 |
|
O10 -.0131 .75 .3569 |
|
OH11 .4106 .25 .0696 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Sursassite |
|
Nagashima M, Akasaka M, Minakawa T, Libowitzky E, Armbruster T |
| |
American Mineralogist 94 (2009) 1440-1449 |
|
Sursassite: hydrogen bonding, cation order, and pumpellyite intergrowth |
|
Locality: Kamogawa, Japan |
|
Sample Number: 4 |
|
_database_code_amcsd 0004989 |
|
8.7065 5.7978 9.7946 90 108.938 90 P2_1/m |
|
atom x y z occ |
|
Mn1 .16902 .25 .31367 |
|
Mn2 .27275 .25 .67567 |
|
Al1 .5 0 .5 |
|
Al2 .5 0 0 |
|
Al3 0 .5 0 |
|
Si1 .3071 .75 .1913 |
|
Si2 .2067 .75 .8080 |
|
Si3 .1554 .75 .4950 |
|
O1 .2607 .5138 .5017 |
|
O2 .1907 .5248 .1628 |
|
O3 .3145 .5180 .8339 |
|
O4 .4152 .75 .0820 |
|
O5 .4484 .75 .3521 |
|
O6 .0843 .25 .9291 |
|
O7 .4381 .25 .3684 |
|
O8 .0720 .75 .8943 |
|
O9 .0899 .75 .6370 |
|
O10 -.0107 .75 .3575 |
|
O11 .4119 .25 .0717 |
|
H6A .06 .25 .824 .5 |
|
H6B .199 .25 .94 .5 |
|
H7 .44 .25 .268 |
|
H11A .297 .25 .06 .5 |
|
H11B .43 .25 .176 .5 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Sursassite |
|
Nagashima M, Akasaka M, Minakawa T, Libowitzky E, Armbruster T |
| |
American Mineralogist 94 (2009) 1440-1449 |
|
Sursassite: hydrogen bonding, cation order, and pumpellyite intergrowth |
|
Locality: Molinello, Italy |
|
Sample Number: 5 |
|
_database_code_amcsd 0004990 |
|
8.6982 5.7887 9.7777 90 108.918 90 P2_1/m |
|
atom x y z occ |
|
Mn1 .16738 .25 .31398 |
|
Mn2 .26707 .25 .67527 |
|
Al1 .5 0 .5 |
|
Al2 .5 0 0 |
|
Al3 0 .5 0 |
|
Si1 .3078 .75 .1925 |
|
Si2 .2069 .75 .8078 |
|
Si3 .1573 .75 .4944 |
|
O1 .2654 .5140 .5027 |
|
O2 .1916 .5238 .1637 |
|
O3 .3143 .5174 .8342 |
|
O4 .4154 .75 .0823 |
|
O5 .4482 .75 .3542 |
|
O6 .0848 .25 .9295 |
|
O7 .4390 .25 .3692 |
|
O8 .0717 .75 .8940 |
|
O9 .0912 .75 .6363 |
|
O10 -.0074 .75 .3574 |
|
O11 .4129 .25 .0738 |
|
H6A .05 .25 .824 .5 |
|
H6B .201 .25 .94 .5 |
|
H7 .325 .25 .31 |
|
H11A .295 .25 .05 .5 |
|
H11B .40 .25 .168 .5 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Sursassite |
|
Nagashima M, Akasaka M, Minakawa T, Libowitzky E, Armbruster T |
| |
American Mineralogist 94 (2009) 1440-1449 |
|
Sursassite: hydrogen bonding, cation order, and pumpellyite intergrowth |
|
Locality: Molinello, Italy |
|
Sample Number: 6 |
|
_database_code_amcsd 0004991 |
|
8.716 5.799 9.794 90 108.985 90 P2_1/m |
|
atom x y z |
|
Mn1 .1699 .25 .3132 |
|
Mn2 .2716 .25 .6753 |
|
Al1 .5 0 .5 |
|
Al2 .5 0 0 |
|
Al3 0 .5 0 |
|
Si1 .3072 .75 .1919 |
|
Si2 .2064 .75 .8076 |
|
Si3 .1545 .75 .4945 |
|
O1 .2617 .514 .5015 |
|
O2 .1912 .525 .1639 |
|
O3 .3134 .521 .8328 |
|
O4 .414 .75 .0805 |
|
O5 .448 .75 .351 |
|
OH6 .085 .25 .9288 |
|
OH7 .438 .25 .3695 |
|
O8 .0732 .75 .8939 |
|
O9 .0901 .75 .6376 |
|
O10 -.008 .75 .3568 |
|
OH11 .413 .25 .0723 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Sursassite |
|
Nagashima M, Akasaka M, Minakawa T, Libowitzky E, Armbruster T |
| |
American Mineralogist 94 (2009) 1440-1449 |
|
Sursassite: hydrogen bonding, cation order, and pumpellyite intergrowth |
|
Locality: Gambatesa, Italy |
|
Sample Number: 7 |
|
_database_code_amcsd 0004992 |
|
8.715 5.7981 9.798 90 108.879 90 P2_1/m |
|
atom x y z |
|
Mn1 .1677 .25 .3142 |
|
Mn2 .2693 .25 .6760 |
|
Al1 .5 0 .5 |
|
Al2 .5 0 0 |
|
Al3 0 .5 0 |
|
Si1 .3074 .75 .1923 |
|
Si2 .2066 .75 .8077 |
|
Si3 .1566 .75 .4947 |
|
O1 .2638 .5135 .5027 |
|
O2 .1912 .5245 .1631 |
|
O3 .3146 .5184 .8353 |
|
O4 .4161 .75 .0829 |
|
O5 .4459 .75 .3532 |
|
OH6 .0845 .25 .9291 |
|
O7 .4391 .25 .3679 |
|
O8 .0719 .75 .8934 |
|
O9 .0921 .75 .6375 |
|
O10 -.0078 .75 .3571 |
|
O11 .4130 .25 .0731 |
|
H7 .45 .25 .27 |
|
H11B .48 .25 .176 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Epidote-(Sr) |
| |
Minakawa T, Fukushima H, Nishio-Hamane D, Miura H |
| |
Journal of Mineralogical and Petrological Sciences 103 (2008) 400-406 |
|
Epidote-(Sr), CaSrAl2Fe(Si2O7)(SiO4)(OH), a new mineral from the Ananai mine, |
|
Kochi Prefecture, Japan |
|
Locality: Ananai mine, Kochi Prefecture, Japan |
|
_database_code_amcsd 0013136 |
|
8.928 5.652 10.244 90 114.46 90 P2_1/m |
|
atom x y z occ Biso |
|
CaA1 .764 .75 .156 .96 .76 |
|
SrA1 .764 .75 .156 .04 .76 |
|
SrA2 .595 .75 .422 .86 .92 |
|
CaA2 .595 .75 .422 .14 .92 |
|
AlM1 0 0 0 .90 .51 |
|
FeM1 0 0 0 .10 .51 |
|
AlM2 0 0 .5 .43 |
|
FeM3 .295 .25 .220 .78 .42 |
|
MnM3 .295 .25 .220 .20 .42 |
|
AlM3 .295 .25 .220 .02 .42 |
|
Si1 .338 .75 .037 .45 |
|
Si2 .685 .25 .274 .45 |
|
Si3 .174 .75 .315 .45 |
|
O1 .246 .999 .043 .70 |
|
O2 .292 .973 .336 .70 |
|
O3 .785 .013 .329 .70 |
|
O4 .041 .25 .117 .7 |
|
O5 .045 .75 .143 .70 |
|
O6 .072 .75 .418 .70 |
|
O7 .509 .75 .176 .70 |
|
O8 .532 .25 .316 .70 |
|
O9 .642 .25 .109 .70 |
|
OH10 .076 .25 .425 .70 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Piemontite |
|
Nagashima M, Armbruster T, Akasaka M, Minakawa T |
| |
Journal of Mineralogical and Petrological Sciences 105 (2010) 142-150 |
|
Crystal chemistry of Mn2+-, Sr-rich and REE-bearing piemontite from the |
|
Kamisugai mine in the Sambagawa metamorphic belt, Shikoku, Japan |
|
Locality: Kamisugai mine, Sambagawa metamorphic belt, Shikoku, Japan |
|
_database_code_amcsd 0018299 |
|
8.8673 5.6747 10.1594 90 114.719 90 P2_1/m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
CaAl .7574 .75 .1527 .59 .0157 .0212 .0128 .0171 0 .0119 0 |
|
MnAl .7574 .75 .1527 .41 .0157 .0212 .0128 .0171 0 .0119 0 |
|
CaA2 .5950 .75 .42469 .71 .0087 .0069 .0124 .0056 0 .0015 0 |
|
SrA2 .5950 .75 .42469 .19 .0087 .0069 .0124 .0056 0 .0015 0 |
|
LaA2 .5950 .75 .42469 .03 .0087 .0069 .0124 .0056 0 .0015 0 |
|
CeA2 .5950 .75 .42469 .05 .0087 .0069 .0124 .0056 0 .0015 0 |
|
NdA2 .5950 .75 .42469 .02 .0087 .0069 .0124 .0056 0 .0015 0 |
|
AlMl 0 0 0 .72 .0085 .0090 .0056 .0103 -.0005 .0033 .0004 |
|
MnMl 0 0 0 .17 .0085 .0090 .0056 .0103 -.0005 .0033 .0004 |
|
FeMl 0 0 0 .77 .0085 .0090 .0056 .0103 -.0005 .0033 .0004 |
|
AlM2 0 0 .5 .0088 .0086 .0062 .0119 -.0002 .0045 -.0007 |
|
AlM3 .2999 .25 .2193 .11 .0096 .0087 .0082 .0096 0 .0015 0 |
|
MnM3 .2999 .25 .2193 .55 .0096 .0087 .0082 .0096 0 .0015 0 |
|
FeM3 .2999 .25 .2193 .34 .0096 .0087 .0082 .0096 0 .0015 0 |
|
Sil .3433 .75 .0428 .0102 .0100 .0089 .0114 0 .0043 0 |
|
Si2 .6890 .25 .2757 .0103 .0106 .0084 .0125 0 .0056 0 |
|
Si3 .1854 .75 .3193 .0097 .0100 .0097 .0107 0 .0057 0 |
|
O1 .2368 .9927 .0347 .0165 .018 .009 .026 .002 .012 .001 |
|
O2 .3066 .9782 .3545 .0148 .014 .016 .015 -.003 .007 -.001 |
|
O3 .8009 .0143 .3340 .0165 .013 .008 .022 .001 .001 .000 |
|
O4 .0563 .25 .1305 .0127 .015 .011 .013 0 .007 0 |
|
O5 .0411 .75 .1492 .0136 .012 .013 .015 0 .005 0 |
|
O6 .0742 .75 .4140 .0125 .015 .009 .018 0 .012 0 |
|
O7 .5170 .75 .1785 .019 .016 .017 .016 0 .001 0 |
|
O8 .5340 .25 .3201 .020 .017 .025 .026 0 .016 0 |
|
O9 .6163 .25 .0999 .024 .028 .033 .014 0 .011 0 |
|
O10 .0885 .25 .4329 .87 .0117 .013 .010 .016 0 .010 0 |
|
H10 .03 .25 .327 .87 .05 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Ehimeite |
| |
Nishio-Hamane D, Ohnishi M, Minakawa T, Yamaura J, Saito S, Kadota R |
| |
Journal of Mineralogical and Petrological Sciences 107 (2012) 1-7 |
|
Ehimeite, NaCa2Mg4CrSi6Al2O22(OH)2: The first Cr-dominant amphibole |
|
from the Akaishi Mine, Higashi-Akaishi Mountain, Ehime Prefecture, Japan |
|
Locality: Akaishi mine, Higashi-Akaishi Mountain, Ehime Prefecture, Japan |
|
_database_code_amcsd 0018696 |
|
9.91760 18.0057 5.28650 90 105.3950 90 C2/m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
SiT1 .28006 .085048 .30366 .53 .00536 .00520 .00515 .00567 -.00050 .00132 -.00034 |
|
AlT1 .28006 .085048 .30366 .47 .00536 .00520 .00515 .00567 -.00050 .00132 -.00034 |
|
SiT2 .28978 .172871 .81260 .00545 .00532 .00570 .00559 -.00049 .00190 .00004 |
|
MgM1 0 .08883 .5 .00386 .00487 .00380 .00330 0 .00175 0 |
|
MgM2 0 .175599 0 .53 .00993 .01022 .00978 .01005 0 .00318 0 |
|
CrM2 0 .175599 0 .30 .00993 .01022 .00978 .01005 0 .00318 0 |
|
AlM2 0 .175599 0 .09 .00993 .01022 .00978 .01005 0 .00318 0 |
|
FeM2 0 .175599 0 .07 .00993 .01022 .00978 .01005 0 .00318 0 |
|
TiM2 0 .175599 0 .01 .00993 .01022 .00978 .01005 0 .00318 0 |
|
MgM3 0 0 0 .00211 .00290 .00168 .00169 0 .00052 0 |
|
CaM4 0 .279689 .5 .94 .00836 .01032 .00687 .00942 0 .00532 0 |
|
NaM4 0 .279689 .5 .06 .00836 .01032 .00687 .00942 0 .00532 0 |
|
NaA 0 .5 0 .88 .135 .0238 .343 .0460 0 .0253 0 |
|
KA 0 .5 0 .07 .135 .0238 .343 .0460 0 .0253 0 |
|
O1 .10739 .08662 .21821 .00840 .00737 .00999 .00782 -.00104 .00196 .00007 |
|
O2 .11988 .17258 .73037 .00746 .00542 .00862 .00831 -.00001 .00180 .00028 |
|
O3 .10788 0 .71708 .00882 .00731 .0088 .0101 0 .00186 0 |
|
O4 .36554 .24948 .78665 .00925 .01063 .00770 .01030 -.00263 .00433 -.00075 |
|
O5 .34953 .14040 .11364 .01102 .00984 .01316 .00905 -.00081 .00073 .00472 |
|
O6 .34428 .11479 .61427 .01164 .00935 .01232 .01370 .00049 .00383 -.00506 |
|
O7 .34128 0 .27210 .01315 .0095 .0142 .0157 0 .0033 0 |
|
H .19670 0 .74370 .009 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
Multiple datasets can be concatenated into a single downloadable file by
selecting the datasets and then hitting the "Download Selected Data" button.
