|
Fluor-tsilaisite |
|
Bosi F, Andreozzi G B, Agrosi G, Scandale E |
|
Mineralogical Magazine 79 (2015) 89-101 |
|
Fluor-tsilaisite, NaMn3Al6(Si6O18)(BO3)3(OH)3F, a new tourmaline |
|
from San Piero in Campo (Elba, Italy) and new data on tsilaisitic |
|
tourmaline from the holotype specimen locality |
|
Note: Sample CB1b, Standard SREF |
|
Locality: Grotta d'Oggi, San Piero in Campo, Elba Island, Italy |
|
_database_code_amcsd 0020623 |
|
15.9619 15.9691 7.1426 90 90 120 R3m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Na 0 0 .2257 .614 .0269 .0288 .0288 .0233 .0144 0 0 |
|
Ca 0 0 .2257 .0143 .0269 .0288 .0288 .0233 .0144 0 0 |
|
K 0 0 .2257 .0046 .0269 .0288 .0288 .0233 .0144 0 0 |
|
MnY .12432 .06216 .62286 .481 .01170 .0101 .00757 .0182 .00507 -.00314 -.00157 |
|
AlY .12432 .06216 .62286 .395 .01170 .0101 .00757 .0182 .00507 -.00314 -.00157 |
|
LiY .12432 .06216 .62286 .1019 .01170 .0101 .00757 .0182 .00507 -.00314 -.00157 |
|
TiY .12432 .06216 .62286 .0137 .01170 .0101 .00757 .0182 .00507 -.00314 -.00157 |
|
FeY .12432 .06216 .62286 .009 .01170 .0101 .00757 .0182 .00507 -.00314 -.00157 |
|
AlZ .29816 .26145 .61080 .969 .00625 .00643 .00703 .0054 .00342 -.00012 .00056 |
|
MnZ .29816 .26145 .61080 .031 .00625 .00643 .00703 .0054 .00342 -.00012 .00056 |
|
B .11012 .22025 .4541 .0068 .0074 .0057 .0067 .0029 .0000 .0000 |
|
Si .19185 .18988 0 .9895 .00476 .00481 .00467 .00484 .00239 -.00017 -.00042 |
|
AlT .19185 .18988 0 .0105 .00476 .00481 .00467 .00484 .00239 -.00017 -.00042 |
|
O1 0 0 .7780 .6537 .0441 .062 .062 .0083 .0310 0 0 |
|
F1 0 0 .7780 .3463 .0441 .062 .062 .0083 .0310 0 0 |
|
O2 .06157 .12315 .4827 .0197 .0318 .0054 .0131 .0027 .0003 .0005 |
|
O3 .26844 .13422 .5098 .0121 .0249 .0111 .0050 .0124 -.0003 -.0002 |
|
H3 .260 .1301 .394 .018 |
|
O4 .09366 .18732 .0693 .0084 .0065 .0129 .0081 .0064 -.0007 -.0013 |
|
O5 .18713 .09357 .0913 .0088 .0140 .0068 .0080 .0070 .0017 .0008 |
|
O6 .19745 .18725 .77534 .00769 .0084 .0096 .0044 .0040 .0002 -.0004 |
|
O7 .28527 .28572 .07944 .00650 .0059 .0060 .0056 .0015 -.0001 -.0007 |
|
O8 .20999 .27099 .44110 .00816 .0058 .0116 .0082 .0052 .0007 .0029 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
Multiple datasets can be concatenated into a single downloadable file by selecting the datasets and then clicking
Multiple datasets can be downloaded as individual files inside a ZIP archive by selecting the datasets and then clicking
Total number of retrieved datasets: