|
Piemontite-(Pb) |
|
Chukanov N V, Varlamov D A, Nestola F, Belakovskiy D I, Goettlicher J, |
|
Britvin S N, Lanza A, Jancev S |
  |
Neues Jahrbuch fur Mineralogie, Abhandlungen 189 (2012) 275-286 |
|
Piemontite-(Pb), CaPbAl2Mn3+[Si2O7][SiO4]O(OH), a new mineral species |
|
of the epidote supergroup |
|
Locality: "Mixed Series" formation, Jacupica Mtns, Macedonia |
|
_database_code_amcsd 0020679 |
|
8.936 5.697 10.26 90 114.12 90 P2_1/m |
|
atom x y z occ Uiso |
|
Ca .7640 .75 .1548 .0176 |
|
Pb1 .58753 .75 .40974 .73 .0185 |
|
Ca1 .58753 .75 .40974 .30 .0185 |
|
AlM1 0 0 0 .65 .0139 |
|
FeM1 0 0 0 .34 .0139 |
|
AlM2 0 0 .5 .0143 |
|
MnM3 .2920 .25 .2198 .67 .0154 |
|
FeM3 .2920 .25 .2198 .33 .0154 |
|
Sil .3385 .75 .0416 .0157 |
|
Si2 .6880 .25 .2775 .0144 |
|
Si3 .1755 .75 .3120 .96 .0142 |
|
Al3 .1755 .75 .3120 .04 .0142 |
|
O1 .2385 .5073 .0408 .0176 |
|
O2 .2933 .5193 .3418 .0189 |
|
O3 .7955 .0134 .3413 .0196 |
|
O4 .0514 .25 .1275 .016 |
|
O5 .0315 .75 .1452 .018 |
|
O6 .0674 .75 .4075 .0118 |
|
O7 .5148 .75 .1663 .019 |
|
O8 .5269 .25 .3086 .020 |
|
O9 .6392 .25 .1085 .024 |
|
O10 .0801 .25 .4295 .0145 |
|
H .06 .25 .342 .05 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
Multiple datasets can be concatenated into a single downloadable file by selecting the datasets and then clicking
Multiple datasets can be downloaded as individual files inside a ZIP archive by selecting the datasets and then clicking
Total number of retrieved datasets: