|
Mammothite |
 |
Grice J D, Cooper M A |
|
The Canadian Mineralogist 52 (2014) 687-697 |
|
Mammothite: a Pb-Sb-Cu-Al oxy-hydroxide-sulfate - hydrogen atom determination |
|
lowers space group symmetry |
|
Locality: Rowley mine, Arizona, USA |
|
_database_code_amcsd 0021234 |
|
18.959 7.3398 11.363 90 112.428 90 C2 |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .21039 -.00017 .17920 .01552 .01421 .01813 .01466 .0001 .00601 .0002 |
|
Pb21 .42314 .25876 .20361 .01675 .01857 .01230 .01957 -.00248 .00751 -.00001 |
|
Pb22 -.42306 -.25884 -.20331 .01764 .01872 .01216 .02217 -.00199 .00795 -.00004 |
|
Cu1 .24986 .2501 .5002 .01523 .01490 .0151 .01439 -.00479 .00417 -.00306 |
|
Cu2 .10434 .0001 .36849 .01309 .01237 .0129 .01601 .0008 .00763 .0014 |
|
Al 0 -.0005 .5 .74 .0102 .0094 .0121 .0088 0 .0032 0 |
|
Cr 0 -.0005 .5 .26 .0102 .0094 .0121 .0088 0 .0032 0 |
|
Sb 0 0 0 .01058 .00907 .01262 .00989 0 .00346 0 |
|
S .24971 -.0003 -.09612 .0117 .0106 .0124 .0118 .0006 .0041 .0009 |
|
Cl1 .36676 .0001 .39660 .0303 .0301 .0274 .0237 .0004 -.0006 -.0003 |
|
Cl2 .44955 .0004 -.19868 .0207 .0234 .0128 .0264 -.0008 .0099 -.0018 |
|
O .00284 .0014 -.1708 .0120 .0126 .0158 .0078 .002 .0040 .008 |
|
Oh13 .23729 .0011 -.4412 .0194 .0232 .0154 .0154 .005 .0027 -.002 |
|
Oh2 .08877 .0012 -.3460 .0140 .0099 .0178 .0141 -.001 .0046 .003 |
|
Oh31 .08250 .1837 .0441 .0178 .0091 .024 .02127 -.0005 .0071 -.0032 |
|
Oh32 -.0839 -.1834 -.0423 .0126 .0180 .0051 .0181 -.0072 .0106 -.0061 |
|
Oh41 .0408 .1752 .4167 .0153 .0184 .0166 .0153 -.0013 .0115 -.0009 |
|
Oh42 -.0388 -.1722 -.4153 .0130 .0127 .0079 .0159 -.0018 .0027 -.0032 |
|
Oh51 .17048 .1838 .3401 .0126 .0112 .0117 .0124 .0006 .0017 .0021 |
|
Oh52 -.1708 -.1824 -.3403 .0150 .0166 .0125 .0146 -.0025 .0042 .0000 |
|
Os1 .17665 .0009 -.0716 .0206 .0120 .0349 .0160 -.001 .0067 -.007 |
|
Os2 .31345 .0015 .0268 .0246 .0164 .0309 .0206 -.005 .0005 -.002 |
|
Os31 .2467 .1632 -.1732 .0289 .031 .018 .032 -.0068 .0061 .0080 |
|
Os32 -.2495 -.1598 .1708 .0340 .037 .032 .024 -.012 .0025 .0156 |
|
H1 .237 -.056 -.364 .06 |
|
H2 .1343 .056 -.348 .09 |
|
H31 .072 .302 .071 .032 |
|
H32 -.0680 -.259 -.097 .032 |
|
H41 .0591 .264 .484 .042 |
|
H42 -.073 -.262 -.469 .042 |
|
H51 .1326 .279 .302 .033 |
|
H52 -.163 -.296 -.294 .033 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink)
|
|
|
Mammothite |
 |
Effenberger H |
|
Tschermaks Mineralogische und Petrographische Mitteilungen 34 (1985) 279-288 |
|
The crystal structure of mammothite, Pb6Cu4AlSbO2(OH)16Cl4(SO4)2 |
|
Locality: Mammoth vein, Tiger, Arizona, USA |
|
_database_code_amcsd 0015702 |
|
18.93 7.33 11.35 90 112.44 90 C2/m |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .21037 0 .17947 .0179 .0186 .0232 .0159 0 .0051 0 |
|
Pb2 .42277 .25855 .20296 .0189 .0226 .0173 .0216 -.0022 .0064 -.0004 |
|
Cu1 .25 .25 .5 .0155 .0190 .0142 .0154 -.0019 .0027 -.0001 |
|
Cu2 .1042 0 .3685 .0151 .0167 .0168 .0178 0 .0078 0 |
|
Al 0 0 .5 .009 .0010 .014 .004 0 .002 0 |
|
Sb 0 0 0 .0143 .0149 .0174 .0129 0 .0029 0 |
|
O .0021 0 -.1695 .015 .023 .013 .018 0 .013 0 |
|
OH1 .2386 0 -.4393 .019 .018 .013 .030 0 .006 0 |
|
OH2 .0872 0 -.3442 .017 .008 .017 .025 0 -.001 0 |
|
OH3 .0831 .1854 .0426 .019 .020 .024 .018 -.001 .005 .003 |
|
OH4 .0409 .1717 .4173 .016 .022 .013 .021 .006 .008 .008 |
|
OH5 .1695 .1833 .3398 .014 .020 .014 .013 -.004 .005 .002 |
|
Cl1 .3679 0 .3963 .030 .035 .030 .025 0 -.002 0 |
|
Cl2 .4491 0 -.1995 .023 .029 .019 .028 0 .008 0 |
|
S1 .2497 0 -.0953 .015 .013 .021 .014 0 .003 0 |
|
OS1 .1776 0 -.0709 .020 .005 .039 .021 0 .005 0 |
|
OS2 .3103 0 .0298 .036 .015 .064 .029 0 .000 0 |
|
OS3 .2482 .1596 -.1686 .034 .047 .028 .030 -.010 .006 .006 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink)
|
|