|
Epidote-(Sr) |
| |
Minakawa T, Fukushima H, Nishio-Hamane D, Miura H |
| |
Journal of Mineralogical and Petrological Sciences 103 (2008) 400-406 |
|
Epidote-(Sr), CaSrAl2Fe(Si2O7)(SiO4)(OH), a new mineral from the Ananai mine, |
|
Kochi Prefecture, Japan |
|
Locality: Ananai mine, Kochi Prefecture, Japan |
|
_database_code_amcsd 0013136 |
|
8.928 5.652 10.244 90 114.46 90 P2_1/m |
|
atom x y z occ Biso |
|
CaA1 .764 .75 .156 .96 .76 |
|
SrA1 .764 .75 .156 .04 .76 |
|
SrA2 .595 .75 .422 .86 .92 |
|
CaA2 .595 .75 .422 .14 .92 |
|
AlM1 0 0 0 .90 .51 |
|
FeM1 0 0 0 .10 .51 |
|
AlM2 0 0 .5 .43 |
|
FeM3 .295 .25 .220 .78 .42 |
|
MnM3 .295 .25 .220 .20 .42 |
|
AlM3 .295 .25 .220 .02 .42 |
|
Si1 .338 .75 .037 .45 |
|
Si2 .685 .25 .274 .45 |
|
Si3 .174 .75 .315 .45 |
|
O1 .246 .999 .043 .70 |
|
O2 .292 .973 .336 .70 |
|
O3 .785 .013 .329 .70 |
|
O4 .041 .25 .117 .7 |
|
O5 .045 .75 .143 .70 |
|
O6 .072 .75 .418 .70 |
|
O7 .509 .75 .176 .70 |
|
O8 .532 .25 .316 .70 |
|
O9 .642 .25 .109 .70 |
|
OH10 .076 .25 .425 .70 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure
|
|   |
|
Ehimeite |
| |
Nishio-Hamane D, Ohnishi M, Minakawa T, Yamaura J, Saito S, Kadota R |
| |
Journal of Mineralogical and Petrological Sciences 107 (2012) 1-7 |
|
Ehimeite, NaCa2Mg4CrSi6Al2O22(OH)2: The first Cr-dominant amphibole |
|
from the Akaishi Mine, Higashi-Akaishi Mountain, Ehime Prefecture, Japan |
|
Locality: Akaishi mine, Higashi-Akaishi Mountain, Ehime Prefecture, Japan |
|
_database_code_amcsd 0018696 |
|
9.91760 18.0057 5.28650 90 105.3950 90 C2/m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
SiT1 .28006 .085048 .30366 .53 .00536 .00520 .00515 .00567 -.00050 .00132 -.00034 |
|
AlT1 .28006 .085048 .30366 .47 .00536 .00520 .00515 .00567 -.00050 .00132 -.00034 |
|
SiT2 .28978 .172871 .81260 .00545 .00532 .00570 .00559 -.00049 .00190 .00004 |
|
MgM1 0 .08883 .5 .00386 .00487 .00380 .00330 0 .00175 0 |
|
MgM2 0 .175599 0 .53 .00993 .01022 .00978 .01005 0 .00318 0 |
|
CrM2 0 .175599 0 .30 .00993 .01022 .00978 .01005 0 .00318 0 |
|
AlM2 0 .175599 0 .09 .00993 .01022 .00978 .01005 0 .00318 0 |
|
FeM2 0 .175599 0 .07 .00993 .01022 .00978 .01005 0 .00318 0 |
|
TiM2 0 .175599 0 .01 .00993 .01022 .00978 .01005 0 .00318 0 |
|
MgM3 0 0 0 .00211 .00290 .00168 .00169 0 .00052 0 |
|
CaM4 0 .279689 .5 .94 .00836 .01032 .00687 .00942 0 .00532 0 |
|
NaM4 0 .279689 .5 .06 .00836 .01032 .00687 .00942 0 .00532 0 |
|
NaA 0 .5 0 .88 .135 .0238 .343 .0460 0 .0253 0 |
|
KA 0 .5 0 .07 .135 .0238 .343 .0460 0 .0253 0 |
|
O1 .10739 .08662 .21821 .00840 .00737 .00999 .00782 -.00104 .00196 .00007 |
|
O2 .11988 .17258 .73037 .00746 .00542 .00862 .00831 -.00001 .00180 .00028 |
|
O3 .10788 0 .71708 .00882 .00731 .0088 .0101 0 .00186 0 |
|
O4 .36554 .24948 .78665 .00925 .01063 .00770 .01030 -.00263 .00433 -.00075 |
|
O5 .34953 .14040 .11364 .01102 .00984 .01316 .00905 -.00081 .00073 .00472 |
|
O6 .34428 .11479 .61427 .01164 .00935 .01232 .01370 .00049 .00383 -.00506 |
|
O7 .34128 0 .27210 .01315 .0095 .0142 .0157 0 .0033 0 |
|
H .19670 0 .74370 .009 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure
|
|   |
|
FeTi3O7 |
| |
Nishio-Hamane D, Zhang M, Yagi T, Ma Y |
| |
American Mineralogist 97 (2012) 568-572 |
|
High-pressure and high-temperature phase transitions in FeTiO3 |
|
and a new dense FeTi3O7 structure |
|
Note: P = 61 GPa, T = 300 K |
|
Locality: synthetic |
|
_database_code_amcsd 0018864 |
|
9.9522 2.7397 5.9953 90 90 90 Imm2 |
|
atom x y z |
|
Fe1 0 0 .665 |
|
Ti1 0 .5 .205 |
|
Ti2 .2328 0 .896 |
|
O1 0 0 -.013 |
|
O2 .3013 0 .607 |
|
O3 .651 0 .223 |
|
O4 .885 0 .386 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure
|
|   |
Multiple datasets can be concatenated into a single downloadable file by
selecting the datasets and then hitting the "Download Selected Data" button.