|
Ransomite |
 |
Wood M M |
 |
American Mineralogist 55 (1970) 729-734 |
|
The crystal structure of ransomite |
|
Locality: United Verde mine, Jerome, Arizona, USA |
|
_database_code_amcsd 0000203 |
|
4.811 16.217 10.403 90 93.02 90 P2_1/c |
|
atom x y z Biso |
|
Cu 0 0 0 1.33 |
|
Fe .7377 .6272 .0223 .81 |
|
S1 .7906 .2869 .1399 .82 |
|
S2 .2502 .5298 .1704 .60 |
|
O1 .0309 .2144 .5549 1.57 |
|
O2 .5880 .1470 .5927 1.62 |
|
O3 .6687 .2922 .6322 2.33 |
|
O4 .8927 .1906 .7713 2.05 |
|
O5 .1427 .4554 .0999 1.24 |
|
O6 .0705 .5999 .1405 1.25 |
|
O7 .5340 .5474 .1267 1.17 |
|
O8 .2717 .5128 .3098 1.58 |
|
Wat1 .7150 .0661 .9072 1.28 |
|
Wat2 .3508 .2814 .8570 1.18 |
|
Wat3 .1937 .1065 .0483 2.40 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Shattuckite |
 |
Evans H T, Mrose M E |
 |
American Mineralogist 62 (1977) 491-502 |
|
The crystal chemistry of the hydrous copper silicates, shattuckite and |
|
plancheite |
|
Note: sample is from Ajo, Arizona |
|
_database_code_amcsd 0000578 |
|
9.885 19.832 5.3825 90 90 90 Pcab |
|
atom x y z U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Cu1 .5 0 .5 .0088 .0079 .0093 -.0032 -.0030 .0042 |
|
Cu2 .33090 .02547 .03970 .0095 .0080 .0073 -.0025 -.0014 .0020 |
|
Cu3 .25205 .28125 .46765 .0108 .0046 .0066 .0001 -.0025 -.0004 |
|
Si1 .54485 .13502 .2173 .0062 .0039 .0052 -.0004 .0014 .0006 |
|
Si2 .39742 .15706 .7265 .0064 .0034 .0053 .0001 -.0002 .0003 |
|
O1 .5054 .0554 .1996 .0105 .0051 .0067 -.0038 -.0029 .0031 |
|
O2 .3426 .0805 .7439 .0157 .0032 .0119 -.0029 -.0022 .0024 |
|
O3 .7076 .1512 .2203 .0051 .0057 .0083 -.0024 .0005 .0018 |
|
O4 .4913 .1735 .9708 .0101 .0073 .0061 -.0014 -.0007 -.0010 |
|
O5 .4907 .1670 .4777 .0136 .0071 .0069 .0007 .0029 -.0037 |
|
O6 .2836 .2163 .7193 .0109 .0051 .0043 .0032 -.0023 -.0023 |
|
Oh7 .6779 .0243 .6426 .0091 .0059 .0069 -.0021 .0016 -.0002 |
|
H .71 .435 .63 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Davidite-(La) |
 |
Gatehouse B M, Grey I E, Kelly P R |
 |
American Mineralogist 64 (1979) 1010-1017 |
|
The crystal structure of davidite |
|
Locality: Pandora Prospect, Quijotoa Mts., Pima County, Arizona, USA |
|
_database_code_amcsd 0000749 |
|
9.190 9.190 9.190 68.73 68.73 68.73 R-3 |
|
atom x y z occ Biso |
|
La(0) 0 0 0 .540 1.17 |
|
Ca(0) 0 0 0 .200 1.17 |
|
Sr(0) 0 0 0 .090 1.17 |
|
La(1) .5 .5 .5 .370 0.53 |
|
U(1) .5 .5 .5 .330 0.53 |
|
Y(1) .5 .5 .5 .300 0.53 |
|
Fe(2) .3090 .3090 .3090 .790 0.47 |
|
Mg(2) .3090 .3090 .3090 .120 0.47 |
|
Fe(3) .3474 .1269 .0184 .762 0.51 |
|
Ti(3) .3474 .1269 .0184 .112 0.51 |
|
Cr(3) .3474 .1269 .0184 .035 0.51 |
|
Ti(4) .3086 .7218 .1448 0.34 |
|
Ti(5) .4749 .0775 .6444 0.30 |
|
O(1) .2999 .6300 .3765 0.54 |
|
O(2) .1486 .2347 .9391 0.49 |
|
O(3) .9192 .4574 .3025 0.43 |
|
O(4) .1446 .5137 .9897 0.55 |
|
O(5) .3891 .4869 .1345 0.52 |
|
O(6) .7131 .2404 .0688 0.48 |
|
O(7) .2134 .2134 .2134 0.59 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Weeksite |
 |
Stohl F V, Smith D K |
 |
American Mineralogist 66 (1981) 610-625 |
|
The crystal chemistry of the uranyl silicate minerals |
|
Locality: Anderson mine, Yavapai County, Arizona, USA |
|
_database_code_amcsd 0000839 |
|
7.106 17.900 7.087 90 90 90 Amm2 |
|
atom x y z |
|
U1 0 .198 0 |
|
Si 0 .130 .523 |
|
O1 .25 .307 .546 |
|
O2 0 .180 .693 |
|
O2b 0 .180 .307 |
|
O3 .194 .071 .487 |
|
O4 0 .429 .473 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Dumortierite |
 |
Alexander V D, Griffen D T, Martin T J |
 |
American Mineralogist 71 (1986) 786-794 |
|
Crystal chemistry of some Fe- and Ti-poor dumortierites |
|
Sample: #2, BYU 12-5027, from Yuma Co., Arizona, USA |
|
_database_code_amcsd 0001022 |
|
11.786 20.209 4.692 90 90 90 Pmcn |
|
atom x y z occ U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Si1 .75 .4053 .0877 .0042 .0114 .0031 0 0 .0009 |
|
Si2 .5240 .3281 .5876 .99 .0082 .0070 .0032 -.0004 .0004 .0003 |
|
Al1 .75 .2502 .3981 .93 .0067 .0122 .0836 0 0 -.0043 |
|
Al2 .6103 .4722 .5573 .98 .0044 .0058 .0026 .0003 -.0003 -.0004 |
|
Al3 .4913 .4307 .0595 .97 .0044 .0048 .0018 -.0006 .0000 .0001 |
|
Al4 .3581 .2893 .0578 .99 .0073 .0075 .0053 .0011 -.0005 -.0002 |
|
B .25 .4159 .2284 .0030 .0012 .0114 0 0 .0003 |
|
O1 .75 .4537 .3788 .0058 .0213 .0060 0 0 -.0038 |
|
O2 .75 .3258 .1488 .0102 .0216 .0099 0 0 .0024 |
|
O3 .6390 .4242 .8967 .0076 .0171 .0045 -.0006 .0002 .0022 |
|
O4 .4364 .2824 .4014 .0104 .0143 .0054 -.0025 .0021 -.0018 |
|
O5 .5496 .3933 .3972 .0135 .0070 .0061 -.0009 -.0015 .0005 |
|
O6 .4537 .3504 .8846 .0137 .0093 .0066 -.0021 .0030 -.0018 |
|
O7 .6396 .2868 .6479 .0154 .0129 .0091 .0016 -.0023 .0009 |
|
O8 .25 .3500 .1685 .0038 .0102 .0212 0 0 -.0032 |
|
O9 .3507 .4482 .2553 .0059 .0109 .0119 -.0041 .0011 -.0021 |
|
O10 .25 .2723 .7603 .0048 .0145 .0060 0 0 -.0022 |
|
O11 .4663 .4881 .7505 .0057 .0072 .0047 .0006 .0004 .0000 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Beryl |
 |
Aurisicchio C, Fioravanti G, Grubessi O, Zanazzi P F |
 |
American Mineralogist 73 (1988) 826-837 |
|
Reappraisal of the crystal chemistry of beryl |
|
Sample: 6 |
|
Locality: Mohave county, Arizona, USA |
|
_database_code_amcsd 0001175 |
|
9.2531 9.2531 9.1918 90 90 120 P6/mcc |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Si1 .3863 .1139 0 .0051 .0046 .0036 .0026 0 0 |
|
Be .5 0 .25 .959 .008 |
|
Li .5 0 .25 .033 .008 |
|
Si2 .5 0 .25 .008 .008 |
|
Al 2/3 1/3 .25 .826 .0064 .0064 .0063 .0032 0 0 |
|
Fe1 2/3 1/3 .25 .02 .0064 .0064 .0063 .0032 0 0 |
|
Fe2 2/3 1/3 .25 .097 .0064 .0064 .0063 .0032 0 0 |
|
Mg 2/3 1/3 .25 .058 .0064 .0064 .0063 .0032 0 0 |
|
O1 .3064 .2326 0 .0143 .0120 .0172 .0103 0 0 |
|
O2 .4960 .1434 .1451 .0123 .0115 .0067 .0073 -.0026 -.0009 |
|
Na 0 0 .25 .315 .0321 .0321 .0239 .0161 0 0 |
|
Cs 0 0 .25 .04 .0321 .0321 .0239 .0161 0 0 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chalcophanite |
 |
Post J E, Appleman D E |
 |
American Mineralogist 73 (1988) 1401-1404 |
|
Chalcophanite, ZnMn3O7.3(H2O): New crystal-structure determinations |
|
Locality: Bisbee, Arizona |
|
Note: U(1,2) of O3 altered to match symmetry constraints |
|
Note: H positions determined by energy modelling |
|
_database_code_amcsd 0001204 |
|
7.533 7.533 20.794 90 90 120 R-3 |
|
atom x y z U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Mn .71869 .57771 .99948 .0057 .0058 .0090 .0029 .0002 .0001 |
|
Zn 0 0 .09997 .0100 .0100 .0117 .0050 0 0 |
|
O1 .52784 .62297 .04721 .0098 .0083 .0080 .0050 .0000 -.0005 |
|
O2 .26077 .20655 .05048 .0097 .0095 .0122 .0055 .0028 .0026 |
|
O3 0 0 .71250 .0093 .0093 .0063 .00465 0 0 |
|
O4 .17900 .93107 .16435 .0152 .0182 .0160 .0073 -.0028 .0004 |
|
H1 .229 .025 .198 |
|
H2 .310 .940 .144 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Artroeite |
 |
Kampf A R, Foord E E |
 |
American Mineralogist 80 (1995) 179-183 |
|
Artroeite, PbAlF3(OH)2, a new mineral from the Grand Reef mine, Graham County, |
|
Arizona: Description and crystal structure |
|
_database_code_amcsd 0001717 |
|
6.270 6.821 5.057 90.68 107.69 104.46 P-1 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .30975 .19142 .20352 .00866 .00607 .0140 .00235 .00339 .00156 |
|
Al .8110 .3273 .8364 .0085 .0047 .0100 .0016 .0031 .0012 |
|
F1 .7950 .1378 .5751 .017 .0069 .015 .0030 .009 .0003 |
|
F2 .7407 .4891 .5627 .012 .0081 .011 .0043 .002 .0028 |
|
F3 .5137 .2308 .8113 .009 .0105 .023 .0001 .006 .002 |
|
Oh1 .8629 .5514 .0981 .008 .0073 .013 .0027 .005 .001 |
|
Oh2 .8981 .1432 .0988 .010 .0076 .007 .0030 .003 .0021 |
|
H1 .807 .509 .253 .02 |
|
H2 .862 .122 .255 .02 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Carmichaelite |
|
Wang L, Rouse R C, Essene E J, Peacor D R, Zhang Y |
 |
American Mineralogist 85 (2000) 792-800 |
|
Carmichaelite, a new hydroxyl-bearing titanate from Garnet Ridge, Arizona |
|
_database_code_amcsd 0002458 |
|
7.706 4.5583 20.187 90 92.334 90 P2_1/c |
|
atom x y z occ Biso |
|
Ti1 .5 0 0 1.3 |
|
Ti2 .0562 .007 .3113 .94 .30 |
|
V2 .0562 .007 .3113 .06 .30 |
|
Ti3 .4128 .992 .3691 .975 .34 |
|
Nb3 .4128 .992 .3691 .025 .34 |
|
Ti4 .1328 .999 .9448 .57 |
|
Cr5 .3271 .000 .7396 .775 .65 |
|
Cr6 .2187 .016 .5747 .27 .7 |
|
Fe6 .2187 .016 .5747 .17 .7 |
|
Al6 .2187 .016 .5747 .18 .7 |
|
Mg7 .2799 .040 .2046 .14 .6 |
|
Fe8 .2375 .021 .1051 .31 .5 |
|
Mg8 .2375 .021 .1051 .16 .5 |
|
O1 .703 .293 .4866 2.5 |
|
O2 .259 .255 .8074 1.1 |
|
O3 .173 .283 .1637 2.1 |
|
O4 .807 .283 .1193 1.7 |
|
O5 .624 .215 .3502 .9 |
|
O6 .066 .252 .0206 2.6 |
|
O7 .355 .286 .4372 2.3 |
|
O8 .523 .253 .2140 2.7 |
|
O9 .889 .240 .2564 .9 |
|
O10 .986 .233 .3930 1.2 |
|
O11 .436 .283 .0731 2.3 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Alpersite |
|
Peterson R C, Hammarstrom J M, Seal R R |
 |
American Mineralogist 91 (2006) 261-269 |
|
Alpersite (Mg,Cu)SO4*7H2O, a new mineral of the melanterite group, and cuprian |
|
pentahydrite: Their occurrence within mine waste |
|
Locality: Miami, Arizona, USA |
|
_database_code_amcsd 0004015 |
|
14.189 6.547 10.830 90 105.872 90 P2_1/c |
|
atom x y z occ U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Mg1 0 0 0 .845 .027 .024 .035 .003 .010 .004 |
|
Cu1 0 0 0 .155 .027 .024 .035 .003 .010 .004 |
|
Mg2 .5 .5 0 .265 .029 .0300 .0247 .0044 .0064 .0019 |
|
Cu2 .5 .5 0 .735 .029 .0300 .0247 .0044 .0064 .0019 |
|
S .22865 .4672 .1741 .0307 .0310 .0363 .0006 .0102 .0003 |
|
O1 .2017 .4691 .0321 .049 .046 .030 .007 .008 .001 |
|
O2 .1444 .5431 .2181 .048 .050 .059 .015 .033 .012 |
|
O3 .3152 .6028 .2240 .047 .044 .050 .018 .009 .011 |
|
O4 .2538 .2569 .2221 .050 .036 .055 .008 .009 .007 |
|
Wat1 .1057 .3789 .4256 .067 .063 .064 .030 .037 .024 |
|
Wat2 .1047 .9562 .1773 .051 .043 .046 .004 .003 .003 |
|
Wat3 .0286 .7911 .4300 .045 .034 .050 .003 .011 .008 |
|
Wat4 .4814 .4530 .1737 .043 .048 .036 .004 .013 .001 |
|
Wat5 .4294 .2645 .4391 .049 .040 .043 .007 .007 .007 |
|
Wat6 .3480 .8390 .4413 .051 .053 .045 .008 .006 .007 |
|
Wat7 .3682 .0085 .1131 .049 .036 .049 .001 .008 .004 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Pentahydrite |
 |
Peterson R C, Hammarstrom J M, Seal R R |
 |
American Mineralogist 91 (2006) 261-269 |
|
Alpersite (Mg,Cu)SO4*7H2O, a new mineral of the melanterite group, and cuprian |
|
pentahydrite: Their occurrence within mine waste |
|
Locality: Miami, Arizona, USA |
|
_database_code_amcsd 0004017 |
|
6.2470 10.5995 6.0395 82.530 109.408 104.794 P-1 |
|
atom x y z occ Uiso |
|
Mg1 0 0 0 .1 .056 |
|
Cu1 0 0 0 .9 .056 |
|
Mg2 .5 .5 0 .7 .037 |
|
Cu2 .5 .5 0 .3 .037 |
|
S .0368 .2935 .6402 .039 |
|
O1 .911 .1662 .666 .037 |
|
O2 .263 .3227 .847 .037 |
|
O3 .872 .3720 .639 .037 |
|
O4 .053 .2958 .411 .037 |
|
Wat1 .821 .0687 .178 .037 |
|
Wat2 .312 .1161 .173 .037 |
|
Wat3 .535 .5917 .671 .037 |
|
Wat4 .230 .5917 .988 .037 |
|
Wat5 .446 .1289 .647 .037 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Aravaipaite |
 |
Kampf A R, Yang H, Downs R T, Pinch W W |
|
American Mineralogist 96 (2011) 402-407 |
|
The crystal structures and Raman spectra of aravaipaite and calcioaravaipaite |
|
Locality: Grand Reef mine, Aravaipa mining district, Arizona, USA |
|
_database_code_amcsd 0018320 |
|
5.6637 5.8659 12.7041 98.725 94.020 90.683 P-1 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .30470 .11693 .36471 .01512 .01590 .01373 .01576 .00132 .00129 .00219 |
|
Pb2 .76753 .04754 .11751 .02400 .0365 .01645 .0190 -.00141 .00197 .00279 |
|
Pb3 .27468 .51132 .11789 .01756 .01676 .01772 .0179 .00000 .00200 .00137 |
|
Al .7940 .6181 .3082 .0124 .0098 .0129 .0145 .0012 .0001 .0022 |
|
F1 .0486 .7745 .2740 .0265 .025 .026 .027 -.007 .013 -.006 |
|
F2 .7369 .5094 .1661 .0249 .027 .033 .014 -.002 -.001 .000 |
|
F3 .8488 .7199 .4455 .0290 .024 .047 .015 .000 .002 .001 |
|
F4 .5192 .4752 .3306 .0257 .022 .025 .031 -.009 .001 .007 |
|
F5 .6158 .8676 .2863 .0265 .030 .019 .034 .013 .013 .009 |
|
F6 .9587 .3635 .3170 .0394 .035 .032 .052 .016 -.005 .011 |
|
F7 .4996 .2430 .9924 .0188 .020 .017 .019 .0015 .000 .003 |
|
F8 .0007 .2475 .9953 .0176 .019 .020 .013 .0015 -.0028 .0019 |
|
F9 .2942 .1283 .1710 .0407 .083 .025 .014 .000 .000 .004 |
|
OW .6621 .2257 .5128 .0200 .013 .020 .027 .000 .005 .000 |
|
H1 .597 .338 .555 .050 |
|
H2 .814 .253 .509 .050 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Calcioaravaipaite |
 |
Kampf A R, Yang H, Downs R T, Pinch W W |
|
American Mineralogist 96 (2011) 402-407 |
|
The crystal structures and Raman spectra of aravaipaite and calcioaravaipaite |
|
Locality: Grand Reef mine, Aravaipa mining district, Arizona, USA |
|
_database_code_amcsd 0018321 |
|
5.3815 5.3846 12.2034 91.364 101.110 91.525 P-1 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .27238 .28211 .107209 .01678 .01998 .01783 .01279 .00242 .00367 -.00039 |
|
Ca1 .04213 .75777 .61450 .00876 .0094 .0074 .0095 .00025 .0019 .00039 |
|
Ca2 .44851 .73503 .38616 .00891 .0092 .0077 .0097 -.00027 .0016 .00065 |
|
Al .20387 .20662 .81864 .00910 .0098 .0092 .0083 -.0003 .0017 .0006 |
|
F1 .8481 .0489 .09603 .0234 .0285 .0199 .0233 .0002 .0080 .0075 |
|
F2 .7419 .5504 .27419 .0165 .0189 .0136 .0195 .0030 .0087 .0071 |
|
F3 .3698 .0017 .73490 .0141 .0152 .0125 .0154 .0030 .0045 .0003 |
|
F4 .0419 .4057 .90021 .0180 .0219 .0186 .0147 .0060 .0058 -.0011 |
|
F5 .9168 .1103 .72148 .0169 .0117 .0169 .0198 .0011 -.0025 -.0042 |
|
F6 .5004 .2955 .90746 .0226 .0156 .0273 .0220 -.0029 -.0028 -.0032 |
|
F7 .2517 .0076 .50112 .0118 .0122 .0098 .0136 .0012 .0024 .0011 |
|
F8 .2503 .5117 .50560 .0116 .0120 .0103 .0130 -.0002 .0038 -.0002 |
|
F9 .2567 .3857 .29105 .0154 .0185 .0154 .0126 -.0043 .0051 -.0035 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Markascherite |
|
Yang H, Jenkins R A, Thompson R M, Downs R T, Evans S H, Bloch E M |
|
American Mineralogist 97 (2012) 197-202 |
|
Markascherite, Cu3(MoO4)(OH)4, a new mineral species polymorphic with szenicsite, |
|
from Copper Creek, Pinal County, Arizona, U.S.A. |
|
Locality: Copper Creek, Pinal County, Arizona, USA |
|
_database_code_amcsd 0018649 |
|
9.9904 5.9934 5.5255 90 97.428 90 P2_1/m |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Cu1 -.00037 .25 -.00385 .0103 .0161 .0065 .0090 0 .0040 0 |
|
Cu2 0 .5 .5 .0098 .0139 .0074 .0086 -.0001 .0039 .0009 |
|
Cu3 .5 .5 0 .0130 .0125 .0114 .0163 -.0004 .0071 .0002 |
|
Mo .32101 .25 .42366 .0098 .0092 .0107 .0099 0 .0022 0 |
|
O1 .1432 .25 .3533 .0138 .011 .015 .015 0 .001 0 |
|
O2 .3940 .25 .1365 .0153 .014 .016 .017 0 .008 0 |
|
O3 .3636 .0137 .5975 .0210 .021 .020 .022 .0040 .000 .0073 |
|
OH4 .1016 .75 .4040 .0126 .014 .009 .015 0 .001 0 |
|
OH5 .3922 .75 .0855 .0159 .014 .018 .017 0 .007 0 |
|
OH6 .0913 .5029 .8514 .0115 .011 .011 .013 -.0002 .003 .0011 |
|
H1 .173 .75 .44 .03 |
|
H2 .367 .75 .25 .03 |
|
H3 .165 .516 .837 .03 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Weeksite |
 |
Fejfarova K, Plasil J, Yang H, Cejka J, Dusek M, Downs R T, Barkley M C, Skoda R |
|
American Mineralogist 97 (2012) 750-754 |
|
Revision of the crystal structure and chemical formula of weeksite, |
|
K2(UO2)2(Si5O13)*4H2O |
|
Locality: Anderson mine, Arizona, USA |
|
_database_code_amcsd 0018760 |
|
14.1957 14.2291 9.6305 90 111.578 90 C2/m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
U1 .099331 .246786 .89678 .01189 .00807 .01867 .00959 .00057 .00403 .00072 |
|
K1 -.0707 0 .8602 .951 .0369 .0280 .0310 .057 0 .0224 0 |
|
K2 .2460 0 .8433 .930 .054 .058 .040 .089 0 .055 0 |
|
Si1 0 .3068 .5 .0166 .0133 .0244 .0121 0 .0046 0 |
|
Si2 .18748 .24984 .2495 .0116 .0094 .0180 .0080 .0011 .0038 -.0010 |
|
Si3 .29855 .10998 .5004 .0184 .0220 .0156 .0192 -.0011 .0095 .0000 |
|
O1 .4105 .1224 .4996 .033 .020 .030 .052 -.005 .018 -.002 |
|
O2 .0712 .2440 .1370 .023 .006 .055 .007 .000 .001 -.001 |
|
O3 .2472 .2551 .1367 .024 .009 .055 .009 .000 .005 -.001 |
|
O4 .0366 .2437 .6473 .023 .024 .037 .008 .003 .006 .006 |
|
O5 .2162 .1560 .3546 .027 .028 .026 .021 -.001 .002 .011 |
|
O6 .2705 0 .4998 .022 .029 .012 .029 0 .013 0 |
|
O7 .2892 .1573 .6467 .026 .036 .018 .027 -.003 .016 -.007 |
|
O8 .1020 .1201 .9055 .029 .035 .019 .040 -.001 .021 .001 |
|
O9 .0990 .3727 .8972 .032 .036 .020 .042 -.003 .016 -.003 |
|
Wat10 .4310 0 .8411 .053 .033 .040 .073 0 .005 0 |
|
Wat11 -.2624 0 .8441 .98 .059 .059 .052 .073 0 .034 0 |
|
Wat12 0 0 .5 .72 .036 |
|
Wat13 0 -.079 .5 .259 .036 |
|
Wat14 -.0464 -.0614 .602 .281 .036 |
|
Wat15 -.0917 -.0636 .398 .264 .036 |
|
Wat16 -.445 0 .702 .24 .024 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Enstatite |
 |
Zhang J S, Dera P, Bass J D |
|
American Mineralogist 97 (2012) 1070-1074 |
|
A new high-pressure phase transition in natural Fe-bearing orthoenstatite |
|
Locality: San Carlos, Arizona, USA |
|
Note: P = 12.66 GPa |
|
_database_code_amcsd 0019068 |
|
17.868 8.491 5.0565 90 90 90 Pbca |
|
atom x y z occ Uiso |
|
Mg1 .3762 .6585 .8537 .973 .007 |
|
Mg2 .3780 .4790 .3482 .853 .009 |
|
Fe1 .3762 .6585 .8537 .027 .007 |
|
Fe2 .3780 .4790 .3482 .147 .009 |
|
SiA .2706 .3446 .0331 .006 |
|
SiB .4726 .3382 .8052 .006 |
|
O1a .1818 .3404 .0201 .007 |
|
O2a .3086 .5120 .0287 .008 |
|
O3a .3045 .2247 -.1868 .010 |
|
O1b .5630 .3383 .8114 .008 |
|
O2b .4333 .4886 .6826 .010 |
|
O3b .4444 .1890 .6169 .009 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Enstatite |
 |
Zhang J S, Dera P, Bass J D |
|
American Mineralogist 97 (2012) 1070-1074 |
|
A new high-pressure phase transition in natural Fe-bearing orthoenstatite |
|
Locality: San Carlos, Arizona, USA |
|
Note: P = 14.26 GPa |
|
_database_code_amcsd 0019069 |
|
17.87 8.526 4.9485 90 92.88 90 P2_1/c |
|
atom x y z occ Uiso |
|
Mg1-1 .3759 .6574 .8231 .96 .009 |
|
Mg1-2 .1254 .3419 .3658 .95 .008 |
|
Mg2-1 .3826 .4820 .3282 .84 .0116 |
|
Mg2-2 .1247 .5275 .8672 .88 .009 |
|
Fe1-1 .3759 .6574 .8231 .04 .009 |
|
Fe1-2 .1254 .3419 .3658 .05 .008 |
|
Fe2-1 .3826 .4820 .3282 .16 .0116 |
|
Fe2-2 .1247 .5275 .8672 .12 .009 |
|
SiA-1 .2716 .3414 .0258 .0069 |
|
SiA-2 .2271 .6572 .4422 .0092 |
|
SiB-1 .4721 .3398 .8079 .0084 |
|
SiB-2 .0249 .6585 .3125 .0101 |
|
O1a-1 .1835 .3414 .0380 .006 |
|
O1a-2 .3157 .6630 .4710 .004 |
|
O2a-1 .3112 .5080 -.0120 .005 |
|
O2a-2 .1871 .5030 .5470 .014 |
|
O3a-1 .3046 .2090 .8390 .010 |
|
O3a-2 .1968 .7020 .1280 .014 |
|
O1b-1 .5637 .3340 .8280 .010 |
|
O1b-2 .9370 .6520 .3080 .006 |
|
O2b-1 .4368 .4960 .6780 .010 |
|
O2b-2 .0619 .5152 .1850 .001 |
|
O3b-1 .4447 .1854 .6200 .010 |
|
O3b-2 .0534 .8130 .1310 .007 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Rongibbsite |
|
Yang H, Downs R T, Evans S H, Jenkins R A, Bloch E M |
|
American Mineralogist 98 (2013) 236-241 |
|
Rongibbsite, Pb2(Si4Al)O11(OH), a new zeolitic aluminosilicate mineral with an |
|
interrupted framework from Maricopa County, Arizona, U.S.A. |
|
Locality: Big Horn Mountains, Maricopa County, Arizona, USA |
|
_database_code_amcsd 0019710 |
|
7.8356 13.9132 10.2775 90 92.925 90 I2/m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .09729 .34602 .34367 .802 .01822 .02299 .01679 .01477 .00332 -.00019 -.00136 |
|
Pb' .10313 .33075 .34924 .198 .02774 .03159 .03245 .01811 .01856 -.00932 -.00819 |
|
SiT1 .32365 .39185 .66099 .01126 .01366 .01013 .01001 .00024 .00085 -.00102 |
|
SiT2 .19392 .11266 .53609 .80 .01088 .01048 .01006 .01205 -.00017 -.00003 .00034 |
|
AlT2 .19392 .11266 .53609 .20 .01088 .01048 .01006 .01205 -.00017 -.00003 .00034 |
|
AlT3 .5 .24649 .5 .60 .00733 .00710 .00566 .00922 0 .00026 0 |
|
SiT3 .5 .24649 .5 .40 .00733 .00710 .00566 .00922 0 .00026 0 |
|
O1 .23932 .12479 .69315 .01883 .02209 .02019 .01452 -.00242 .00407 .00043 |
|
O2 0 .15506 .5 .02141 .01415 .01941 .03045 0 -.00098 0 |
|
O3 .20846 0 .48925 .01874 .02521 .00985 .02106 0 .00016 0 |
|
O4 .15728 .37490 .56303 .01828 .01770 .02095 .01589 -.00006 -.00200 -.00264 |
|
O5 .39855 .5 .64981 .01673 .01796 .01091 .02179 0 .00553 0 |
|
O6 .32993 .17896 .45812 .01740 .01756 .01858 .01618 .00052 .00197 .00046 |
|
O7 .47538 .31765 .63132 .01602 .01528 .01290 .01986 .00518 .00051 -.00404 |
|
O8H .12819 .5 .28393 .04113 .06374 .02491 .03556 0 .01063 0 |
|
H .24320 .5 .30933 .03000 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Wherryite |
|
Cooper M A, Hawthorne F C |
 |
The Canadian Mineralogist 32 (1994) 373-380 |
|
The crystal structure of wherryite, Pb7Cu2(SO4)4(SiO4)2(OH)2, a mixed |
|
sulfate-silicate with [M(TO4)2] chains |
|
Locality: Mammoth-St Anthony mine, Tiger, Pinal County, Arizona, USA |
|
_database_code_amcsd 0005365 |
|
20.789 5.787 9.142 90 91.24 90 C2/m |
|
atom x y z U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .1434 0 .2632 .029 .026 .026 0 .004 0 |
|
Pb2 .4739 0 .7061 .028 .031 .021 0 .001 0 |
|
Pb3 .3419 0 .3212 .028 .036 .028 0 -.001 0 |
|
Pb4 0 0 0 .037 .028 .030 0 -.004 0 |
|
Cu .25 .25 0 .025 .021 .022 .002 .003 0 |
|
S1 .2668 0 .6575 .027 .019 .017 0 .004 0 |
|
S2 .4318 .5 .3475 .021 .021 .020 0 .003 0 |
|
Si .3960 0 -.0089 .028 .023 .026 0 .005 0 |
|
O1 .3192 0 .030 .027 .017 .038 0 .009 0 |
|
O2 .3356 0 .615 .041 .032 .032 0 .014 0 |
|
O3 .4173 .216 -.110 .032 .025 .015 .005 .005 0 |
|
O4 .2235 0 .531 .033 .040 .025 0 -.009 0 |
|
O5 .3850 .5 .222 .036 .044 .024 0 -.005 0 |
|
O6 .4351 0 .148 .043 .028 .026 0 .007 0 |
|
O7 .2576 .206 -.251 .038 .036 .019 0 .007 -.001 |
|
O8 .4236 .293 .438 .040 .062 .033 -.006 -.002 .009 |
|
O9 .5036 .5 -.285 .019 .054 .056 0 .003 0 |
|
O10 .3091 .5 -.029 .025 .030 .021 0 -.005 0 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Winstanleyite |
 |
Bindi L, Cipriani C |
 |
The Canadian Mineralogist 41 (2003) 1469-1473 |
|
The crystal structure of winstanleyite, TiTe3O8, from the |
|
Grand Central Mine, Tombstone, Arizona |
|
Locality: Grand Central Mine, Tombstone, Arizona |
|
_database_code_amcsd 0005922 |
|
10.965 10.965 10.965 90 90 90 I2_1/a-3 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ti 0 0 0 .0244 .0244 .0244 .0244 -.0001 -.0001 -.0001 |
|
Te .20907 0 .25 .0274 .0275 .0274 .0274 0 0 .0001 |
|
O1 .4386 .1333 .3987 .0224 .0228 .0228 .0227 -.0002 -.0003 -.0002 |
|
O2 .1729 .1729 .1729 .0225 .0225 .0225 .0225 .0005 .0005 .0005 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Georgerobinsonite |
|
Cooper M A, Ball N A, Hawthorne F C, Paar W H, Roberts A C, Moffatt E |
|
The Canadian Mineralogist 49 (2011) 865-876 |
|
Georgerobinsonite, Pb4(CrO4)2(OH)2FCl, a new chromate mineral from the |
|
Mammoth-St. Anthony mine, Tiger, Pinal County, Arizona: description and crystal structure |
|
Locality: Mammoth-St. Anthony mine, Tiger, Pinal County, Arizona, USA |
|
_database_code_amcsd 0018387 |
|
7.6256 11.6081 6.8961 90 90 90 *Pmmn |
|
.25 .25 0 |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb(1) .25 .59690 .12642 .02183 .0256 .0233 .0166 0 0 -.0031 |
|
Pb(2) .50242 .25 .41670 .02025 .0147 .0239 .0221 0 -.00089 0 |
|
Cr .25 .49812 .6485 .0129 .0134 .0135 .0117 0 0 -.0015 |
|
Cl .25 .2284 .0720 .5 .0217 |
|
F .75 .25 .1327 .027 .035 .034 .011 0 0 0 |
|
O(1) .4226 .5121 .7804 .0264 .023 .033 .023 .006 -.003 -.006 |
|
O(2) .25 .6070 .4931 .0232 .028 .021 .021 0 0 -.000 |
|
O(3) .25 .3763 .5289 .0235 .023 .016 .032 0 0 -.003 |
|
Oh4 .4388 .75 .2306 .0166 .014 .019 .016 0 -.001 0 |
|
H .550 .75 .159 .02 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Forsterite |
 |
McCormick T C, Smyth J R, Lofgren G E |
|
Physics and Chemistry of Minerals 14 (1987) 368-372 |
|
Site occupancies of minor elements in synthetic olivines as |
|
determined by channeling-enhanced X-ray emission |
|
Locality: sample from San Carlos, Arizona |
|
_database_code_amcsd 0007438 |
|
4.7641 10.2269 5.9952 90 90 90 Pbnm |
|
atom x y z occ B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
FeM1 0 0 0 .097 .0035 .00122 .00232 .00001 -.00037 -.00040 |
|
MgM1 0 0 0 .903 .0035 .00122 .00232 .00001 -.00037 -.00040 |
|
FeM2 .99000 .27770 .25 .093 .0049 .00082 .00278 .00011 0 0 |
|
MgM2 .99000 .27770 .25 .907 .0049 .00082 .00278 .00011 0 0 |
|
Si .42649 .09432 .25 .0020 .00069 .00193 .00004 0 0 |
|
O1 .7661 .09172 .25 .0027 .00131 .0029 .00022 0 0 |
|
O2 .2206 .44764 .25 .0044 .00074 .0034 .00004 0 0 |
|
O3 .2783 .16309 .0337 .0040 .00120 .0030 .00000 -.0002 .00048 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Stishovite |
 |
Baur W H, Khan A A |
 |
Acta Crystallographica B27 (1971) 2133-2139 |
|
Rutile-type compounds. VI. |
|
SiO2, GeO2 and a comparison with other rutile-type structures |
|
Locality: Meteor Crater, Arizona, USA |
|
_database_code_amcsd 0009403 |
|
4.1790 4.1790 2.6649 90 90 90 P4_2/mnm |
|
atom x y z B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
Si 0 0 0 .0078 .0078 .0287 .0002 0 0 |
|
O .3062 .3062 0 .0112 .0112 .0347 .0005 0 0 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Zunyite |
 |
Baur W H, Ohta T |
 |
Acta Crystallographica B38 (1982) 390-401 |
|
The Si5O16 pentamer in zunyite refined and empirical relations for individual |
|
silicon-oxygen bonds |
|
Locality: Quartzsite, Arizona, USA |
|
_database_code_amcsd 0009752 |
|
13.8654 13.8654 13.8654 90 90 90 F-43m |
|
atom x y z occ Biso |
|
Si1 .25 .25 .25 .31 |
|
Si2 .11430 .11430 .11430 .26 |
|
Al1 .75 .75 .75 .25 |
|
Al2 .08556 .08556 .76670 .35 |
|
O1 .82478 .82478 .82478 .35 |
|
O2 .18243 .18243 .18243 .89 |
|
O3 .27949 0 0 .66 |
|
O4 .17870 .17870 .54601 2/3 .63 |
|
F4 .17870 .17870 .54601 1/3 .63 |
|
O5 .13834 .13834 .00152 .44 |
|
Cl .5 .5 .5 .77 |
|
H1a .228 .228 .530 1/3 13.00 |
|
H1b .190 .190 .480 1/3 13.00 |
|
H2 .336 0 0 1.90 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Junitoite |
 |
Yang H, Jenkins N G, Downs R T |
 |
Acta Crystallographica E68 (2012) i73-i73 |
|
Redetermination of junitoite, CaZn2Si2O7*H2O |
|
Locality: Christmas Mine, Gila County, Arizona, USA |
|
_database_code_amcsd 0019356 |
|
12.5302 6.3056 8.5617 90 90 90 Aba2 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ca 0 .5 .51882 .00899 .01062 .00784 .00850 .00019 0 0 |
|
Zn .25216 .24453 .13494 .00808 .00755 .00739 .00931 -.00067 .00070 -.00072 |
|
Si .11827 .00274 .39406 .00615 .00563 .00687 .00596 -.00022 .00019 .00035 |
|
O1 .12311 .29919 .01003 .01075 .00841 .01119 .01263 -.00097 -.00197 .00459 |
|
O2 .12739 .21991 .49272 .00990 .00865 .01091 .01015 .00190 -.00265 -.00348 |
|
O3 .20596 -.00482 .25347 .01007 .01237 .00798 .00987 -.00005 .00448 .00027 |
|
O4 0 0 .30367 .00819 .00629 .01121 .00706 .00000 0 0 |
|
OW5 0 .5 .25181 .02088 .02719 .02784 .00761 .00997 0 0 |
|
H .03502 .44843 .20019 .03 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Connellite |
 |
Hibbs D E, Leverett P, Williams P A |
  |
Axis 2 (2006) 1-7 |
|
Connellite from Bisbee, Arizona: A single-crystal X-ray study |
|
Locality: Bisbee, Arizona, USA |
|
_database_code_amcsd 0012063 |
|
15.7866 15.7866 9.1015 90 90 120 P6_3/mmc |
|
atom x y z occ Uiso |
|
Cu(1) .5 0 0 .25 .014 |
|
Cu(2) .2011 0 0 .5 .012 |
|
Cu(3) .3364 .1682 .75 .25 .010 |
|
Cu(4) .3585 .0165 .25 .5 .010 |
|
Cl(3) 0 0 0 .043 .011 |
|
Cl(1) .2772 .1386 .25 .25 .012 |
|
OH1 .4504 .3707 .0918 .012 |
|
OH2 .0749 -.0749 .0989 .5 .020 |
|
OH3 .6744 .7442 .1102 .011 |
|
OH4 .4424 .5576 .25 .25 .014 |
|
OW .5070 .2540 .75 .040 .017 |
|
Cl(4) 2/3 1/3 .25 .034 .015 |
|
N(1) 2/3 1/3 .25 .021 .015 |
|
O(1a) .6226 .3774 .25 .063 .017 |
|
O(1b) .6150 .3850 .25 .084 .017 |
|
S(1) 2/3 1/3 .2999 .028 .014 |
|
O(1c) 2/3 1/3 .4620 .028 .014 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Conichalcite |
 |
Sakai S, Yoshiasa A, Sugiyama K, Miyawaki R |
|
Journal of Mineralogical and Petrological Sciences 104 (2009) 125-131 |
|
Crystal structure and chemistry of conichalcite, CaCu(AsO4)(OH) |
|
Locality: Higgins mine, Arizona, USA |
|
_database_code_amcsd 0018380 |
|
7.3849 5.8379 9.1937 90 90 90 P2_12_12_1 |
|
atom x y z occ Uiso |
|
Ca .1168 .2706 .4258 .0082 |
|
Cu .0050 -.0004 .7494 .96 .0093 |
|
Mg .0050 -.0004 .7494 .04 .0093 |
|
As .3681 -.2350 .5802 .0081 |
|
O1 .1884 -.255 .6983 .011 |
|
O2 .541 -.167 .6912 .016 |
|
O3 .387 .514 .4908 .015 |
|
O4 .355 -.007 .4697 .012 |
|
O5 .139 .254 .6814 .010 |
|
H .25 .26 .72 .03 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Junitoite |
 |
Hamilton R D, Finney J J |
 |
Mineralogical Magazine 49 (1985) 91-95 |
|
The structure of junitoite, CaZn2Si2O7*H2O |
|
Locality: Christmas mine, Gile County, Arizona, USA |
|
_database_code_amcsd 0014480 |
|
12.510 6.318 8.561 90 90 90 Ama2 |
|
atom x y z Biso |
|
Ca 1/4 .2462 .1119 .40 |
|
Zn1 0 0 .0000 1.23 |
|
Zn2 0 0 .4963 .15 |
|
Si .1316 .7348 .2359 .32 |
|
O1 .0437 .7438 .3764 .72 |
|
O2 .1213 .5314 .1360 1.10 |
|
O3 .1263 .9517 .1249 1.21 |
|
O4 1/4 .7721 .3270 .46 |
|
Wat 1/4 .2746 .3785 3.22 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Luetheite |
 |
Burns P C, Smith J V, Steele I M |
 |
Mineralogical Magazine 64 (2000) 25-30 |
|
Arizona porphyry copper/hydrothermal deposits I. |
|
The structure of chenevixite and luetheite |
|
Note: Luetheite-chenevixite series |
|
Locality: Humboldt mine, Patagonia, Arizona |
|
_database_code_amcsd 0014539 |
|
5.7012 5.1801 29.265 90 89.99 90 B2_1 |
|
atom x y z occ Uiso |
|
Cu1 .8659 .633 .1259 .0092 |
|
Cu2 .366 .646 .1245 .0100 |
|
AlM1 .122 .3848 .2145 .70 .0074 |
|
FeM1 .122 .3848 .2145 .30 .0074 |
|
AlM2 .625 .8860 .0343 .57 .0084 |
|
FeM2 .625 .8860 .0343 .43 .0084 |
|
As1 .8760 .6865 .9385 .0058 |
|
As2 .6176 .0923 .1886 .0087 |
|
O1 .857 .725 .9984 .0111 |
|
O2 .617 .020 .2421 .0231 |
|
O3 .865 .264 .1747 .0029 |
|
O4 .155 .553 .9245 .0474 |
|
O5 .886 .996 .9122 .0241 |
|
O6 .611 .821 .1574 .0175 |
|
O7 .646 .543 .9216 .0238 |
|
O8 .388 .279 .1754 .0125 |
|
OH1 .382 .552 .2555 .0344 |
|
OH2 .620 .215 .9997 .0173 |
|
OH3 .115 .682 .1713 .0087 |
|
OH4 .619 .549 .0808 .0405 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Khinite |
 |
Cooper M A, Hawthorne F C, Back M E |
|
Mineralogical Magazine 72 (2008) 763-770 |
|
The crystal structure of khinite and polytypism in khinite and parakhinite |
|
Locality: the Empire mine, Tombstone, Arizona, USA |
|
_database_code_amcsd 0014583 |
|
5.7491 10.0176 24.022 90 90 90 Fdd2 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .25 .25 .14110 .01294 .0140 .0100 .0148 -.0009 0 0 |
|
Te .5 0 .23761 .0072 .0130 .0007 .0079 -.0018 0 0 |
|
Cu(1) 0 0 .29395 .0082 .0067 .0059 .0119 -.0031 0 0 |
|
Cu(2) .25 .25 .29509 .0052 .0033 .0044 .0079 -.0002 0 0 |
|
Cu(3) .75 .25 .23861 .0089 .0149 .0031 .0088 -.0043 0 0 |
|
OH(1) .153 .1158 .3466 .010 |
|
O(2) .615 .1266 .1834 .009 |
|
O(3) .2002 .1007 .2401 .009 |
|
O(4) .6278 .1221 .2931 .012 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Khinite-4O |
 |
Cooper M A, Hawthorne F C, Back M E |
|
Mineralogical Magazine 72 (2008) 763-770 |
|
The crystal structure of khinite and polytypism in khinite and parakhinite |
|
Locality: the Empire mine, Tombstone, Arizona, USA |
|
Note: This is the original khinite, now distinguished as the -4O polytype |
|
_database_code_amcsd 0014584 |
|
5.7491 10.0176 24.022 90 90 90 Fdd2 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .25 .25 .14110 .01294 .0140 .0100 .0148 -.0009 0 0 |
|
Te .5 0 .23761 .0072 .0130 .0007 .0079 -.0018 0 0 |
|
Cu(1) 0 0 .29395 .0082 .0067 .0059 .0119 -.0031 0 0 |
|
Cu(2) .25 .25 .29509 .0052 .0033 .0044 .0079 -.0002 0 0 |
|
Cu(3) .75 .25 .23861 .0089 .0149 .0031 .0088 -.0043 0 0 |
|
OH(1) .153 .1158 .3466 .010 |
|
O(2) .615 .1266 .1834 .009 |
|
O(3) .2002 .1007 .2401 .009 |
|
O(4) .6278 .1221 .2931 .012 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Bobmeyerite |
|
Kampf A R, Pluth J J, Chen Y S, Roberts A C, Housley R M |
|
Mineralogical Magazine 77 (2013) 81-91 |
|
Bobmeyerite, a new mineral from Tiger, Arizona, USA, structurally related |
|
to cerchiaraite and ashburtonite |
|
Locality: Tiger mine, Arizona, USA |
|
_database_code_amcsd 0019796 |
|
13.969 14.243 5.893 90 90 90 Pnnm |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .72313 .48502 0 .0312 .0477 .0294 .0163 -.0031 0 0 |
|
Pb2 .51318 .71552 0 .0300 .0354 .0381 .0166 -.0036 0 0 |
|
Al .7684 .2688 .7506 .82 .0226 .033 .029 .006 .013 .001 -.0006 |
|
Cu .7684 .2688 .7506 .18 .0226 .033 .029 .006 .013 .001 -.0006 |
|
Si1 .5942 .6270 .5 .0202 .025 .028 .008 -.006 0 0 |
|
Si2 .6296 .4081 .5 .0184 .032 .016 .008 .008 0 0 |
|
O1 .6323 .5200 .5 .031 .040 .023 .030 -.002 0 0 |
|
O2 .4787 .6313 .5 .028 .030 .036 .018 -.016 0 0 |
|
O3 .6314 .6780 .274 .024 .041 .025 .004 -.017 .000 .000 |
|
O4 .6803 .3691 .728 .021 .025 .026 .013 -.002 -.004 -.005 |
|
OH5 .7036 .2162 0 .035 .035 .044 .027 .007 0 0 |
|
OH6 .7105 .2051 .5 .034 .033 .026 .042 .007 0 0 |
|
OH7 .6591 .8225 0 .025 .014 .030 .031 .008 0 0 |
|
OH8 .8258 .3398 0 .039 .017 .061 .038 .013 0 0 |
|
Cl .5 .5 0 .030 .044 .031 .016 -.001 0 0 |
|
Wat9 .630 .028 0 .75 .17 |
|
S9 .630 .028 0 .125 .17 |
|
Si9 .630 .028 0 .125 .17 |
|
O9 .630 .028 0 .5 .17 |
|
Wat10 .032 .366 0 .75 .22 |
|
S10 .032 .366 0 .125 .22 |
|
Si10 .032 .366 0 .125 .22 |
|
O10 .032 .366 0 .5 .22 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chalcoalumite |
 |
Hawthorne F C, Cooper M A |
|
Mineralogical Magazine 77 (2013) 2901-2912 |
|
The crystal structure of chalcoalumite: mechanisms of Jahn-Teller-driven |
|
distortion in [6]Cu2+-containing oxysalts |
|
Locality: Bisbee, Arizona, USA |
|
_database_code_amcsd 0019969 |
|
10.228 8.929 17.098 90 95.800 90 P2_1/n |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Cu .74871 .50020 .49406 .01027 .00500 .00812 .01797 -.00049 .00255 -.00068 |
|
Al1 .00286 .32667 .50357 .00993 .0055 .0093 .0151 -.00034 .00200 -.00019 |
|
Al2 .49758 .67520 .50148 .01061 .0057 .0091 .0173 .00002 .00222 .00035 |
|
Al3 .25324 .16052 .49944 .01033 .0069 .0078 .0165 -.00023 .00250 -.00001 |
|
Al4 .24511 -.15945 .49702 .01109 .0072 .0079 .0187 -.00053 .00353 -.00041 |
|
S .48868 .10515 .74290 .01769 .01837 .0210 .01360 -.00112 .00114 .00011 |
|
O1 .58554 .50007 .55216 .0116 .0089 .0102 .0154 -.0005 -.0000 .0002 |
|
O2 .91756 .49687 .44494 .0102 .0081 .0104 .0121 -.0006 .0008 -.0005 |
|
O3 .65339 .32353 .44067 .0129 .0099 .0131 .0163 .0012 .0044 .0020 |
|
O4 .85631 .31444 .56145 .0136 .0106 .0135 .0177 -.0045 .0063 -.0043 |
|
O5 .11276 .19553 .56067 .0127 .0095 .0128 .0164 .0017 .0042 .0042 |
|
O6 .18188 .00447 .43737 .0136 .0107 .0099 .0195 -.0006 -.0028 -.0005 |
|
O7 .64111 .68906 .44022 .0115 .0089 .0112 .0148 -.0025 .0032 -.0019 |
|
O8 .84633 .67318 .55416 .0116 .0086 .0129 .0139 .0015 .0032 .0020 |
|
O9 -.10271 .19348 .44411 .0127 .0091 .0121 .0176 -.0021 .0043 -.0043 |
|
O10 .60574 .80479 .56145 .0131 .0094 .0125 .0181 -.0018 .0045 -.0046 |
|
O11 .38867 -.19697 .44224 .0132 .0084 .0127 .0193 .0023 .0049 .0045 |
|
O12 .31366 -.00303 .55849 .0135 .0102 .0094 .0202 -.0002 -.0030 .0004 |
|
O13 .52462 .02155 .67381 .0229 .0269 .0240 .0184 .0016 .0054 -.0015 |
|
O14 .91716 .49570 .29136 .0347 .0456 .0411 .0189 .0175 .0099 .0003 |
|
O15 .60893 .16165 .78789 .0315 .0262 .0413 .0253 -.0078 -.0066 -.0018 |
|
O16 .40475 .23331 .71722 .0309 .0319 .0322 .0280 .0124 .0004 -.0015 |
|
O17 -.15408 -.22030 .21994 .0313 .0278 .0317 .0353 .0021 .0077 .0020 |
|
Wat18 .7238 .4046 .6941 .697 .0473 .053 .058 .0321 -.0225 .0092 -.0071 |
|
Wat18A .8427 .2656 .7217 .350 .069 .071 .090 .044 -.033 .003 -.003 |
|
Wat18B .6612 .506 .7044 .436 .126 .073 .27 .036 -.065 .014 -.015 |
|
O19 -.0313 .01001 .31308 .0344 .0444 .0315 .0262 -.0024 -.0013 .0020 |
|
H1 -.2444 -.221 .234 .101 |
|
H2 -.124 -.3226 .232 .093 |
|
H5 -.046 .0993 .2800 .045 |
|
H6 -.063 -.075 .2805 .079 |
|
H7 .611 .495 .6089 .045 |
|
H8 .913 .491 .38751 .029 |
|
H9 .652 .313 .3836 .033 |
|
H10 .855 .320 .619 .044 |
|
H11 .097 .121 .6007 .063 |
|
H12 .122 .010 .3890 .045 |
|
H13 .624 .702 .3832 .026 |
|
H14 .862 .668 .61160 .032 |
|
H15 -.085 .128 .4003 .056 |
|
H16 .590 .869 .6060 .051 |
|
H17 .406 -.135 .3972 .056 |
|
H18 .382 -.005 .6029 .059 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Papagoite |
 |
Groat L A, Hawthorne F C |
  |
Mineralogy and Petrology 37 (1987) 89-96 |
|
Refinement of the structure of papagoite, CaCuAlSi2O6(OH)3 |
|
Locality: Ajo, Pima County, Arizona, USA |
|
Note: U(1,1)(O3) changed from .0068 to match reported Uiso |
|
_database_code_amcsd 0014616 |
|
12.926 11.496 4.696 90 100.81 90 C2/m |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ca 0 .1553 .5 .0110 .0049 .0097 .0177 0 .0006 0 |
|
Cu .26873 .5 .4461 .0077 .0088 .0049 .0081 0 -.0018 0 |
|
Al .25 .25 .5 .0051 .0047 .0059 .0053 .0007 .0022 -.0003 |
|
Si .38740 .13238 .0678 .0049 .0040 .0054 .0056 -.0003 .0011 -.0009 |
|
O1 .2005 .3697 .2259 .0086 .0101 .0066 .0079 -.0002 -.0018 .0000 |
|
O2 .1631 .1268 .3073 .0074 .0087 .0065 .0069 -.0001 .0002 .0007 |
|
O3 .4234 .5 .2317 .0080 .0086 .0072 .0077 0 -.0015 0 |
|
O4 0 .3198 0 .0110 .0073 .0106 .0162 0 .0045 0 |
|
O5 .3615 .2209 .3058 .0089 .0076 .0106 .0095 -.0001 .0043 -.0033 |
|
O6 .4013 0 .1931 .0110 .0135 .0074 .0109 0 -.0030 0 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Manganbabingtonite |
 |
Nagashima M, Mitani K, Akasaka M |
  |
Mineralogy and Petrology 108 (2014) 287-301 |
|
Structural variation of babingtonite depending on cation |
|
distribution at the octahedral sites |
|
Note: Sample 6 |
|
Locality: Iron Cap mine, Graham County, Arizona, USA |
|
_database_code_amcsd 0020458 |
|
7.4967 11.6632 6.7014 91.602 93.989 104.574 P-1 |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ca1 .78527 .94188 .14065 .01425 .0205 .0139 .0076 .0029 .0017 -.0016 |
|
Ca2 .23699 .51981 .30439 .01319 .0131 .0158 .0097 .0027 .0002 -.0036 |
|
Fe1 .59341 .64493 .06234 .23 .01079 .0125 .0131 .0065 .0029 .00079 -.00077 |
|
Mn1 .59341 .64493 .06234 .74 .01079 .0125 .0131 .0065 .0029 .00079 -.00077 |
|
Mg1 .59341 .64493 .06234 .03 .01079 .0125 .0131 .0065 .0029 .00079 -.00077 |
|
Fe2 .04515 .23514 .18576 .97 .00927 .0116 .0104 .0056 .0025 .00010 -.00092 |
|
Al2 .04515 .23514 .18576 .03 .00927 .0116 .0104 .0056 .0025 .00010 -.00092 |
|
Si1 .28630 .05405 .34250 .0113 .0144 .0122 .0066 .0027 -.0004 -.0006 |
|
Si2 .46026 .31431 .42419 .01001 .0114 .0124 .0059 .0027 .0000 -.0007 |
|
Si3 .80683 .44495 .20928 .00951 .0112 .0118 .0053 .0026 .0004 -.0014 |
|
Si4 .98996 .71407 .30967 .01015 .0128 .0112 .0062 .0029 .0003 -.0012 |
|
Si5 .32797 .83740 .10741 .0109 .0130 .0124 .0072 .0031 .0009 -.0009 |
|
O1 .1968 .9893 .5365 .0170 .0220 .0162 .0099 -.0004 .0014 .0008 |
|
O2 .1285 .0802 .1856 .0129 .0156 .0160 .0073 .0044 .0003 -.0004 |
|
O3 .4331 .17216 .4356 .0143 .0179 .0111 .0126 .0029 -.0039 -.0001 |
|
O4 .3163 .3385 .2463 .0122 .0150 .0135 .0075 .0032 -.0002 .0004 |
|
O5 .5496 .6195 .3668 .0137 .0140 .0160 .0097 .0018 .0012 -.0024 |
|
O6 .6772 .3712 .3724 .0119 .0119 .0162 .0072 .0028 -.0002 .0007 |
|
O7 .9696 .3842 .1599 .0135 .0138 .0151 .0116 .0039 .0013 -.0027 |
|
O8 .6796 .4729 .0248 .0128 .0142 .0154 .0082 .0024 .0013 .0009 |
|
O9 .9266 .56918 .3367 .0123 .0162 .0108 .0087 .0019 -.0011 -.0021 |
|
O10 .8744 .7564 .1255 .0134 .0153 .0157 .0093 .0039 .0014 .0009 |
|
O11 .0185 .2210 .4790 .0149 .0203 .0147 .0093 .0036 .0021 -.0035 |
|
O12 .2054 .7371 .2493 .0129 .0138 .0156 .0088 .0028 .0003 .0006 |
|
O13 .5115 .8026 .0575 .0153 .0167 .0183 .0123 .0068 .0028 .0008 |
|
O14 .8047 .1412 .0816 .0141 .0171 .0151 .0082 .0012 -.0010 -.0010 |
|
O15 .3917 .9682 .2291 .0158 .0175 .0144 .0141 .0025 -.0006 -.0046 |
|
H1 .119 .9078 .524 .050 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Beaverite |
 |
Breidenstein B, Schluter J, Gebhard G |
  |
Neues Jahrbuch fur Mineralogie, Monatshefte 1992 (1992) 213-220 |
|
On beaverite: new occurrence, chemical data and crystal structure |
|
Locality: Grand Reef mine, Graham County, Arizona, USA |
|
_database_code_amcsd 0014860 |
|
7.205 7.205 16.994 90 90 120 R-3m |
|
atom x y z Biso |
|
Pb 0 0 0 3.5 |
|
Fe .5 0 .5 3.5 |
|
S 0 0 .3156 1.5 |
|
O1 0 0 .4002 1.0 |
|
O2 .222 -.222 -.05 1.0 |
|
OH .1229 -.1229 .1367 1.0 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Beaverite-(Cu) |
 |
Breidenstein B, Schluter J, Gebhard G |
  |
Neues Jahrbuch fur Mineralogie, Monatshefte 1992 (1992) 213-220 |
|
On beaverite: new occurrence, chemical data and crystal structure |
|
Locality: Grand Reef mine, Graham County, Arizona, USA |
|
_database_code_amcsd 0014861 |
|
7.205 7.205 16.994 90 90 120 R-3m |
|
atom x y z Biso |
|
Pb 0 0 0 3.5 |
|
Fe .5 0 .5 3.5 |
|
S 0 0 .3156 1.5 |
|
O1 0 0 .4002 1.0 |
|
O2 .222 -.222 -.05 1.0 |
|
OH .1229 -.1229 .1367 1.0 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Buttgenbachite |
 |
Hibbs D E, Leverett P, Williams P A |
  |
Neues Jahrbuch fur Mineralogie, Monatshefte 2002 (2002) 225-240 |
|
Buttgenbachite from Bisbee, Arizona, USA: A single-crystal X-ray study |
|
Locality: Bisbee, Arizona, USA |
|
_database_code_amcsd 0014920 |
|
15.739 15.739 9.127 90 90 120 P6_3/mmc |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Cu1 .5 0 0 .011 .010 .014 .012 .007 -.001 -.002 |
|
Cu2 .2014 0 0 .011 .012 .010 .011 .005 .001 .002 |
|
Cu3 .3357 .16785 .75 .010 .013 .009 .009 .007 0 0 |
|
Cu4 .3586 .0165 .25 .010 .008 .011 .008 .002 0 0 |
|
Cl1 .2768 .1384 .25 .014 .016 .011 .016 .008 0 0 |
|
Cl3 0 0 0 .5 .015 .013 .013 .019 .006 0 0 |
|
OH1 .4501 .3699 .0912 .012 .015 .011 .009 .006 .003 .001 |
|
OH2 .0753 -.0753 .0991 .021 .014 .014 .023 -.002 .005 -.005 |
|
OH3 .6737 .7441 .1097 .012 .014 .012 .011 .008 .001 .001 |
|
OH4 .4423 .5577 .25 .009 .021 .021 .000 .021 0 0 |
|
N1 2/3 1/3 .25 .5 .013 |
|
Cl2 2/3 1/3 .25 .5 .013 |
|
O1 .6216 .3784 .25 .011 |
|
Wat .5100 .2552 .8070 .1 .011 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Ajoite |
 |
Pluth J J, Smith J V |
  |
Proceedings of the National Academy of Sciences 99 (2002) 11002-11005 |
|
Arizona porphyry copper/hydrothermal deposits II: |
|
Crystal structure of ajoite, (K+Na)3Cu20Al3Si29O76(OH)16*~8H2O |
|
_database_code_amcsd 0015331 |
|
13.634 13.687 14.522 110.833 107.208 105.680 P-1 |
|
atom x y z occ Uiso |
|
K .4955 -.0269 .0001 .5 .38 |
|
Cu1 .0905 .2149 .4795 .06 |
|
Cu2 .2917 .1663 .4821 .06 |
|
Cu3 -.3123 .3137 .4739 .07 |
|
Cu4 -.1117 .2633 .4739 .07 |
|
Cu5 .6937 .0674 .4870 .07 |
|
Cu6 -.5122 .3618 .4779 .08 |
|
Cu7 .4904 .1143 .4814 .05 |
|
Cu8 .8985 .0236 .4971 .06 |
|
Cu9 .0948 .4663 .4917 .08 |
|
Cu10 .2895 .4106 .4811 .08 |
|
Si1 .6643 .3950 .7006 .05 |
|
Si2 .0701 .3064 .7035 .05 |
|
Si3 .4619 .4426 .7031 .07 |
|
Si4 .2748 .2604 .7058 .05 |
|
Si5 -.0713 .4667 .2873 .06 |
|
Si6 .1296 .4192 .2741 .08 |
|
Si7 .6719 .1773 .7118 .05 |
|
Si8 .7100 -.0524 .2641 .07 |
|
Si9 .5006 -.0103 .2554 .06 |
|
Si10 .8838 .1424 .7223 .06 |
|
Si11 -.2735 .2659 .2552 .07 |
|
Si12 -.2213 .0602 .1340 .5 .10 |
|
Al12 -.2213 .0602 .1340 .5 .10 |
|
Si13 .8941 .0292 .8708 .75 .09 |
|
Al13 .8941 .0292 .8708 .25 .09 |
|
Si14 .3420 .0763 .1332 .5 .11 |
|
Al14 .3420 .0763 .1332 .5 .11 |
|
Si15 .0095 .1594 .1263 .75 .10 |
|
Al15 .0095 .1594 .1263 .25 .10 |
|
Si16 -.4746 .3171 .2625 .07 |
|
O1 .0064 .2350 .5707 .06 |
|
O2 .2093 .1867 .5737 .06 |
|
O3 .6127 .0964 .5795 .08 |
|
O4 .7754 .0377 .3951 .09 |
|
OH5 .3784 .1511 .3979 .12 |
|
O6 .5675 .0819 .3852 .09 |
|
OH7 .4062 .1326 .5717 .10 |
|
OH8 .1812 .2064 .3988 .11 |
|
O9 -.2284 .2968 .3830 .14 |
|
OH10 .9850 .0041 .4113 .14 |
|
OH11 -.0152 .2624 .4004 .11 |
|
O12 .8203 .0566 .5921 .08 |
|
O13 -.4252 .3529 .3914 .11 |
|
OH14 .2084 .4287 .5734 .11 |
|
O15 -.0092 .5202 .4187 .08 |
|
O16 .6069 .3324 .5678 .08 |
|
O17 .4066 .3796 .5711 .07 |
|
OH18 .7972 .2725 .5554 .11 |
|
O19 .1816 .4601 .4041 .11 |
|
O20 .5889 .4500 .7500 .13 |
|
O21 .2109 .5035 .2467 .16 |
|
O22 .9944 .2541 .7561 .15 |
|
O23 -.1907 .3607 .2371 .16 |
|
O24 .7999 .1910 .7636 .15 |
|
O25 .6778 .3047 .7452 .15 |
|
O26 .2969 .0272 -.0006 .20 |
|
O27 -.0935 .5595 .2513 .16 |
|
O28 .9270 .0820 .7927 .18 |
|
O29 .6896 -.1836 .2402 .15 |
|
O30 -.2887 .1410 .1764 .17 |
|
O31 -.4690 .4287 .2449 .16 |
|
O32 -.3963 .2689 .2113 .12 |
|
O33 .0073 .4247 .2335 .16 |
|
O34 .9320 -.0756 .8510 .30 |
|
O35 .3984 -.1238 .2325 .14 |
|
O36 .1120 .2912 .2001 .19 |
|
O37 .4489 .0417 .1793 .12 |
|
O38 -.0901 .1485 .1699 .19 |
|
O39 .3887 .3713 .7466 .14 |
|
O40 .7808 -.0187 .2002 .16 |
|
O41 .5847 -.0557 .2126 .12 |
|
O42 .9606 .1315 .9971 .24 |
|
O43 .1918 .3038 .7518 .14 |
|
O44 -.6046 .2217 .1934 .17 |
|
O45 .7562 -.0253 .8291 .19 |
|
OH46 -.6211 .4054 .3988 .14 |
|
Wat1 .2462 .2448 -.0039 .73 |
|
Wat2 .1059 .3156 -.0031 .61 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Henryite |
 |
Bindi L |
  |
Solid State Sciences 38 (2014) 108-111 |
|
Chemical and structural characterization of henryite, (Cu,Ag)3+xTe2 (x ~ 0.40): |
|
A new structure type in the (Ag)-Cu-Te system |
|
Locality: the Campbell orebody, Bisbee, Arizona, USA |
|
_database_code_amcsd 0020215 |
|
12.1987 12.1987 12.1987 90 90 90 Fd3c |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
CuM1 .125 .125 .125 .484 .063 .063 .063 .063 0 0 0 |
|
AgM1 .125 .125 .125 .366 .063 .063 .063 .063 0 0 0 |
|
CuM2 .875 .125 .125 .475 .064 .065 .063 .063 0 0 0 |
|
AgM2 .875 .125 .125 .368 .064 .065 .063 .063 0 0 0 |
|
FeM2 .875 .125 .125 .011 .064 .065 .063 .063 0 0 0 |
|
Te 0 0 0 .068 .068 .068 .068 -.0010 -.0010 -.0010 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Emmonsite |
 |
Pertlik F |
  |
Tschermaks Mineralogische und Petrographische Mitteilungen 18 (1972) 157-168 |
|
Der strukturtyp von emmonsit, {Fe2[TeO3]3*H2O}*xH2O (x=0-1) |
|
Locality: Tombstone, Arizona, USA |
|
_database_code_amcsd 0015641 |
|
7.90 8.00 7.62 96.73 95.00 84.47 P-1 |
|
atom x y z Biso |
|
Fe1 .19452 .02627 .96827 .41 |
|
Fe2 .30020 .47704 .51757 .42 |
|
Te1 .52645 .28821 .14098 .54 |
|
Te2 .02360 .34375 .20857 .52 |
|
Te3 .12548 .83745 .31807 .67 |
|
O1 .0053 .1124 .1448 .93 |
|
O2 .0740 .2057 .8079 .26 |
|
O3 .3122 .2220 .1131 1.15 |
|
O4 .3755 .9174 .8247 .78 |
|
O5 .2661 .8623 .1236 .31 |
|
O6 .1229 .3225 .4333 .93 |
|
O7 .2057 .6138 .3294 1.66 |
|
O8 .1948 .6277 .7103 1.61 |
|
O9 .4960 .3683 .3764 1.37 |
|
Wat .3857 .3149 .7150 2.14 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Stringhamite |
 |
Hawthorne F C |
  |
Tschermaks Mineralogische und Petrographische Mitteilungen 34 (1985) 15-24 |
|
The crystal structure of stringhamite |
|
Locality: Christmas mine, Pinal County, Arizona, USA |
|
_database_code_amcsd 0015701 |
|
5.030 16.1350 5.343 90 102.96 90 P2_1/c |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ca .6496 .17671 .3464 .0089 .0093 .0102 .0074 .0004 .0027 .0001 |
|
Cu1 0 0 .5 .0091 .0108 .0102 .0062 .0016 .0019 -.0002 |
|
Cu2 .5 0 0 .0093 .0070 .0098 .0107 .0002 .0013 -.0010 |
|
Si .9802 .11123 -.0290 .0075 .0065 .0089 .0074 -.0001 .0022 -.0001 |
|
O1 .8995 .2058 .0268 .011 .0109 .0124 .0096 .0001 .0033 -.0011 |
|
O2 .8461 .0853 .6740 .013 .0160 .0117 .0109 .0065 .0037 -.0002 |
|
O3 .3129 .1023 .0383 .010 .0066 .0118 .0117 -.0005 .0029 -.0028 |
|
O4 .8419 .0541 .1691 .009 .0082 .0111 .0083 .0007 .0031 .0005 |
|
O5 .3525 .2094 .6257 .014 .0160 .0138 .0136 -.0009 .0066 .0044 |
|
H5A .319 .316 .222 .01 |
|
H5B .184 .258 .081 .01 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Mammothite |
 |
Effenberger H |
  |
Tschermaks Mineralogische und Petrographische Mitteilungen 34 (1985) 279-288 |
|
The crystal structure of mammothite, Pb6Cu4AlSbO2(OH)16Cl4(SO4)2 |
|
Locality: Mammoth vein, Tiger, Arizona, USA |
|
_database_code_amcsd 0015702 |
|
18.93 7.33 11.35 90 112.44 90 C2/m |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .21037 0 .17947 .0179 .0186 .0232 .0159 0 .0051 0 |
|
Pb2 .42277 .25855 .20296 .0189 .0226 .0173 .0216 -.0022 .0064 -.0004 |
|
Cu1 .25 .25 .5 .0155 .0190 .0142 .0154 -.0019 .0027 -.0001 |
|
Cu2 .1042 0 .3685 .0151 .0167 .0168 .0178 0 .0078 0 |
|
Al 0 0 .5 .009 .0010 .014 .004 0 .002 0 |
|
Sb 0 0 0 .0143 .0149 .0174 .0129 0 .0029 0 |
|
O .0021 0 -.1695 .015 .023 .013 .018 0 .013 0 |
|
OH1 .2386 0 -.4393 .019 .018 .013 .030 0 .006 0 |
|
OH2 .0872 0 -.3442 .017 .008 .017 .025 0 -.001 0 |
|
OH3 .0831 .1854 .0426 .019 .020 .024 .018 -.001 .005 .003 |
|
OH4 .0409 .1717 .4173 .016 .022 .013 .021 .006 .008 .008 |
|
OH5 .1695 .1833 .3398 .014 .020 .014 .013 -.004 .005 .002 |
|
Cl1 .3679 0 .3963 .030 .035 .030 .025 0 -.002 0 |
|
Cl2 .4491 0 -.1995 .023 .029 .019 .028 0 .008 0 |
|
S1 .2497 0 -.0953 .015 .013 .021 .014 0 .003 0 |
|
OS1 .1776 0 -.0709 .020 .005 .039 .021 0 .005 0 |
|
OS2 .3103 0 .0298 .036 .015 .064 .029 0 .000 0 |
|
OS3 .2482 .1596 -.1686 .034 .047 .028 .030 -.010 .006 .006 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
Multiple datasets can be concatenated into a single downloadable file by selecting the datasets and then clicking
Multiple datasets can be downloaded as individual files inside a ZIP archive by selecting the datasets and then clicking
Total number of retrieved datasets: