|
Richelsdorfite |
 |
Susse P, Tillmann B |
 |
Zeitschrift fur Kristallographie 179 (1987) 323-334 |
|
The crystal structure of the new mineral richelsdorfite, |
|
Ca2Cu5Sb(Cl/(OH)6/(AsO4)4)*6H2O |
|
Locality: Iba, near Richelsdorf, Hessen, Germany |
|
_database_code_amcsd 0010965 |
|
14.079 14.203 13.470 90 101.05 90 C2/m |
|
atom x y z Biso |
|
Ca .0408 .2431 .2320 1.38 |
|
Cu1 .2904 0 .2369 .70 |
|
Cu2 .1452 .3852 .0570 .82 |
|
Cu3 .3723 .3867 .0562 .80 |
|
Sb .25 .25 .5 1.32 |
|
As1 .0673 0 .1319 .54 |
|
As2 .4809 0 .1322 .53 |
|
As3 .2735 .2062 .1324 .49 |
|
O1 .1166 0 .0242 .52 |
|
O2 .1538 0 .2361 1.12 |
|
O3 .0030 .1010 .1296 1.39 |
|
O4 .3967 0 .0227 .66 |
|
O5 .4275 0 .232 .80 |
|
O6 .0453 .3989 .1358 1.56 |
|
O7 .2886 .1386 .2346 1.24 |
|
O8 .2565 .1422 .0247 .98 |
|
O9 .1680 .2670 .1292 1.13 |
|
O10 .3760 .2691 .1326 1.47 |
|
OH11 .3666 .1817 .4805 2.69 |
|
OH12 .1839 .2174 .3617 1.31 |
|
OH13 .3033 .3633 .4458 3.84 |
|
Cl .2790 .5 .1575 2.06 |
|
Wat14 .3307 0 .4047 2.93 |
|
Wat15 .1007 0 .4242 2.21 |
|
Wat16 .4988 .1500 .3513 2.66 |
|
Wat17 .4715 .3525 .3493 2.94 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink)
|
|