|
Drugmanite |
 |
King G S D, Sengier-Roberts L |
|
Bulletin de Mineralogie 111 (1988) 431-437 |
|
Drugmanite, Pb2(Fe0.78Al0.22)H(PO4)2(OH)2: |
|
Its crystal structure and place in the datolite group |
|
Locality: Richelle, Belgium |
|
Note: anisoU's taken from ICSD |
|
_database_code_amcsd 0012089 |
|
11.111 7.986 4.643 90 90.41 90 P2_1/a |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb .31395 .09643 -.00835 .133 .00855 .01789 .01336 .00298 .00006 .00000 |
|
Fe .5 .5 0 .78 .053 .0012 .006 .0084 -.0010 -.0009 .0011 |
|
Al .5 .5 0 .22 .053 .0012 .006 .0084 -.0010 -.0009 .0011 |
|
P .6044 .2567 .4839 .092 .0070 .0101 .0103 -.0013 -.0007 -.0001 |
|
O2 .5049 .3009 .2706 .133 .0115 .0170 .0113 -.0028 .0008 .0044 |
|
O3 .7294 .2433 .3410 .181 .0128 .0262 .0151 .0053 .0011 .0068 |
|
O4 .6154 .3851 .7364 .154 .0044 .0160 .0258 .0028 -.0046 -.0054 |
|
O5 .3526 .4066 .8327 .119 .0063 .0194 .0097 -.0063 -.0075 .0047 |
|
Oh1 .5729 .0841 .6241 .167 .0191 .0116 .0193 -.0078 -.0096 .0072 |
|
H .5 0 .5 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink)
|
| |
