Na6F(H2O)18(NaH2O)(AsO4)2 Baur W H, Tillmanns E Acta Crystallographica B30 (1974) 2218-2224 Salt hydrates. X. The crystal structure determination of heptasodium fluoride bisphosphate 19-hydrate and heptasodium fluoride bisarsenate 19-hydrate and the computer simulation of the isomorphous vanadate salt _database_code_amcsd 0009516 28.12 28.12 28.12 90 90 90 *Fd3c .375 .375 .375 atom x y z occ B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) Na .4875 .0838 .0135 .00066 .00094 .00072 -.00025 .00009 -.00019 F 0 0 0 .00066 .00066 .00066 .00015 .00015 .00015 NaA .2032 .2032 .2032 .5 .00142 .00142 .00142 -.00006 -.00006 -.00006 WatA .2032 .2032 .2032 .5 .00142 .00142 .00142 -.00006 -.00006 -.00006 As1 .125 .125 .125 .00044 .00044 .00044 0 0 0 As2 .875 .125 .125 .00041 .00041 .00034 0 0 0 O1 .1387 .0760 .0950 1/3 .00145 .00243 .00129 .00031 -.00069 -.00085 O2 .4099 .0773 .1375 .00050 .00047 .00050 .00022 -.00006 .00012 Wat3 .0725 .0023 .0963 .00069 .00110 .00056 .00006 -.00012 .00019 Wat4 .4027 .0699 .0112 .00091 .00053 .00075 .00015 -.00015 .00006 Wat5 .2842 .0344 .0829 .00249 .00082 .00104 -.00044 .00082 -.00028