|
Shattuckite |
 |
Evans H T, Mrose M E |
 |
American Mineralogist 62 (1977) 491-502 |
|
The crystal chemistry of the hydrous copper silicates, shattuckite and |
|
plancheite |
|
Note: sample is from Ajo, Arizona |
|
9.885 19.832 5.3825 90 90 90 Pcab |
|
atom x y z U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Cu1 .5 0 .5 .0088 .0079 .0093 -.0032 -.0030 .0042 |
|
Cu2 .33090 .02547 .03970 .0095 .0080 .0073 -.0025 -.0014 .0020 |
|
Cu3 .25205 .28125 .46765 .0108 .0046 .0066 .0001 -.0025 -.0004 |
|
Si1 .54485 .13502 .2173 .0062 .0039 .0052 -.0004 .0014 .0006 |
|
Si2 .39742 .15706 .7265 .0064 .0034 .0053 .0001 -.0002 .0003 |
|
O1 .5054 .0554 .1996 .0105 .0051 .0067 -.0038 -.0029 .0031 |
|
O2 .3426 .0805 .7439 .0157 .0032 .0119 -.0029 -.0022 .0024 |
|
O3 .7076 .1512 .2203 .0051 .0057 .0083 -.0024 .0005 .0018 |
|
O4 .4913 .1735 .9708 .0101 .0073 .0061 -.0014 -.0007 -.0010 |
|
O5 .4907 .1670 .4777 .0136 .0071 .0069 .0007 .0029 -.0037 |
|
O6 .2836 .2163 .7193 .0109 .0051 .0043 .0032 -.0023 -.0023 |
|
Oh7 .6779 .0243 .6426 .0091 .0059 .0069 -.0021 .0016 -.0002 |
|
H .71 .435 .63 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Dumortierite |
|
Alexander V D, Griffen D T, Martin T J |
|
American Mineralogist 71 (1986) 786-794 |
|
Crystal chemistry of some Fe- and Ti-poor dumortierites |
|
Sample: #2, BYU 12-5027, from Yuma Co., Arizona, USA |
|
11.786 20.209 4.692 90 90 90 Pmcn |
|
atom x y z occ U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Si1 .75 .4053 .0877 .0042 .0114 .0031 0 0 .0009 |
|
Si2 .5240 .3281 .5876 .99 .0082 .0070 .0032 -.0004 .0004 .0003 |
|
Al1 .75 .2502 .3981 .93 .0067 .0122 .0836 0 0 -.0043 |
|
Al2 .6103 .4722 .5573 .98 .0044 .0058 .0026 .0003 -.0003 -.0004 |
|
Al3 .4913 .4307 .0595 .97 .0044 .0048 .0018 -.0006 .0000 .0001 |
|
Al4 .3581 .2893 .0578 .99 .0073 .0075 .0053 .0011 -.0005 -.0002 |
|
B .25 .4159 .2284 .0030 .0012 .0114 0 0 .0003 |
|
O1 .75 .4537 .3788 .0058 .0213 .0060 0 0 -.0038 |
|
O2 .75 .3258 .1488 .0102 .0216 .0099 0 0 .0024 |
|
O3 .6390 .4242 .8967 .0076 .0171 .0045 -.0006 .0002 .0022 |
|
O4 .4364 .2824 .4014 .0104 .0143 .0054 -.0025 .0021 -.0018 |
|
O5 .5496 .3933 .3972 .0135 .0070 .0061 -.0009 -.0015 .0005 |
|
O6 .4537 .3504 .8846 .0137 .0093 .0066 -.0021 .0030 -.0018 |
|
O7 .6396 .2868 .6479 .0154 .0129 .0091 .0016 -.0023 .0009 |
|
O8 .25 .3500 .1685 .0038 .0102 .0212 0 0 -.0032 |
|
O9 .3507 .4482 .2553 .0059 .0109 .0119 -.0041 .0011 -.0021 |
|
O10 .25 .2723 .7603 .0048 .0145 .0060 0 0 -.0022 |
|
O11 .4663 .4881 .7505 .0057 .0072 .0047 .0006 .0004 .0000 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Chalcophanite |
|
Post J E, Appleman D E |
|
American Mineralogist 73 (1988) 1401-1404 |
|
Chalcophanite, ZnMn3O7.3(H2O): New crystal-structure determinations |
|
Locality: Bisbee, Arizona |
|
Note: U(1,2) of O3 altered to match symmetry constraints |
|
Note: H positions determined by energy modelling |
|
7.533 7.533 20.794 90 90 120 R-3 |
|
atom x y z U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Mn .71869 .57771 .99948 .0057 .0058 .0090 .0029 .0002 .0001 |
|
Zn 0 0 .09997 .0100 .0100 .0117 .0050 0 0 |
|
O1 .52784 .62297 .04721 .0098 .0083 .0080 .0050 .0000 -.0005 |
|
O2 .26077 .20655 .05048 .0097 .0095 .0122 .0055 .0028 .0026 |
|
O3 0 0 .71250 .0093 .0093 .0063 .00465 0 0 |
|
O4 .17900 .93107 .16435 .0152 .0182 .0160 .0073 -.0028 .0004 |
|
H1 .229 .025 .198 |
|
H2 .310 .940 .144 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Artroeite |
|
Kampf A R, Foord E E |
|
American Mineralogist 80 (1995) 179-183 |
|
Artroeite, PbAlF3(OH)2, a new mineral from the Grand Reef mine, Graham County, |
|
Arizona: Description and crystal structure |
|
6.270 6.821 5.057 90.68 107.69 104.46 P-1 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .30975 .19142 .20352 .00866 .00607 .0140 .00235 .00339 .00156 |
|
Al .8110 .3273 .8364 .0085 .0047 .0100 .0016 .0031 .0012 |
|
F1 .7950 .1378 .5751 .017 .0069 .015 .0030 .009 .0003 |
|
F2 .7407 .4891 .5627 .012 .0081 .011 .0043 .002 .0028 |
|
F3 .5137 .2308 .8113 .009 .0105 .023 .0001 .006 .002 |
|
Oh1 .8629 .5514 .0981 .008 .0073 .013 .0027 .005 .001 |
|
Oh2 .8981 .1432 .0988 .010 .0076 .007 .0030 .003 .0021 |
|
H1 .807 .509 .253 .02 |
|
H2 .862 .122 .255 .02 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Carmichaelite |
| |
Wang L, Rouse R C, Essene E J, Peacor D R, Zhang Y |
|
American Mineralogist 85 (2000) 792-800 |
|
Carmichaelite, a new hydroxyl-bearing titanate from Garnet Ridge, Arizona |
|
7.706 4.5583 20.187 90 92.334 90 P2_1/c |
|
atom x y z occ Biso |
|
Ti1 .5 0 0 1.3 |
|
Ti2 .0562 .007 .3113 .94 .30 |
|
V2 .0562 .007 .3113 .06 .30 |
|
Ti3 .4128 .992 .3691 .975 .34 |
|
Nb3 .4128 .992 .3691 .025 .34 |
|
Ti4 .1328 .999 .9448 .57 |
|
Cr5 .3271 .000 .7396 .775 .65 |
|
Cr6 .2187 .016 .5747 .27 .7 |
|
Fe6 .2187 .016 .5747 .17 .7 |
|
Al6 .2187 .016 .5747 .18 .7 |
|
Mg7 .2799 .040 .2046 .14 .6 |
|
Fe8 .2375 .021 .1051 .31 .5 |
|
Mg8 .2375 .021 .1051 .16 .5 |
|
O1 .703 .293 .4866 2.5 |
|
O2 .259 .255 .8074 1.1 |
|
O3 .173 .283 .1637 2.1 |
|
O4 .807 .283 .1193 1.7 |
|
O5 .624 .215 .3502 .9 |
|
O6 .066 .252 .0206 2.6 |
|
O7 .355 .286 .4372 2.3 |
|
O8 .523 .253 .2140 2.7 |
|
O9 .889 .240 .2564 .9 |
|
O10 .986 .233 .3930 1.2 |
|
O11 .436 .283 .0731 2.3 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Alpersite |
| |
Peterson R C, Hammarstrom J M, Seal R R |
|
American Mineralogist 91 (2006) 261-269 |
|
Alpersite (Mg,Cu)SO4*7H2O, a new mineral of the melanterite group, and cuprian |
|
pentahydrite: Their occurrence within mine waste |
|
Locality: Miami, Arizona, USA |
|
14.189 6.547 10.830 90 105.872 90 P2_1/c |
|
atom x y z occ U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Mg1 0 0 0 .845 .027 .024 .035 .003 .010 .004 |
|
Cu1 0 0 0 .155 .027 .024 .035 .003 .010 .004 |
|
Mg2 .5 .5 0 .265 .029 .0300 .0247 .0044 .0064 .0019 |
|
Cu2 .5 .5 0 .735 .029 .0300 .0247 .0044 .0064 .0019 |
|
S .22865 .4672 .1741 .0307 .0310 .0363 .0006 .0102 .0003 |
|
O1 .2017 .4691 .0321 .049 .046 .030 .007 .008 .001 |
|
O2 .1444 .5431 .2181 .048 .050 .059 .015 .033 .012 |
|
O3 .3152 .6028 .2240 .047 .044 .050 .018 .009 .011 |
|
O4 .2538 .2569 .2221 .050 .036 .055 .008 .009 .007 |
|
Wat1 .1057 .3789 .4256 .067 .063 .064 .030 .037 .024 |
|
Wat2 .1047 .9562 .1773 .051 .043 .046 .004 .003 .003 |
|
Wat3 .0286 .7911 .4300 .045 .034 .050 .003 .011 .008 |
|
Wat4 .4814 .4530 .1737 .043 .048 .036 .004 .013 .001 |
|
Wat5 .4294 .2645 .4391 .049 .040 .043 .007 .007 .007 |
|
Wat6 .3480 .8390 .4413 .051 .053 .045 .008 .006 .007 |
|
Wat7 .3682 .0085 .1131 .049 .036 .049 .001 .008 .004 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Pentahydrite |
|
Peterson R C, Hammarstrom J M, Seal R R |
|
American Mineralogist 91 (2006) 261-269 |
|
Alpersite (Mg,Cu)SO4*7H2O, a new mineral of the melanterite group, and cuprian |
|
pentahydrite: Their occurrence within mine waste |
|
Locality: Miami, Arizona, USA |
|
6.2470 10.5995 6.0395 82.530 109.408 104.794 P-1 |
|
atom x y z occ Uiso |
|
Mg1 0 0 0 .1 .056 |
|
Cu1 0 0 0 .9 .056 |
|
Mg2 .5 .5 0 .7 .037 |
|
Cu2 .5 .5 0 .3 .037 |
|
S .0368 .2935 .6402 .039 |
|
O1 .911 .1662 .666 .037 |
|
O2 .263 .3227 .847 .037 |
|
O3 .872 .3720 .639 .037 |
|
O4 .053 .2958 .411 .037 |
|
Wat1 .821 .0687 .178 .037 |
|
Wat2 .312 .1161 .173 .037 |
|
Wat3 .535 .5917 .671 .037 |
|
Wat4 .230 .5917 .988 .037 |
|
Wat5 .446 .1289 .647 .037 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Winstanleyite |
|
Bindi L, Cipriani C |
|
The Canadian Mineralogist 41 (2003) 1469-1473 |
|
The crystal structure of winstanleyite, TiTe3O8, from the |
|
Grand Central Mine, Tombstone, Arizona |
|
Locality: Grand Central Mine, Tombstone, Arizona |
|
10.965 10.965 10.965 90 90 90 I2_1/a-3 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ti 0 0 0 .0244 .0244 .0244 .0244 -.0001 -.0001 -.0001 |
|
Te .20907 0 .25 .0274 .0275 .0274 .0274 0 0 .0001 |
|
O1 .4386 .1333 .3987 .0224 .0228 .0228 .0227 -.0002 -.0003 -.0002 |
|
O2 .1729 .1729 .1729 .0225 .0225 .0225 .0225 .0005 .0005 .0005 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Olivine |
| |
McCormick T C, Smyth J R, Lofgren G E |
| |
Physics and Chemistry of Minerals 14 (1987) 368-372 |
|
Site occupancies of minor elements in synthetic olivines as |
|
determined by channeling-enhanced X-ray emission |
|
Locality: sample from San Carlos, Arizona |
|
4.7641 10.2269 5.9952 90 90 90 Pbnm |
|
atom x y z occ B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
FeM1 0 0 0 .097 .0035 .00122 .00232 .00001 -.00037 -.00040 |
|
MgM1 0 0 0 .903 .0035 .00122 .00232 .00001 -.00037 -.00040 |
|
FeM2 .99000 .27770 .25 .093 .0049 .00082 .00278 .00011 0 0 |
|
MgM2 .99000 .27770 .25 .907 .0049 .00082 .00278 .00011 0 0 |
|
Si .42649 .09432 .25 .0020 .00069 .00193 .00004 0 0 |
|
O1 .7661 .09172 .25 .0027 .00131 .0029 .00022 0 0 |
|
O2 .2206 .44764 .25 .0044 .00074 .0034 .00004 0 0 |
|
O3 .2783 .16309 .0337 .0040 .00120 .0030 .00000 -.0002 .00048 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Stishovite |
|
Baur W H, Khan A A |
 |
Acta Crystallographica B27 (1971) 2133-2139 |
|
Rutile-type compounds. VI. |
|
SiO2, GeO2 and a comparison with other rutile-type structures |
|
Locality: Meteor Crater, Arizona, USA |
|
4.1790 4.1790 2.6649 90 90 90 P4_2/mnm |
|
atom x y z B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
Si 0 0 0 .0078 .0078 .0287 .0002 0 0 |
|
O .3062 .3062 0 .0112 .0112 .0347 .0005 0 0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Zunyite |
|
Baur W H, Ohta T |
|
Acta Crystallographica B38 (1982) 390-401 |
|
The Si5O16 pentamer in zunyite refined and empirical relations for individual |
|
silicon-oxygen bonds |
|
Locality: Quartzsite, Arizona, USA |
|
13.8654 13.8654 13.8654 90 90 90 F-43m |
|
atom x y z occ Biso |
|
Si1 .25 .25 .25 .31 |
|
Si2 .11430 .11430 .11430 .26 |
|
Al1 .75 .75 .75 .25 |
|
Al2 .08556 .08556 .76670 .35 |
|
O1 .82478 .82478 .82478 .35 |
|
O2 .18243 .18243 .18243 .89 |
|
O3 .27949 0 0 .66 |
|
O4 .17870 .17870 .54601 2/3 .63 |
|
F4 .17870 .17870 .54601 1/3 .63 |
|
O5 .13834 .13834 .00152 .44 |
|
Cl .5 .5 .5 .77 |
|
H1a .228 .228 .530 1/3 13.00 |
|
H1b .190 .190 .480 1/3 13.00 |
|
H2 .336 0 0 1.90 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Beaverite |
|
Breidenstein B, Schluter J, Gebhard G |
| |
Neues Jahrbuch fur Mineralogie, Monatshefte 1992 (1992) 213-220 |
|
On beaverite: new occurrence, chemical data and crystal structure |
|
Locality: Grand Reef mine, Graham County, Arizona, USA |
|
7.205 7.205 16.994 90 90 120 R-3m |
|
atom x y z Biso |
|
Pb 0 0 0 3.5 |
|
Fe .5 0 .5 3.5 |
|
S 0 0 .3156 1.5 |
|
O1 0 0 .4002 1.0 |
|
O2 .222 -.222 -.05 1.0 |
|
OH .1229 -.1229 .1367 1.0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Buttgenbachite |
|
Hibbs D E, Leverett P, Williams P A |
| |
Neues Jahrbuch fur Mineralogie, Monatshefte 2002 (2002) 225-240 |
|
Buttgenbachite from Bisbee, Arizona, USA: A single-crystal X-ray study |
|
Locality: Bisbee, Arizona, USA |
|
15.739 15.739 9.127 90 90 120 P6_3/mmc |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Cu1 .5 0 0 .011 .010 .014 .012 .007 -.001 -.002 |
|
Cu2 .2014 0 0 .011 .012 .010 .011 .005 .001 .002 |
|
Cu3 .3357 .16785 .75 .010 .013 .009 .009 .007 0 0 |
|
Cu4 .3586 .0165 .25 .010 .008 .011 .008 .002 0 0 |
|
Cl1 .2768 .1384 .25 .014 .016 .011 .016 .008 0 0 |
|
Cl3 0 0 0 .5 .015 .013 .013 .019 .006 0 0 |
|
OH1 .4501 .3699 .0912 .012 .015 .011 .009 .006 .003 .001 |
|
OH2 .0753 -.0753 .0991 .021 .014 .014 .023 -.002 .005 -.005 |
|
OH3 .6737 .7441 .1097 .012 .014 .012 .011 .008 .001 .001 |
|
OH4 .4423 .5577 .25 .009 .021 .021 .000 .021 0 0 |
|
N1 2/3 1/3 .25 .5 .013 |
|
Cl2 2/3 1/3 .25 .5 .013 |
|
O1 .6216 .3784 .25 .011 |
|
Wat .5100 .2552 .8070 .1 .011 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Junitoite |
|
Hamilton R D, Finney J J |
|
Mineralogical Magazine 49 (1985) 91-95 |
|
The structure of junitoite, CaZn2Si2O7*H2O |
|
Locality: Christmas mine, Gile County, Arizona, USA |
|
12.510 6.318 8.561 90 90 90 Ama2 |
|
atom x y z Biso |
|
Ca 1/4 .2462 .1119 .40 |
|
Zn1 0 0 .0000 1.23 |
|
Zn2 0 0 .4963 .15 |
|
Si .1316 .7348 .2359 .32 |
|
O1 .0437 .7438 .3764 .72 |
|
O2 .1213 .5314 .1360 1.10 |
|
O3 .1263 .9517 .1249 1.21 |
|
O4 1/4 .7721 .3270 .46 |
|
Wat 1/4 .2746 .3785 3.22 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Luetheite |
|
Burns P C, Smith J V, Steele I M |
|
Mineralogical Magazine 64 (2000) 25-30 |
|
Arizona porphyry copper/hydrothermal deposits I. |
|
The structure of chenevixite and luetheite |
|
Note: Luetheite-chenevixite series |
|
Locality: Humboldt mine, Patagonia, Arizona |
|
5.7012 5.1801 29.265 90 89.99 90 B2_1 |
|
atom x y z occ Uiso |
|
Cu1 .8659 .633 .1259 .0092 |
|
Cu2 .366 .646 .1245 .0100 |
|
AlM1 .122 .3848 .2145 .70 .0074 |
|
FeM1 .122 .3848 .2145 .30 .0074 |
|
AlM2 .625 .8860 .0343 .57 .0084 |
|
FeM2 .625 .8860 .0343 .43 .0084 |
|
As1 .8760 .6865 .9385 .0058 |
|
As2 .6176 .0923 .1886 .0087 |
|
O1 .857 .725 .9984 .0111 |
|
O2 .617 .020 .2421 .0231 |
|
O3 .865 .264 .1747 .0029 |
|
O4 .155 .553 .9245 .0474 |
|
O5 .886 .996 .9122 .0241 |
|
O6 .611 .821 .1574 .0175 |
|
O7 .646 .543 .9216 .0238 |
|
O8 .388 .279 .1754 .0125 |
|
OH1 .382 .552 .2555 .0344 |
|
OH2 .620 .215 .9997 .0173 |
|
OH3 .115 .682 .1713 .0087 |
|
OH4 .619 .549 .0808 .0405 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Khinite |
|
Cooper M A, Hawthorne F C, Back M E |
| |
Mineralogical Magazine 72 (2008) 763-770 |
|
The crystal structure of khinite and polytypism in khinite and parakhinite |
|
Locality: the Empire mine, Tombstone, Arizona, USA |
|
5.7491 10.0176 24.022 90 90 90 Fdd2 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .25 .25 .14110 .01294 .0140 .0100 .0148 -.0009 0 0 |
|
Te .5 0 .23761 .0072 .0130 .0007 .0079 -.0018 0 0 |
|
Cu(1) 0 0 .29395 .0082 .0067 .0059 .0119 -.0031 0 0 |
|
Cu(2) .25 .25 .29509 .0052 .0033 .0044 .0079 -.0002 0 0 |
|
Cu(3) .75 .25 .23861 .0089 .0149 .0031 .0088 -.0043 0 0 |
|
OH(1) .153 .1158 .3466 .010 |
|
O(2) .615 .1266 .1834 .009 |
|
O(3) .2002 .1007 .2401 .009 |
|
O(4) .6278 .1221 .2931 .012 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Emmonsite |
|
Pertlik F |
| |
Tschermaks Mineralogische und Petrographische Mitteilungen 18 (1972) 157-168 |
|
Der strukturtyp von emmonsit, {Fe2[TeO3]3*H2O}*xH2O (x=0-1) |
|
Locality: Tombstone, Arizona, USA |
|
7.90 8.00 7.62 96.73 95.00 84.47 P-1 |
|
atom x y z Biso |
|
Fe1 .19452 .02627 .96827 .41 |
|
Fe2 .30020 .47704 .51757 .42 |
|
Te1 .52645 .28821 .14098 .54 |
|
Te2 .02360 .34375 .20857 .52 |
|
Te3 .12548 .83745 .31807 .67 |
|
O1 .0053 .1124 .1448 .93 |
|
O2 .0740 .2057 .8079 .26 |
|
O3 .3122 .2220 .1131 1.15 |
|
O4 .3755 .9174 .8247 .78 |
|
O5 .2661 .8623 .1236 .31 |
|
O6 .1229 .3225 .4333 .93 |
|
O7 .2057 .6138 .3294 1.66 |
|
O8 .1948 .6277 .7103 1.61 |
|
O9 .4960 .3683 .3764 1.37 |
|
Wat .3857 .3149 .7150 2.14 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Stringhamite |
|
Hawthorne F C |
| |
Tschermaks Mineralogische und Petrographische Mitteilungen 34 (1985) 15-24 |
|
The crystal structure of stringhamite |
|
Locality: Christmas mine, Pinal County, Arizona, USA |
|
5.030 16.1350 5.343 90 102.96 90 P2_1/c |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ca .6496 .17671 .3464 .0089 .0093 .0102 .0074 .0004 .0027 .0001 |
|
Cu1 0 0 .5 .0091 .0108 .0102 .0062 .0016 .0019 -.0002 |
|
Cu2 .5 0 0 .0093 .0070 .0098 .0107 .0002 .0013 -.0010 |
|
Si .9802 .11123 -.0290 .0075 .0065 .0089 .0074 -.0001 .0022 -.0001 |
|
O1 .8995 .2058 .0268 .011 .0109 .0124 .0096 .0001 .0033 -.0011 |
|
O2 .8461 .0853 .6740 .013 .0160 .0117 .0109 .0065 .0037 -.0002 |
|
O3 .3129 .1023 .0383 .010 .0066 .0118 .0117 -.0005 .0029 -.0028 |
|
O4 .8419 .0541 .1691 .009 .0082 .0111 .0083 .0007 .0031 .0005 |
|
O5 .3525 .2094 .6257 .014 .0160 .0138 .0136 -.0009 .0066 .0044 |
|
H5A .319 .316 .222 .01 |
|
H5B .184 .258 .081 .01 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Mammothite |
|
Effenberger H |
| |
Tschermaks Mineralogische und Petrographische Mitteilungen 34 (1985) 279-288 |
|
The crystal structure of mammothite, Pb6Cu4AlSbO2(OH)16Cl4(SO4)2 |
|
Locality: Mammoth vein, Tiger, Arizona, USA |
|
18.93 7.33 11.35 90 112.44 90 C2/m |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .21037 0 .17947 .0179 .0186 .0232 .0159 0 .0051 0 |
|
Pb2 .42277 .25855 .20296 .0189 .0226 .0173 .0216 -.0022 .0064 -.0004 |
|
Cu1 .25 .25 .5 .0155 .0190 .0142 .0154 -.0019 .0027 -.0001 |
|
Cu2 .1042 0 .3685 .0151 .0167 .0168 .0178 0 .0078 0 |
|
Al 0 0 .5 .009 .0010 .014 .004 0 .002 0 |
|
Sb 0 0 0 .0143 .0149 .0174 .0129 0 .0029 0 |
|
O .0021 0 -.1695 .015 .023 .013 .018 0 .013 0 |
|
OH1 .2386 0 -.4393 .019 .018 .013 .030 0 .006 0 |
|
OH2 .0872 0 -.3442 .017 .008 .017 .025 0 -.001 0 |
|
OH3 .0831 .1854 .0426 .019 .020 .024 .018 -.001 .005 .003 |
|
OH4 .0409 .1717 .4173 .016 .022 .013 .021 .006 .008 .008 |
|
OH5 .1695 .1833 .3398 .014 .020 .014 .013 -.004 .005 .002 |
|
Cl1 .3679 0 .3963 .030 .035 .030 .025 0 -.002 0 |
|
Cl2 .4491 0 -.1995 .023 .029 .019 .028 0 .008 0 |
|
S1 .2497 0 -.0953 .015 .013 .021 .014 0 .003 0 |
|
OS1 .1776 0 -.0709 .020 .005 .039 .021 0 .005 0 |
|
OS2 .3103 0 .0298 .036 .015 .064 .029 0 .000 0 |
|
OS3 .2482 .1596 -.1686 .034 .047 .028 .030 -.010 .006 .006 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Ajoite |
|
Pluth J J, Smith J V |
| |
Proceedings of the National Academy of Sciences of the United States of America 99 (2002) 11002-11005 |
|
Arizona porphyry copper/hydrothermal deposits II: |
|
Crystal structure of ajoite, (K+Na)3Cu20Al3Si29O76(OH)16*~8H2O |
|
13.634 13.687 14.522 110.833 107.208 105.680 P-1 |
|
atom x y z occ Uiso |
|
K .4955 -.0269 .0001 .5 .38 |
|
Cu1 .0905 .2149 .4795 .06 |
|
Cu2 .2917 .1663 .4821 .06 |
|
Cu3 -.3123 .3137 .4739 .07 |
|
Cu4 -.1117 .2633 .4739 .07 |
|
Cu5 .6937 .0674 .4870 .07 |
|
Cu6 -.5122 .3618 .4779 .08 |
|
Cu7 .4904 .1143 .4814 .05 |
|
Cu8 .8985 .0236 .4971 .06 |
|
Cu9 .0948 .4663 .4917 .08 |
|
Cu10 .2895 .4106 .4811 .08 |
|
Si1 .6643 .3950 .7006 .05 |
|
Si2 .0701 .3064 .7035 .05 |
|
Si3 .4619 .4426 .7031 .07 |
|
Si4 .2748 .2604 .7058 .05 |
|
Si5 -.0713 .4667 .2873 .06 |
|
Si6 .1296 .4192 .2741 .08 |
|
Si7 .6719 .1773 .7118 .05 |
|
Si8 .7100 -.0524 .2641 .07 |
|
Si9 .5006 -.0103 .2554 .06 |
|
Si10 .8838 .1424 .7223 .06 |
|
Si11 -.2735 .2659 .2552 .07 |
|
Si12 -.2213 .0602 .1340 .5 .10 |
|
Al12 -.2213 .0602 .1340 .5 .10 |
|
Si13 .8941 .0292 .8708 .75 .09 |
|
Al13 .8941 .0292 .8708 .25 .09 |
|
Si14 .3420 .0763 .1332 .5 .11 |
|
Al14 .3420 .0763 .1332 .5 .11 |
|
Si15 .0095 .1594 .1263 .75 .10 |
|
Al15 .0095 .1594 .1263 .25 .10 |
|
Si16 -.4746 .3171 .2625 .07 |
|
O1 .0064 .2350 .5707 .06 |
|
O2 .2093 .1867 .5737 .06 |
|
O3 .6127 .0964 .5795 .08 |
|
O4 .7754 .0377 .3951 .09 |
|
OH5 .3784 .1511 .3979 .12 |
|
O6 .5675 .0819 .3852 .09 |
|
OH7 .4062 .1326 .5717 .10 |
|
OH8 .1812 .2064 .3988 .11 |
|
O9 -.2284 .2968 .3830 .14 |
|
OH10 .9850 .0041 .4113 .14 |
|
OH11 -.0152 .2624 .4004 .11 |
|
O12 .8203 .0566 .5921 .08 |
|
O13 -.4252 .3529 .3914 .11 |
|
OH14 .2084 .4287 .5734 .11 |
|
O15 -.0092 .5202 .4187 .08 |
|
O16 .6069 .3324 .5678 .08 |
|
O17 .4066 .3796 .5711 .07 |
|
OH18 .7972 .2725 .5554 .11 |
|
O19 .1816 .4601 .4041 .11 |
|
O20 .5889 .4500 .7500 .13 |
|
O21 .2109 .5035 .2467 .16 |
|
O22 .9944 .2541 .7561 .15 |
|
O23 -.1907 .3607 .2371 .16 |
|
O24 .7999 .1910 .7636 .15 |
|
O25 .6778 .3047 .7452 .15 |
|
O26 .2969 .0272 -.0006 .20 |
|
O27 -.0935 .5595 .2513 .16 |
|
O28 .9270 .0820 .7927 .18 |
|
O29 .6896 -.1836 .2402 .15 |
|
O30 -.2887 .1410 .1764 .17 |
|
O31 -.4690 .4287 .2449 .16 |
|
O32 -.3963 .2689 .2113 .12 |
|
O33 .0073 .4247 .2335 .16 |
|
O34 .9320 -.0756 .8510 .30 |
|
O35 .3984 -.1238 .2325 .14 |
|
O36 .1120 .2912 .2001 .19 |
|
O37 .4489 .0417 .1793 .12 |
|
O38 -.0901 .1485 .1699 .19 |
|
O39 .3887 .3713 .7466 .14 |
|
O40 .7808 -.0187 .2002 .16 |
|
O41 .5847 -.0557 .2126 .12 |
|
O42 .9606 .1315 .9971 .24 |
|
O43 .1918 .3038 .7518 .14 |
|
O44 -.6046 .2217 .1934 .17 |
|
O45 .7562 -.0253 .8291 .19 |
|
OH46 -.6211 .4054 .3988 .14 |
|
Wat1 .2462 .2448 -.0039 .73 |
|
Wat2 .1059 .3156 -.0031 .61 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Papagoite |
|
Groat L A, Hawthorne F C |
| |
Mineralogy and Petrology 37 (1987) 89-96 |
|
Refinement of the structure of papagoite, CaCuAlSi2O6(OH)3 |
|
Locality: Ajo, Pima County, Arizona, USA |
|
Note: U(1,1)(O3) changed from .0068 to match reported Uiso |
|
12.926 11.496 4.696 90 100.81 90 C2/m |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ca 0 .1553 .5 .0110 .0049 .0097 .0177 0 .0006 0 |
|
Cu .26873 .5 .4461 .0077 .0088 .0049 .0081 0 -.0018 0 |
|
Al .25 .25 .5 .0051 .0047 .0059 .0053 .0007 .0022 -.0003 |
|
Si .38740 .13238 .0678 .0049 .0040 .0054 .0056 -.0003 .0011 -.0009 |
|
O1 .2005 .3697 .2259 .0086 .0101 .0066 .0079 -.0002 -.0018 .0000 |
|
O2 .1631 .1268 .3073 .0074 .0087 .0065 .0069 -.0001 .0002 .0007 |
|
O3 .4234 .5 .2317 .0080 .0086 .0072 .0077 0 -.0015 0 |
|
O4 0 .3198 0 .0110 .0073 .0106 .0162 0 .0045 0 |
|
O5 .3615 .2209 .3058 .0089 .0076 .0106 .0095 -.0001 .0043 -.0033 |
|
O6 .4013 0 .1931 .0110 .0135 .0074 .0109 0 -.0030 0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Connellite |
|
Hibbs D E, Leverett P, Williams P A |
| |
Axis 2 (2006) 1-7 |
|
Connellite from Bisbee, Arizona: A single-crystal X-ray study |
|
Locality: Bisbee, Arizona, USA |
|
15.7866 15.7866 9.1015 90 90 120 P6_3/mmc |
|
atom x y z occ Uiso |
|
Cu(1) .5 0 0 .25 .014 |
|
Cu(2) .2011 0 0 .5 .012 |
|
Cu(3) .3364 .1682 .75 .25 .010 |
|
Cu(4) .3585 .0165 .25 .5 .010 |
|
Cl(3) 0 0 0 .043 .011 |
|
Cl(1) .2772 .1386 .25 .25 .012 |
|
OH1 .4504 .3707 .0918 .012 |
|
OH2 .0749 -.0749 .0989 .5 .020 |
|
OH3 .6744 .7442 .1102 .011 |
|
OH4 .4424 .5576 .25 .25 .014 |
|
OW .5070 .2540 .75 .040 .017 |
|
Cl(4) 2/3 1/3 .25 .034 .015 |
|
N(1) 2/3 1/3 .25 .021 .015 |
|
O(1a) .6226 .3774 .25 .063 .017 |
|
O(1b) .6150 .3850 .25 .084 .017 |
|
S(1) 2/3 1/3 .2999 .028 .014 |
|
O(1c) 2/3 1/3 .4620 .028 .014 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Khinite-4O |
|
Cooper M A, Hawthorne F C, Back M E |
| |
Mineralogical Magazine 72 (2008) 763-770 |
|
The crystal structure of khinite and polytypism in khinite and parakhinite |
|
Locality: the Empire mine, Tombstone, Arizona, USA |
|
5.7491 10.0176 24.022 90 90 90 Fdd2 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .25 .25 .14110 .01294 .0140 .0100 .0148 -.0009 0 0 |
|
Te .5 0 .23761 .0072 .0130 .0007 .0079 -.0018 0 0 |
|
Cu(1) 0 0 .29395 .0082 .0067 .0059 .0119 -.0031 0 0 |
|
Cu(2) .25 .25 .29509 .0052 .0033 .0044 .0079 -.0002 0 0 |
|
Cu(3) .75 .25 .23861 .0089 .0149 .0031 .0088 -.0043 0 0 |
|
OH(1) .153 .1158 .3466 .010 |
|
O(2) .615 .1266 .1834 .009 |
|
O(3) .2002 .1007 .2401 .009 |
|
O(4) .6278 .1221 .2931 .012 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
|
Beaverite-(Cu) |
|
Breidenstein B, Schluter J, Gebhard G |
| |
Neues Jahrbuch fur Mineralogie, Monatshefte 1992 (1992) 213-220 |
|
On beaverite: new occurrence, chemical data and crystal structure |
|
Locality: Grand Reef mine, Graham County, Arizona, USA |
|
7.205 7.205 16.994 90 90 120 R-3m |
|
atom x y z Biso |
|
Pb 0 0 0 3.5 |
|
Fe .5 0 .5 3.5 |
|
S 0 0 .3156 1.5 |
|
O1 0 0 .4002 1.0 |
|
O2 .222 -.222 -.05 1.0 |
|
OH .1229 -.1229 .1367 1.0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure
|
| |
Multiple datasets can be concatenated into a single downloadable file by
selecting the datasets and then hitting the "Download Selected Data" button.
