|
Chromschieffelinite |
|
Kampf A R, Mills S J, Housley R M, Rumsey M S, Spratt J |
|
American Mineralogist 97 (2012) 212-219 |
|
Lead-tellurium oxysalts from Otto Mountain near Baker, California: |
|
VII. Chromschieffelinite, Pb10Te6O20(OH)14(CrO4)(H2O)5, |
|
the chromate analog of schieffelinite |
|
Locality: Otto Mountain near Baker, California, USA |
|
_database_code_amcsd 0018766 |
|
9.6646 19.4962 10.5101 90 90 90 C222_1 |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .5000 .73669 .2500 .02636 .0210 .0188 .0393 .000 .0048 .000 |
|
Pb2 .85091 .65778 .37381 .02338 .0188 .0200 .0314 -.0010 .0048 .0018 |
|
Pb3 .78519 .84795 .49042 .03141 .0551 .0189 .0202 -.0062 -.0102 .0037 |
|
Te1 .5000 .55833 .2500 .0149 .0183 .0134 .0131 .000 -.0005 .000 |
|
Te2 .84797 .79074 .15086 .01206 .0096 .0139 .0127 -.0005 -.0015 .0003 |
|
Cr .0584 .5030 .4555 .25 .050 |
|
O1 .6286 .6271 .2077 .0170 .020 .011 .020 .006 .003 .000 |
|
OH2 .5707 .5544 .4228 .028 .032 .029 .023 -.003 -.010 -.002 |
|
OH3 .3728 .4860 .2998 .034 .053 .013 .036 -.014 -.001 -.002 |
|
O4 .9161 .6999 .1306 .0181 .010 .014 .030 .005 -.001 .004 |
|
O5 .8150 .7336 .5598 .0152 .026 .005 .014 .003 .008 .003 |
|
O6 .7655 .7640 .3088 .0137 .010 .020 .011 .000 .004 .004 |
|
O7 .5579 .6818 .4978 .5 .023 .023 .023 .022 -.002 -.011 -.002 |
|
OH7 .5579 .6818 .4978 .5 .023 .023 .023 .022 -.002 -.011 -.002 |
|
O8 .0000 .8272 .2500 .021 .008 .021 .033 .000 -.011 .000 |
|
OH9 .7667 .8820 .1633 .0204 .016 .022 .023 .003 -.004 .004 |
|
O10 .221 .5000 .5000 .5 .072 |
|
O11 .516 .9325 .050 .5 .130 |
|
O12 .054 .538 .313 .25 .033 |
|
Wat1 -.139 .5000 .5000 .5 .14 |
|
Wat2 .480 .8803 .176 .5 .078 |
|
Wat3 .124 .532 .386 .5 .102 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromo-alumino-povondraite |
|
Bosi F, Skogby H, Halenius U, Reznitskii L |
|
American Mineralogist 98 (2013) 1557-1564 |
|
Crystallographic and spectroscopic characterization of Fe-bearing |
|
chromo-alumino-povondraite and its relations with oxy-chromium-dravite and oxy-dravite |
|
Locality: Sludyanka crystalline complex, Lake Baikal, Russia |
|
_database_code_amcsd 0020261 |
|
16.0032 16.0032 7.28230 90 90 120 R3m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
NaX 0 0 .22677 .76 .0176 .0176 .0176 .0176 .0088 .000 .000 |
|
CaX 0 0 .22677 .19 .0176 .0176 .0176 .0176 .0088 .000 .000 |
|
KX 0 0 .22677 .02 .0176 .0176 .0176 .0176 .0088 .000 .000 |
|
CrY .12364 .061822 .63687 .647 .00539 .00497 .00441 .00696 .00248 -.00106 -.00053 |
|
MgY .12364 .061822 .63687 .328 .00539 .00497 .00441 .00696 .00248 -.00106 -.00053 |
|
AlY .12364 .061822 .63687 .023 .00539 .00497 .00441 .00696 .00248 -.00106 -.00053 |
|
TiY .12364 .061822 .63687 .020 .00539 .00497 .00441 .00696 .00248 -.00106 -.00053 |
|
AlZ .29802 .26200 .60991 .623 .00616 .00558 .00603 .00675 .00282 -.00016 .00023 |
|
MgZ .29802 .26200 .60991 .238 .00616 .00558 .00603 .00675 .00282 -.00016 .00023 |
|
FeZ .29802 .26200 .60991 .078 .00616 .00558 .00603 .00675 .00282 -.00016 .00023 |
|
VZ .29802 .26200 .60991 .032 .00616 .00558 .00603 .00675 .00282 -.00016 .00023 |
|
CrZ .29802 .26200 .60991 .027 .00616 .00558 .00603 .00675 .00282 -.00016 .00023 |
|
Si .19074 .18901 0 .00584 .00543 .00513 .00684 .00257 -.00059 -.00058 |
|
B .11002 .22004 .4539 .0081 .0072 .0066 .0102 .0033 .0000 .0001 |
|
O1 0 0 .7666 .69 .0089 .0086 .0086 .0096 .0043 .000 .000 |
|
F1 0 0 .7666 .23 .0089 .0086 .0086 .0096 .0043 .000 .000 |
|
OH1 0 0 .7666 .08 .0089 .0086 .0086 .0096 .0043 .000 .000 |
|
O2 .06053 .12106 .48759 .0090 .0082 .0069 .0115 .0035 .00034 .0007 |
|
O3 .25870 .12935 .51092 .0117 .0165 .0135 .0060 .0082 .0009 .0004 |
|
H3 .2490 .1245 .400 .018 |
|
O4 .09266 .18532 .07159 .0112 .0088 .0172 .0103 .0086 -.0002 -.0005 |
|
O5 .18290 .09145 .09164 .0107 .0156 .0081 .0108 .0078 .0016 .0008 |
|
O6 .19286 .18338 .77946 .00875 .0113 .0081 .0072 .0051 -.0006 -.0011 |
|
O7 .28371 .28346 .07566 .01044 .0092 .0079 .0108 .0017 -.0029 -.0010 |
|
O8 .20825 .26879 .43905 .01187 .0061 .0098 .0194 .0038 .0011 .0026 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Logvinova A M, Princivalle F, Sobolev N V |
|
American Mineralogist 94 (2009) 1067-1070 |
|
Structural parameters of chromite included in diamond and kimberlites |
|
from Siberia: A new tool for discriminating ultramafic source |
|
Locality: Udachnaya mine, Daldyn kimberlitic field, close to Arctic Circle, Russia |
|
Note: sample UDK1 |
|
_database_code_amcsd 0004961 |
|
8.33273 8.33273 8.33273 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
MgT .125 .125 .125 .567 .0058 |
|
MnT .125 .125 .125 .009 .0058 |
|
Fe2+T .125 .125 .125 .401 .0058 |
|
Fe3+T .125 .125 .125 .022 .0058 |
|
AlM .5 .5 .5 .095 .0037 |
|
TiM .5 .5 .5 .002 .0037 |
|
CrM .5 .5 .5 .875 .0037 |
|
Fe2+M .5 .5 .5 .011 .0037 |
|
Fe3+M .5 .5 .5 .017 .0037 |
|
O .2621 .2621 .2621 .0052 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Logvinova A M, Princivalle F, Sobolev N V |
|
American Mineralogist 94 (2009) 1067-1070 |
|
Structural parameters of chromite included in diamond and kimberlites |
|
from Siberia: A new tool for discriminating ultramafic source |
|
Locality: Udachnaya mine, Daldyn kimberlitic field, close to Arctic Circle, Russia |
|
Note: sample UDK3 |
|
_database_code_amcsd 0004962 |
|
8.3264 8.3264 8.3264 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
MgT .125 .125 .125 .587 .0051 |
|
AlT .125 .125 .125 .039 .0051 |
|
MnT .125 .125 .125 .007 .0051 |
|
Fe2+T .125 .125 .125 .366 .0051 |
|
MgM .5 .5 .5 .007 .00323 |
|
AlM .5 .5 .5 .092 .00323 |
|
TiM .5 .5 .5 .001 .00323 |
|
CrM .5 .5 .5 .861 .00323 |
|
Fe2+M .5 .5 .5 .011 .00323 |
|
Fe3+M .5 .5 .5 .028 .00323 |
|
O .26175 .26175 .26175 .0048 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Logvinova A M, Princivalle F, Sobolev N V |
|
American Mineralogist 94 (2009) 1067-1070 |
|
Structural parameters of chromite included in diamond and kimberlites |
|
from Siberia: A new tool for discriminating ultramafic source |
|
Locality: Udachnaya mine, Daldyn kimberlitic field, close to Arctic Circle, Russia |
|
Note: sample UDK4 |
|
_database_code_amcsd 0004963 |
|
8.3266 8.3266 8.3266 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
MgT .125 .125 .125 .563 .0069 |
|
AlT .125 .125 .125 .026 .0069 |
|
MnT .125 .125 .125 .008 .0069 |
|
Fe2+T .125 .125 .125 .402 .0069 |
|
MgM .5 .5 .5 .013 .00460 |
|
AlM .5 .5 .5 .096 .00460 |
|
TiM .5 .5 .5 .006 .00460 |
|
CrM .5 .5 .5 .860 .00460 |
|
Fe2+M .5 .5 .5 .004 .00460 |
|
Fe3+M .5 .5 .5 .021 .00460 |
|
O .26198 .26198 .26198 .0063 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Logvinova A M, Princivalle F, Sobolev N V |
|
American Mineralogist 94 (2009) 1067-1070 |
|
Structural parameters of chromite included in diamond and kimberlites |
|
from Siberia: A new tool for discriminating ultramafic source |
|
Locality: Udachnaya mine, Daldyn kimberlitic field, close to Arctic Circle, Russia |
|
Note: sample UDK5 |
|
_database_code_amcsd 0004964 |
|
8.3249 8.3249 8.3249 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
MgT .125 .125 .125 .591 .0064 |
|
AlT .125 .125 .125 .016 .0064 |
|
MnT .125 .125 .125 .008 .0064 |
|
Fe2+T .125 .125 .125 .373 .0064 |
|
Fe3+T .125 .125 .125 .012 .0064 |
|
MgM .5 .5 .5 .009 .0041 |
|
AlM .5 .5 .5 .115 .0041 |
|
CrM .5 .5 .5 .851 .0041 |
|
Fe2+M .5 .5 .5 .002 .0041 |
|
Fe3+M .5 .5 .5 .021 .0041 |
|
NiM .5 .5 .5 .002 .0041 |
|
O .26203 .26203 .26203 .0058 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Logvinova A M, Princivalle F, Sobolev N V |
|
American Mineralogist 94 (2009) 1067-1070 |
|
Structural parameters of chromite included in diamond and kimberlites |
|
from Siberia: A new tool for discriminating ultramafic source |
|
Locality: Internatsionalnaya mine, Malo-Botuobiya kimberlite field, Russia |
|
Note: sample Inter-1 |
|
_database_code_amcsd 0004965 |
|
8.3293 8.3293 8.3293 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
MgT .125 .125 .125 .519 .0065 |
|
MnT .125 .125 .125 .009 .0065 |
|
Fe2+T .125 .125 .125 .434 .0065 |
|
Fe3+T .125 .125 .125 .037 .0065 |
|
MgM .5 .5 .5 .014 .00407 |
|
AlM .5 .5 .5 .114 .00407 |
|
TiM .5 .5 .5 .002 .00407 |
|
CrM .5 .5 .5 .850 .00407 |
|
Fe2+M .5 .5 .5 .003 .00407 |
|
Fe3+M .5 .5 .5 .016 .00407 |
|
NiM .5 .5 .5 .001 .00407 |
|
O .26213 .26213 .26213 .0056 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Logvinova A M, Princivalle F, Sobolev N V |
|
American Mineralogist 94 (2009) 1067-1070 |
|
Structural parameters of chromite included in diamond and kimberlites |
|
from Siberia: A new tool for discriminating ultramafic source |
|
Locality: Mir mine, Malo-Botuobiya kimberlite field, Russia |
|
Note: sample Mr-1a |
|
_database_code_amcsd 0004966 |
|
8.3390 8.3390 8.3390 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
MgT .125 .125 .125 .522 .0079 |
|
AlT .125 .125 .125 .023 .0079 |
|
MnT .125 .125 .125 .009 .0079 |
|
Fe2+T .125 .125 .125 .430 .0079 |
|
Fe3+T .125 .125 .125 .015 .0079 |
|
MgM .5 .5 .5 .026 .0054 |
|
AlM .5 .5 .5 .098 .0054 |
|
TiM .5 .5 .5 .018 .0054 |
|
CrM .5 .5 .5 .780 .0054 |
|
Fe2+M .5 .5 .5 .007 .0054 |
|
Fe3+M .5 .5 .5 .069 .0054 |
|
NiM .5 .5 .5 .001 .0054 |
|
O .26197 .26197 .26197 .0070 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Logvinova A M, Princivalle F, Sobolev N V |
|
American Mineralogist 94 (2009) 1067-1070 |
|
Structural parameters of chromite included in diamond and kimberlites |
|
from Siberia: A new tool for discriminating ultramafic source |
|
Locality: Internatsionalnaya mine, Malo-Botuobiya kimberlite field, Russia |
|
Note: sample UV-170 |
|
_database_code_amcsd 0004967 |
|
8.3055 8.3055 8.3055 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
MgT .125 .125 .125 .567 .0052 |
|
AlT .125 .125 .125 .022 .0052 |
|
MnT .125 .125 .125 .008 .0052 |
|
Fe2+T .125 .125 .125 .404 .0052 |
|
MgM .5 .5 .5 .020 .0031 |
|
AlM .5 .5 .5 .187 .0031 |
|
TiM .5 .5 .5 .001 .0031 |
|
CrM .5 .5 .5 .800 .0031 |
|
Fe2+M .5 .5 .5 .006 .0031 |
|
O .26237 .26237 .26237 .0052 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromo-alumino-povondraite |
|
Reznitskii L, Clark C M, Hawthorne F C, Grice J D, Skogby H, Halenius U, Bosi F |
|
American Mineralogist 99 (2014) 1767-1773 |
|
Chromo-alumino-povondraite, NaCr3(Al4Mg2)(Si6O18)(BO3)3(OH)3O, a new mineral species |
|
of the tourmaline supergroup |
|
Locality: Sludyanka, Lake Baikal, Russia |
|
_database_code_amcsd 0020335 |
|
16.0277 16.0277 7.30850 90 90 120 R3m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
NaX 0 0 .22801 .87 .0203 .0212 .0212 .0186 .0106 0 0 |
|
CaX 0 0 .22801 .07 .0203 .0212 .0212 .0186 .0106 0 0 |
|
KX 0 0 .22801 .02 .0203 .0212 .0212 .0186 .0106 0 0 |
|
CrY .12380 .061898 .63723 .76333 .00552 .00518 .00495 .00650 .00259 -.00074 -.00037 |
|
MgY .12380 .061898 .63723 .23667 .00552 .00518 .00495 .00650 .00259 -.00074 -.00037 |
|
AlZ .297903 .261913 .60938 .50667 .00450 .00424 .00464 .00442 .00207 .00002 .00026 |
|
MgZ .297903 .261913 .60938 .25667 .00450 .00424 .00464 .00442 .00207 .00002 .00026 |
|
CrZ .297903 .261913 .60938 .19667 .00450 .00424 .00464 .00442 .00207 .00002 .00026 |
|
VZ .297903 .261913 .60938 .03667 .00450 .00424 .00464 .00442 .00207 .00002 .00026 |
|
FeZ .297903 .261913 .60938 .00167 .00450 .00424 .00464 .00442 .00207 .00002 .00026 |
|
B .10993 .21986 .4549 .0072 .0065 .0073 .0083 .0036 .0003 .0005 |
|
Si .190426 .18870 0 .99333 .00570 .00567 .00524 .00609 .00266 -.00042 -.00050 |
|
Al .190426 .18870 0 .00667 .00570 .00567 .00524 .00609 .00266 -.00042 -.00050 |
|
O1 0 0 .7661 .73 .0072 .0071 .0071 .0073 .0035 0 0 |
|
F1 0 0 .7661 .25 .0072 .0071 .0071 .0073 .0035 0 0 |
|
OH1 0 0 .7661 .02 .0072 .0071 .0071 .0073 .0035 0 0 |
|
O2 .06037 .12074 .48900 .0068 .0066 .0048 .0083 .0024 .00029 .0006 |
|
O3 .25735 .12868 .51027 .0105 .0138 .0128 .0054 .0069 .0007 .00036 |
|
H3 .2575 .1287 .395 .016 |
|
O4 .09256 .18511 .07144 .0106 .0085 .0174 .0087 .0087 -.0002 -.0004 |
|
O5 .18285 .09142 .09074 .0100 .0161 .0079 .0087 .0081 .0011 .0005 |
|
O6 .19226 .18294 .78002 .00773 .0104 .0080 .0055 .0052 -.0004 -.0009 |
|
O7 .28334 .28296 .07444 .00938 .0084 .0072 .0092 .0015 -.0024 -.0005 |
|
O8 .20763 .26830 .43859 .01093 .0055 .0094 .0173 .0033 .0010 .0031 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Princivalle F |
|
The Canadian Mineralogist 43 (2005) 1305-1314 |
|
The crystal chemistry of detrital chromian spinel from the |
|
southeastern Alps and Outer Dinarides: The discrimination of |
|
supplies from areas of similar tectonic setting? |
|
Sample: CL 1 |
|
_database_code_amcsd 0006033 |
|
8.2837 8.2837 8.2837 90 90 90 *Fd-3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .001 .0037 |
|
Fe2+T .125 .125 .125 .516 .0037 |
|
Fe3+T .125 .125 .125 .065 .0037 |
|
MgT .125 .125 .125 .413 .0037 |
|
ZnT .125 .125 .125 .005 .0037 |
|
AlM .5 .5 .5 .361 .0063 |
|
Fe2+M .5 .5 .5 .023 .0063 |
|
Fe3+M .5 .5 .5 .030 .0063 |
|
MgM .5 .5 .5 .0155 .0063 |
|
CrM .5 .5 .5 .5625 .0063 |
|
NiM .5 .5 .5 .001 .0063 |
|
TiM .5 .5 .5 .007 .0063 |
|
O .26291 .26291 .26291 .0060 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Princivalle F |
|
The Canadian Mineralogist 43 (2005) 1305-1314 |
|
The crystal chemistry of detrital chromian spinel from the |
|
southeastern Alps and Outer Dinarides: The discrimination of |
|
supplies from areas of similar tectonic setting? |
|
Sample: BG 17 |
|
_database_code_amcsd 0006034 |
|
8.2905 8.2905 8.2905 90 90 90 *Fd-3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .005 .0047 |
|
Fe2+T .125 .125 .125 .497 .0047 |
|
Fe3+T .125 .125 .125 .027 .0047 |
|
MgT .125 .125 .125 .464 .0047 |
|
SiT .125 .125 .125 .002 .0047 |
|
ZnT .125 .125 .125 .005 .0047 |
|
AlM .5 .5 .5 .339 .0070 |
|
Fe2+M .5 .5 .5 .007 .0070 |
|
Fe3+M .5 .5 .5 .0715 .0070 |
|
MgM .5 .5 .5 .0235 .0070 |
|
CrM .5 .5 .5 .5435 .0070 |
|
NiM .5 .5 .5 .0015 .0070 |
|
TiM .5 .5 .5 .014 .0070 |
|
O .26271 .26271 .26271 .0071 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Princivalle F |
|
The Canadian Mineralogist 43 (2005) 1305-1314 |
|
The crystal chemistry of detrital chromian spinel from the |
|
southeastern Alps and Outer Dinarides: The discrimination of |
|
supplies from areas of similar tectonic setting? |
|
Sample: BG 23 |
|
_database_code_amcsd 0006037 |
|
8.3232 8.3232 8.3232 90 90 90 *Fd-3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .001 .0052 |
|
Fe2+T .125 .125 .125 .517 .0052 |
|
Fe3+T .125 .125 .125 .057 .0052 |
|
MgT .125 .125 .125 .419 .0052 |
|
SiT .125 .125 .125 .001 .0052 |
|
ZnT .125 .125 .125 .005 .0052 |
|
AlM .5 .5 .5 .2455 .0078 |
|
Fe2+M .5 .5 .5 .0265 .0078 |
|
Fe3+M .5 .5 .5 .0765 .0078 |
|
MgM .5 .5 .5 .040 .0078 |
|
CrM .5 .5 .5 .5665 .0078 |
|
NiM .5 .5 .5 .0035 .0078 |
|
TiM .5 .5 .5 .041 .0078 |
|
O .26244 .26244 .26244 .0077 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Princivalle F |
|
The Canadian Mineralogist 43 (2005) 1305-1314 |
|
The crystal chemistry of detrital chromian spinel from the |
|
southeastern Alps and Outer Dinarides: The discrimination of |
|
supplies from areas of similar tectonic setting? |
|
Sample: IB_KRKV3B |
|
_database_code_amcsd 0006047 |
|
8.2416 8.2416 8.2416 90 90 90 *Fd-3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .023 .0037 |
|
Fe2+T .125 .125 .125 .531 .0037 |
|
Fe3+T .125 .125 .125 .016 .0037 |
|
MgT .125 .125 .125 .421 .0037 |
|
SiT .125 .125 .125 .002 .0037 |
|
ZnT .125 .125 .125 .007 .0037 |
|
AlM .5 .5 .5 .2615 .0060 |
|
Fe2+M .5 .5 .5 .007 .0060 |
|
Fe3+M .5 .5 .5 .0005 .0060 |
|
MgM .5 .5 .5 .018 .0060 |
|
CrM .5 .5 .5 .711 .0060 |
|
NiM .5 .5 .5 .001 .0060 |
|
TiM .5 .5 .5 .002 .0060 |
|
O .26283 .26283 .26283 .0064 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromium-dravite |
|
Bosi F, Lucchesi S, Reznitskii L |
|
European Journal of Mineralogy 16 (2004) 345-352 |
|
Crystal chemistry of the dravite-chromdravite series |
|
Note: Tourmaline TMt3b |
|
Locality: Sludyanka crystalline complex, Lake Baikal, Russia |
|
_database_code_amcsd 0007057 |
|
16.0539 16.0539 7.3247 90 90 120 R3m |
|
atom x y z occ Uiso |
|
NaX 0 0 .2255 .880 .0171 |
|
CaX 0 0 .2255 .073 .0171 |
|
KX 0 0 .2255 .017 .0171 |
|
CrY .12335 .061675 .63774 .711 .00408 |
|
MgY .12335 .061675 .63774 .146 .00408 |
|
V3+Y .12335 .061675 .63774 .118 .00408 |
|
Fe2+Y .12335 .061675 .63774 .017 .00408 |
|
ZnY .12335 .061675 .63774 .007 .00408 |
|
Ti4+Y .12335 .061675 .63774 .001 .00408 |
|
CrZ .29779 .26179 .60896 .369 .0045 |
|
AlZ .29779 .26179 .60896 .331 .0045 |
|
MgZ .29779 .26179 .60896 .301 .0045 |
|
SiT .19001 .18832 0 .981 .0041 |
|
AlT .19001 .18832 0 .019 .0041 |
|
B .10977 .21954 .4543 .0045 |
|
O1W 0 0 .7652 .609 .0054 |
|
F1W 0 0 .7652 .381 .0054 |
|
OH1W 0 0 .7652 .009 .0054 |
|
O2 .06021 .12042 .4891 .0059 |
|
O3V .2564 .1282 .5098 .0088 |
|
O4 .09250 .18500 .0717 .0090 |
|
O5 .1824 .0912 .0913 .0086 |
|
O6 .19138 .18214 .7802 .0063 |
|
O7 .28320 .28263 .0737 .0081 |
|
O8 .20739 .26778 .4377 .0093 |
|
H3V .259 .1295 .39 .14 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromium-dravite |
|
Bosi F, Lucchesi S, Reznitskii L |
|
European Journal of Mineralogy 16 (2004) 345-352 |
|
Crystal chemistry of the dravite-chromdravite series |
|
Note: Tourmaline TMt6b |
|
Locality: Sludyanka crystalline complex, Lake Baikal, Russia |
|
_database_code_amcsd 0007058 |
|
16.0377 16.0377 7.3157 90 90 120 R3m |
|
atom x y z occ Uiso |
|
NaX 0 0 .2254 .892 .0183 |
|
CaX 0 0 .2254 .068 .0183 |
|
KX 0 0 .2254 .017 .0183 |
|
CrY .12339 .061695 .63757 .743 .0045 |
|
MgY .12339 .061695 .63757 .154 .0045 |
|
V3+Y .12339 .061695 .63757 .081 .0045 |
|
Fe2+Y .12339 .061695 .63757 .012 .0045 |
|
Ti4+Y .12339 .061695 .63757 .010 .0045 |
|
AlZ .29781 .26188 .60891 .390 .0052 |
|
MgZ .29781 .26188 .60891 .310 .0052 |
|
CrZ .29781 .26188 .60891 .300 .0052 |
|
SiT .19013 .18840 0 .996 .0046 |
|
AlT .19013 .18840 0 .004 .0046 |
|
B .10992 .21984 .4541 .0048 |
|
O1W 0 0 .7651 .668 .0067 |
|
F1W 0 0 .7651 .332 .0067 |
|
O2 .06024 .12048 .4893 .0064 |
|
O3V .2565 .12825 .5102 .0097 |
|
O4 .09262 .18524 .0720 .0100 |
|
O5 .1826 .0913 .0913 .0089 |
|
O6 .19144 .18221 .7803 .0074 |
|
O7 .28310 .28278 .0734 .0091 |
|
O8 .20752 .26819 .4382 .0104 |
|
H3V .237 .1185 .36 .994 .14 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromium-dravite |
|
Bosi F, Lucchesi S, Reznitskii L |
|
European Journal of Mineralogy 16 (2004) 345-352 |
|
Crystal chemistry of the dravite-chromdravite series |
|
Note: Tourmaline TMt3c |
|
Locality: Sludyanka crystalline complex, Lake Baikal, Russia |
|
_database_code_amcsd 0007059 |
|
16.0299 16.0299 7.3056 90 90 120 R3m |
|
atom x y z occ Uiso |
|
NaX 0 0 .2237 .842 .0186 |
|
CaX 0 0 .2237 .043 .0186 |
|
KX 0 0 .2237 .027 .0186 |
|
CrY .12337 .061675 .63710 .580 .0045 |
|
V3+Y .12337 .061675 .63710 .261 .0045 |
|
MgY .12337 .061675 .63710 .121 .0045 |
|
AlY .12337 .061675 .63710 .028 .0045 |
|
Fe2+Y .12337 .061675 .63710 .007 .0045 |
|
ZnY .12337 .061675 .63710 .003 .0045 |
|
Ti4+Y .12337 .061675 .63710 .001 .0045 |
|
AlZ .29791 .26194 .60892 .440 .0055 |
|
MgZ .29791 .26194 .60892 .287 .0055 |
|
CrZ .29791 .26194 .60892 .272 .0055 |
|
Fe2+Z .29791 .26194 .60892 .001 .0055 |
|
SiT .19027 .18858 0 .978 .0040 |
|
AlT .19027 .18858 0 .022 .0040 |
|
B .1100 .2200 .4543 .0054 |
|
O1W 0 0 .7654 .639 .0062 |
|
F1W 0 0 .7654 .361 .0062 |
|
O2 .06041 .12082 .4887 .0068 |
|
OH3V .2570 .1285 .5097 .979 .0100 |
|
O3V .2570 .1285 .5097 .021 .0100 |
|
O4 .09276 .18552 .0718 .0098 |
|
O5 .1829 .09145 .0918 .0088 |
|
O6 .19186 .18238 .7793 .0073 |
|
O7 .28339 .28328 .0737 .0087 |
|
O8 .20787 .26860 .4380 .0103 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromium-dravite |
|
Bosi F, Lucchesi S, Reznitskii L |
|
European Journal of Mineralogy 16 (2004) 345-352 |
|
Crystal chemistry of the dravite-chromdravite series |
|
Note: Tourmaline TMpr79f |
|
Locality: Sludyanka crystalline complex, Lake Baikal, Russia |
|
_database_code_amcsd 0007060 |
|
16.0204 16.0204 7.2985 90 90 120 R3m |
|
atom x y z occ Uiso |
|
NaX 0 0 .2251 .829 .0179 |
|
CaX 0 0 .2251 .097 .0179 |
|
KX 0 0 .2251 .014 .0179 |
|
CrY .12337 .061675 .63729 .766 .0044 |
|
MgY .12337 .061675 .63729 .158 .0044 |
|
V3+Y .12337 .061675 .63729 .049 .0044 |
|
Fe2+Y .12337 .061675 .63729 .014 .0044 |
|
Ti4+Y .12337 .061675 .63729 .010 .0044 |
|
ZnY .12337 .061675 .63729 .004 .0044 |
|
AlZ .29783 .26189 .60889 .444 .0053 |
|
MgZ .29783 .26189 .60889 .289 .0053 |
|
CrZ .29783 .26189 .60889 .267 .0053 |
|
SiT .19032 .18856 0 .997 .0043 |
|
AlT .19032 .18856 0 .003 .0043 |
|
B .10995 .21990 .4542 .0049 |
|
O1W 0 0 .7653 .607 .0060 |
|
F1W 0 0 .7653 .393 .0060 |
|
O2 .06030 .12060 .4882 .0064 |
|
O3V .2569 .12845 .5098 .0092 |
|
O4 .09258 .18516 .0717 .0092 |
|
O5 .1827 .09135 .0916 .0086 |
|
O6 .19182 .18237 .7796 .0068 |
|
O7 .28347 .28306 .0737 .0086 |
|
O8 .20776 .26828 .4383 .0098 |
|
H3V .248 .124 .382 .940 .07 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromium-dravite |
|
Bosi F, Lucchesi S, Reznitskii L |
|
European Journal of Mineralogy 16 (2004) 345-352 |
|
Crystal chemistry of the dravite-chromdravite series |
|
Note: Tourmaline TM1p43e |
|
Locality: Sludyanka crystalline complex, Lake Baikal, Russia |
|
_database_code_amcsd 0007061 |
|
15.9911 15.9911 7.2764 90 90 120 R3m |
|
atom x y z occ Uiso |
|
NaX 0 0 .2245 .888 .0180 |
|
CaX 0 0 .2245 .028 .0180 |
|
KX 0 0 .2245 .022 .0180 |
|
CrY .12349 .061745 .63680 .726 .0045 |
|
MgY .12349 .061745 .63680 .217 .0045 |
|
AlY .12349 .061745 .63680 .032 .0045 |
|
V3+Y .12349 .061745 .63680 .019 .0045 |
|
ZnY .12349 .061745 .63680 .005 .0045 |
|
Ti4+Y .12349 .061745 .63680 .001 .0045 |
|
AlZ .29794 .26194 .60929 .541 .0054 |
|
MgZ .29794 .26194 .60929 .253 .0054 |
|
CrZ .29794 .26194 .60929 .162 .0054 |
|
V3+Z .29794 .26194 .60929 .037 .0054 |
|
Fe2+Z .29794 .26194 .60929 .006 .0054 |
|
SiT .19050 .18872 0 .998 .0044 |
|
AlT .19050 .18872 0 .002 .0044 |
|
B .11011 .22022 .4541 .0047 |
|
O1W 0 0 .7653 .707 .0064 |
|
F1W 0 0 .7653 .259 .0064 |
|
OH1W 0 0 .7653 .034 .0064 |
|
O2 .06044 .12088 .4883 .0067 |
|
O3V .2577 .12885 .5099 .0100 |
|
O4 .09270 .18540 .0716 .0098 |
|
O5 .1832 .0916 .0916 .0087 |
|
O6 .19234 .18293 .7791 .0070 |
|
O7 .28368 .28345 .0744 .0089 |
|
O8 .20809 .26881 .4384 .0101 |
|
H3V .252 .126 .38 .15 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV21, LG |
|
_database_code_amcsd 0007226 |
|
8.2996 8.2996 8.2996 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
Fe2+T .125 .125 .125 .502 .00545 |
|
Fe3+T .125 .125 .125 .039 .00545 |
|
MgT .125 .125 .125 .451 .00545 |
|
MnT .125 .125 .125 .008 .00545 |
|
AlM .5 .5 .5 .269 .00331 |
|
Fe3+M .5 .5 .5 .082 .00331 |
|
MgM .5 .5 .5 .024 .00331 |
|
CrM .5 .5 .5 .611 .00331 |
|
NiM .5 .5 .5 .002 .00331 |
|
TiM .5 .5 .5 .008 .00331 |
|
VM .5 .5 .5 .004 .00331 |
|
O .26274 .26274 .26274 .00582 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV21A, LG |
|
_database_code_amcsd 0007227 |
|
8.3039 8.3039 8.3039 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
Fe2+T .125 .125 .125 .523 .00649 |
|
Fe3+T .125 .125 .125 .025 .00649 |
|
MgT .125 .125 .125 .443 .00649 |
|
MnT .125 .125 .125 .009 .00649 |
|
AlM .5 .5 .5 .244 .00432 |
|
Fe2+M .5 .5 .5 .005 .00432 |
|
Fe3+M .5 .5 .5 .098 .00432 |
|
MgM .5 .5 .5 .010 .00432 |
|
CrM .5 .5 .5 .628 .00432 |
|
NiM .5 .5 .5 .002 .00432 |
|
TiM .5 .5 .5 .008 .00432 |
|
VM .5 .5 .5 .005 .00432 |
|
O .26272 .26272 .26272 .00650 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV20, LG |
|
_database_code_amcsd 0007228 |
|
8.3011 8.3011 8.3011 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .020 .00615 |
|
Fe2+T .125 .125 .125 .500 .00615 |
|
Fe3+T .125 .125 .125 .036 .00615 |
|
MgT .125 .125 .125 .436 .00615 |
|
MnT .125 .125 .125 .007 .00615 |
|
ZnT .125 .125 .125 .001 .00615 |
|
AlM .5 .5 .5 .288 .00399 |
|
Fe2+M .5 .5 .5 .012 .00399 |
|
Fe3+M .5 .5 .5 .072 .00399 |
|
MgM .5 .5 .5 .023 .00399 |
|
CrM .5 .5 .5 .591 .00399 |
|
NiM .5 .5 .5 .002 .00399 |
|
TiM .5 .5 .5 .007 .00399 |
|
VM .5 .5 .5 .005 .00399 |
|
O .26257 .26257 .26257 .00610 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV20A, LG |
|
_database_code_amcsd 0007229 |
|
8.3004 8.3004 8.3004 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .027 .00633 |
|
Fe2+T .125 .125 .125 .519 .00633 |
|
Fe3+T .125 .125 .125 .015 .00633 |
|
MgT .125 .125 .125 .432 .00633 |
|
MnT .125 .125 .125 .007 .00633 |
|
AlM .5 .5 .5 .287 .00427 |
|
Fe2+M .5 .5 .5 .010 .00427 |
|
Fe3+M .5 .5 .5 .077 .00427 |
|
MgM .5 .5 .5 .018 .00427 |
|
CrM .5 .5 .5 .593 .00427 |
|
NiM .5 .5 .5 .002 .00427 |
|
TiM .5 .5 .5 .008 .00427 |
|
VM .5 .5 .5 .005 .00427 |
|
O .26267 .26267 .26267 .00615 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV28, MG |
|
_database_code_amcsd 0007230 |
|
8.3171 8.3171 8.3171 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .001 .00686 |
|
Fe2+T .125 .125 .125 .577 .00686 |
|
Fe3+T .125 .125 .125 .028 .00686 |
|
MgT .125 .125 .125 .384 .00686 |
|
MnT .125 .125 .125 .010 .00686 |
|
AlM .5 .5 .5 .225 .00424 |
|
Fe2+M .5 .5 .5 .013 .00424 |
|
Fe3+M .5 .5 .5 .142 .00424 |
|
MgM .5 .5 .5 .008 .00424 |
|
CrM .5 .5 .5 .593 .00424 |
|
NiM .5 .5 .5 .002 .00424 |
|
TiM .5 .5 .5 .013 .00424 |
|
VM .5 .5 .5 .004 .00424 |
|
O .26272 .26272 .26272 .00648 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV28A, MG |
|
_database_code_amcsd 0007231 |
|
8.3191 8.3191 8.3191 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
Fe2+T .125 .125 .125 .593 .00615 |
|
Fe3+T .125 .125 .125 .039 .00615 |
|
MgT .125 .125 .125 .358 .00615 |
|
MnT .125 .125 .125 .010 .00615 |
|
AlM .5 .5 .5 .225 .00386 |
|
Fe2+M .5 .5 .5 .018 .00386 |
|
Fe3+M .5 .5 .5 .124 .00386 |
|
MgM .5 .5 .5 .011 .00386 |
|
CrM .5 .5 .5 .600 .00386 |
|
NiM .5 .5 .5 .002 .00386 |
|
TiM .5 .5 .5 .015 .00386 |
|
VM .5 .5 .5 .005 .00386 |
|
O .26262 .26262 .26262 .00592 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV27, TW |
|
_database_code_amcsd 0007232 |
|
8.2829 8.2829 8.2829 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .026 .00621 |
|
Fe2+T .125 .125 .125 .560 .00621 |
|
Fe3+T .125 .125 .125 .012 .00621 |
|
MgT .125 .125 .125 .395 .00621 |
|
MnT .125 .125 .125 .007 .00621 |
|
AlM .5 .5 .5 .362 .00367 |
|
Fe2+M .5 .5 .5 .003 .00367 |
|
Fe3+M .5 .5 .5 .031 .00367 |
|
MgM .5 .5 .5 .025 .00367 |
|
CrM .5 .5 .5 .563 .00367 |
|
NiM .5 .5 .5 .002 .00367 |
|
TiM .5 .5 .5 .009 .00367 |
|
VM .5 .5 .5 .005 .00367 |
|
O .26305 .26305 .26305 .00626 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV27A, TW |
|
_database_code_amcsd 0007233 |
|
8.2822 8.2822 8.2822 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .036 .00675 |
|
Fe2+T .125 .125 .125 .560 .00675 |
|
Fe3+T .125 .125 .125 .010 .00675 |
|
MgT .125 .125 .125 .387 .00675 |
|
MnT .125 .125 .125 .007 .00675 |
|
AlM .5 .5 .5 .344 .00418 |
|
Fe2+M .5 .5 .5 .011 .00418 |
|
Fe3+M .5 .5 .5 .028 .00418 |
|
MgM .5 .5 .5 .022 .00418 |
|
CrM .5 .5 .5 .576 .00418 |
|
NiM .5 .5 .5 .002 .00418 |
|
TiM .5 .5 .5 .011 .00418 |
|
VM .5 .5 .5 .006 .00418 |
|
O .26290 .26290 .26290 .00681 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV34, UG1 |
|
_database_code_amcsd 0007234 |
|
8.3250 8.3250 8.3250 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .002 .00713 |
|
Fe2+T .125 .125 .125 .695 .00713 |
|
Fe3+T .125 .125 .125 .028 .00713 |
|
MgT .125 .125 .125 .262 .00713 |
|
MnT .125 .125 .125 .010 .00713 |
|
ZnT .125 .125 .125 .003 .00713 |
|
AlM .5 .5 .5 .243 .00472 |
|
Fe2+M .5 .5 .5 .006 .00472 |
|
Fe3+M .5 .5 .5 .108 .00472 |
|
MgM .5 .5 .5 .026 .00472 |
|
CrM .5 .5 .5 .590 .00472 |
|
NiM .5 .5 .5 .002 .00472 |
|
TiM .5 .5 .5 .018 .00472 |
|
VM .5 .5 .5 .007 .00472 |
|
O .26281 .26281 .26281 .00669 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV34A, UG1 |
|
_database_code_amcsd 0007235 |
|
8.3269 8.3269 8.3269 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .008 .00714 |
|
Fe2+T .125 .125 .125 .671 .00714 |
|
Fe3+T .125 .125 .125 .027 .00714 |
|
MgT .125 .125 .125 .281 .00714 |
|
MnT .125 .125 .125 .011 .00714 |
|
ZnT .125 .125 .125 .002 .00714 |
|
AlM .5 .5 .5 .249 .00472 |
|
Fe2+M .5 .5 .5 .026 .00472 |
|
Fe3+M .5 .5 .5 .097 .00472 |
|
MgM .5 .5 .5 .009 .00472 |
|
CrM .5 .5 .5 .594 .00472 |
|
TiM .5 .5 .5 .018 .00472 |
|
VM .5 .5 .5 .007 .00472 |
|
O .26279 .26279 .26279 .00706 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV29, UG2 |
|
_database_code_amcsd 0007236 |
|
8.2913 8.2913 8.2913 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .030 .00628 |
|
Fe2+T .125 .125 .125 .551 .00628 |
|
Fe3+T .125 .125 .125 .012 .00628 |
|
MgT .125 .125 .125 .398 .00628 |
|
MnT .125 .125 .125 .007 .00628 |
|
ZnT .125 .125 .125 .002 .00628 |
|
AlM .5 .5 .5 .336 .00394 |
|
Fe2+M .5 .5 .5 .011 .00394 |
|
Fe3+M .5 .5 .5 .082 .00394 |
|
MgM .5 .5 .5 .018 .00394 |
|
CrM .5 .5 .5 .536 .00394 |
|
NiM .5 .5 .5 .002 .00394 |
|
TiM .5 .5 .5 .010 .00394 |
|
VM .5 .5 .5 .005 .00394 |
|
O .26289 .26289 .26289 .00631 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV29A, UG2 |
|
_database_code_amcsd 0007237 |
|
8.2942 8.2942 8.2942 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .025 .00639 |
|
Fe2+T .125 .125 .125 .563 .00639 |
|
Fe3+T .125 .125 .125 .016 .00639 |
|
MgT .125 .125 .125 .389 .00639 |
|
MnT .125 .125 .125 .007 .00639 |
|
AlM .5 .5 .5 .327 .00394 |
|
Fe2+M .5 .5 .5 .006 .00394 |
|
Fe3+M .5 .5 .5 .082 .00394 |
|
MgM .5 .5 .5 .025 .00394 |
|
CrM .5 .5 .5 .541 .00394 |
|
NiM .5 .5 .5 .002 .00394 |
|
TiM .5 .5 .5 .012 .00394 |
|
VM .5 .5 .5 .005 .00394 |
|
O .26290 .26290 .26290 .00630 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV32, UG2 |
|
_database_code_amcsd 0007238 |
|
8.2944 8.2944 8.2944 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .039 .00686 |
|
Fe2+T .125 .125 .125 .531 .00686 |
|
Fe3+T .125 .125 .125 .007 .00686 |
|
MgT .125 .125 .125 .416 .00686 |
|
MnT .125 .125 .125 .007 .00686 |
|
AlM .5 .5 .5 .320 .00459 |
|
Fe2+M .5 .5 .5 .008 .00459 |
|
Fe3+M .5 .5 .5 .100 .00459 |
|
MgM .5 .5 .5 .023 .00459 |
|
CrM .5 .5 .5 .531 .00459 |
|
NiM .5 .5 .5 .003 .00459 |
|
TiM .5 .5 .5 .010 .00459 |
|
VM .5 .5 .5 .005 .00459 |
|
O .26272 .26272 .26272 .00703 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV32A, UG2 |
|
_database_code_amcsd 0007239 |
|
8.2950 8.2950 8.2950 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .023 .00640 |
|
Fe2+T .125 .125 .125 .529 .00640 |
|
Fe3+T .125 .125 .125 .012 .00640 |
|
MgT .125 .125 .125 .426 .00640 |
|
MnT .125 .125 .125 .007 .00640 |
|
ZnT .125 .125 .125 .003 .00640 |
|
AlM .5 .5 .5 .322 .00393 |
|
Fe2+M .5 .5 .5 .005 .00393 |
|
Fe3+M .5 .5 .5 .098 .00393 |
|
MgM .5 .5 .5 .021 .00393 |
|
CrM .5 .5 .5 .535 .00393 |
|
NiM .5 .5 .5 .003 .00393 |
|
TiM .5 .5 .5 .011 .00393 |
|
VM .5 .5 .5 .005 .00393 |
|
O .26275 .26275 .26275 .00617 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV31, UG3 |
|
_database_code_amcsd 0007240 |
|
8.2902 8.2902 8.2902 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .029 .00689 |
|
Fe2+T .125 .125 .125 .522 .00689 |
|
Fe3+T .125 .125 .125 .017 .00689 |
|
MgT .125 .125 .125 .422 .00689 |
|
MnT .125 .125 .125 .007 .00689 |
|
ZnT .125 .125 .125 .003 .00689 |
|
AlM .5 .5 .5 .328 .00468 |
|
Fe2+M .5 .5 .5 .008 .00468 |
|
Fe3+M .5 .5 .5 .092 .00468 |
|
MgM .5 .5 .5 .021 .00468 |
|
CrM .5 .5 .5 .534 .00468 |
|
NiM .5 .5 .5 .004 .00468 |
|
TiM .5 .5 .5 .009 .00468 |
|
VM .5 .5 .5 .004 .00468 |
|
O .26279 .26279 .26279 .00651 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV31A, UG3 |
|
_database_code_amcsd 0007241 |
|
8.2900 8.2900 8.2900 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .034 .00664 |
|
Fe2+T .125 .125 .125 .510 .00664 |
|
Fe3+T .125 .125 .125 .007 .00664 |
|
MgT .125 .125 .125 .439 .00664 |
|
MnT .125 .125 .125 .007 .00664 |
|
ZnT .125 .125 .125 .003 .00664 |
|
AlM .5 .5 .5 .332 .00451 |
|
Fe2+M .5 .5 .5 .013 .00451 |
|
Fe3+M .5 .5 .5 .092 .00451 |
|
MgM .5 .5 .5 .015 .00451 |
|
CrM .5 .5 .5 .532 .00451 |
|
NiM .5 .5 .5 .003 .00451 |
|
TiM .5 .5 .5 .009 .00451 |
|
VM .5 .5 .5 .004 .00451 |
|
O .26279 .26279 .26279 .00702 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV30, UG3B |
|
_database_code_amcsd 0007242 |
|
8.2994 8.2994 8.2994 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
Fe2+T .125 .125 .125 .569 .00706 |
|
Fe3+T .125 .125 .125 .083 .00706 |
|
MgT .125 .125 .125 .338 .00706 |
|
MnT .125 .125 .125 .009 .00706 |
|
ZnT .125 .125 .125 .001 .00706 |
|
AlM .5 .5 .5 .310 .00443 |
|
Fe2+M .5 .5 .5 .019 .00443 |
|
Fe3+M .5 .5 .5 .076 .00443 |
|
MgM .5 .5 .5 .035 .00443 |
|
CrM .5 .5 .5 .536 .00443 |
|
NiM .5 .5 .5 .003 .00443 |
|
TiM .5 .5 .5 .016 .00443 |
|
VM .5 .5 .5 .005 .00443 |
|
O .26273 .26273 .26273 .00702 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: BV30A, UG3B |
|
_database_code_amcsd 0007243 |
|
8.3013 8.3013 8.3013 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
AlT .125 .125 .125 .001 .00664 |
|
Fe2+T .125 .125 .125 .595 .00664 |
|
Fe3+T .125 .125 .125 .036 .00664 |
|
MgT .125 .125 .125 .356 .00664 |
|
MnT .125 .125 .125 .009 .00664 |
|
ZnT .125 .125 .125 .003 .00664 |
|
AlM .5 .5 .5 .270 .00422 |
|
Fe2+M .5 .5 .5 .002 .00422 |
|
Fe3+M .5 .5 .5 .119 .00422 |
|
MgM .5 .5 .5 .025 .00422 |
|
CrM .5 .5 .5 .559 .00422 |
|
NiM .5 .5 .5 .003 .00422 |
|
TiM .5 .5 .5 .017 .00422 |
|
VM .5 .5 .5 .005 .00422 |
|
O .26289 .26289 .26289 .00663 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: MER, MR |
|
_database_code_amcsd 0007244 |
|
8.2929 8.2929 8.2929 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
Fe2+T .125 .125 .125 .539 .00613 |
|
Fe3+T .125 .125 .125 .045 .00613 |
|
MgT .125 .125 .125 .407 .00613 |
|
MnT .125 .125 .125 .008 .00613 |
|
ZnT .125 .125 .125 .001 .00613 |
|
AlM .5 .5 .5 .291 .00383 |
|
Fe2+M .5 .5 .5 .004 .00383 |
|
Fe3+M .5 .5 .5 .080 .00383 |
|
MgM .5 .5 .5 .023 .00383 |
|
CrM .5 .5 .5 .584 .00383 |
|
NiM .5 .5 .5 .003 .00383 |
|
TiM .5 .5 .5 .011 .00383 |
|
VM .5 .5 .5 .004 .00383 |
|
O .26278 .26278 .26278 .00591 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Braidotti R, Princivalle F, Garuti G, Zaccarini F |
|
European Journal of Mineralogy 19 (2007) 599-609 |
|
Crystal chemistry and structural refinement of chromites from different |
|
chromitite layers and xenoliths of the Bushveld complex |
|
Locality: Bushveld complex, South Africa |
|
Sample: MER-A, MR |
|
_database_code_amcsd 0007245 |
|
8.2963 8.2963 8.2963 90 90 90 *Fd3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
Fe2+T .125 .125 .125 .528 .00542 |
|
Fe3+T .125 .125 .125 .037 .00542 |
|
MgT .125 .125 .125 .427 .00542 |
|
MnT .125 .125 .125 .008 .00542 |
|
AlM .5 .5 .5 .309 .00283 |
|
Fe2+M .5 .5 .5 .007 .00283 |
|
Fe3+M .5 .5 .5 .083 .00283 |
|
MgM .5 .5 .5 .020 .00283 |
|
CrM .5 .5 .5 .563 .00283 |
|
NiM .5 .5 .5 .003 .00283 |
|
TiM .5 .5 .5 .011 .00283 |
|
VM .5 .5 .5 .004 .00283 |
|
O .26277 .26277 .26277 .00543 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Skogby H, Princivalle F, Halenius U |
|
Physics and Chemistry of Minerals 31 (2004) 633-642 |
|
Structural changes and valence states in the MgCr2O4-FeCr2O4 solid solution series |
|
Sample: Fe2-45 |
|
_database_code_amcsd 0008912 |
|
8.3577 8.3577 8.3577 90 90 90 *Fd-3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
FeA .125 .125 .125 .60 .0056 |
|
MgA .125 .125 .125 .40 .0056 |
|
CrB .5 .5 .5 .0032 |
|
O .26192 .26192 .26192 .0043 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Skogby H, Princivalle F, Halenius U |
|
Physics and Chemistry of Minerals 31 (2004) 633-642 |
|
Structural changes and valence states in the MgCr2O4-FeCr2O4 solid solution series |
|
Sample: Fe2-60 |
|
_database_code_amcsd 0008913 |
|
8.3620 8.3620 8.3620 90 90 90 *Fd-3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
FeA .125 .125 .125 .65 .0056 |
|
MgA .125 .125 .125 .35 .0056 |
|
CrB .5 .5 .5 .0032 |
|
O .26207 .26207 .26207 .0043 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Skogby H, Princivalle F, Halenius U |
|
Physics and Chemistry of Minerals 31 (2004) 633-642 |
|
Structural changes and valence states in the MgCr2O4-FeCr2O4 solid solution series |
|
Sample: Fe2-55 |
|
_database_code_amcsd 0008914 |
|
8.3613 8.3613 8.3613 90 90 90 *Fd-3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
FeA .125 .125 .125 .67 .0060 |
|
MgA .125 .125 .125 .33 .0060 |
|
CrB .5 .5 .5 .0036 |
|
O .26219 .26219 .26219 .0046 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Skogby H, Princivalle F, Halenius U |
|
Physics and Chemistry of Minerals 31 (2004) 633-642 |
|
Structural changes and valence states in the MgCr2O4-FeCr2O4 solid solution series |
|
Sample: Fe2-70 |
|
_database_code_amcsd 0008915 |
|
8.3672 8.3672 8.3672 90 90 90 *Fd-3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
FeA .125 .125 .125 .76 .0066 |
|
MgA .125 .125 .125 .24 .0066 |
|
CrB .5 .5 .5 .0036 |
|
O .26224 .26224 .26224 .0047 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Skogby H, Princivalle F, Halenius U |
|
Physics and Chemistry of Minerals 31 (2004) 633-642 |
|
Structural changes and valence states in the MgCr2O4-FeCr2O4 solid solution series |
|
Sample: Fe2-80 |
|
_database_code_amcsd 0008916 |
|
8.3710 8.3710 8.3710 90 90 90 *Fd-3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
FeA .125 .125 .125 .87 .0069 |
|
MgA .125 .125 .125 .13 .0069 |
|
CrB .5 .5 .5 .0038 |
|
O .26256 .26256 .26256 .0047 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Skogby H, Princivalle F, Halenius U |
|
Physics and Chemistry of Minerals 31 (2004) 633-642 |
|
Structural changes and valence states in the MgCr2O4-FeCr2O4 solid solution series |
|
Sample: Fe2-90 |
|
_database_code_amcsd 0008917 |
|
8.3739 8.3739 8.3739 90 90 90 *Fd-3m |
|
.125 .125 .125 |
|
atom x y z occ Uiso |
|
FeA .125 .125 .125 .91 .0055 |
|
MgA .125 .125 .125 .09 .0055 |
|
CrB .5 .5 .5 .0029 |
|
O .26271 .26271 .26271 .0040 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromite |
|
Lenaz D, Skogby H, Princivalle F, Halenius U |
|
Physics and Chemistry of Minerals 31 (2004) 633-642 |
|
Structural changes and valence states in the MgCr2O4-FeCr2O4 solid solution series |
|
Sample: Fe2- |
|
_database_code_amcsd 0008918 |
|
8.3765 8.3765 8.3765 90 90 90 *Fd-3m |
|
.125 .125 .125 |
|
atom x y z Uiso |
|
FeA .125 .125 .125 .0061 |
|
CrB .5 .5 .5 .0034 |
|
O .26265 .26265 .26265 .0043 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromatite |
|
Clouse J |
|
Zeitschrift fur Kristallographie 83 (1932) 161-171 |
|
Investigations on the X-Ray Crystal Structures of Ca Cr O4, Ca Cr O4 * |
|
H2 O and Ca Cr O4 * (H2 O)2 |
|
_cod_database_code 1010939 |
|
_database_code_amcsd 0017660 |
|
7.25 7.25 6.34 90 90 90 I4_1/amd |
|
atom x y z |
|
Ca1 0 0 0 |
|
Cr1 0 0 .5 |
|
O1 0 .17 .34 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromium |
|
Wyckoff R W G |
|
Crystal Structures 1 (1963) 7-83 |
|
Second edition. Interscience Publishers, New York, New York |
|
Cubic closest packed, ccp, structure |
|
_database_code_amcsd 0011144 |
|
3.68 3.68 3.68 90 90 90 Fm3m |
|
atom x y z |
|
Cr 0 0 0 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromium |
|
Wyckoff R W G |
|
Crystal Structures 1 (1963) 7-83 |
|
Second edition. Interscience Publishers, New York, New York |
|
Hexagonal closest packed, hcp, structure |
|
_database_code_amcsd 0011170 |
|
2.722 2.722 4.427 90 90 120 P6_3/mmc |
|
atom x y z |
|
Cr 1/3 2/3 .25 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromium |
|
Wyckoff R W G |
|
Crystal Structures 1 (1963) 7-83 |
|
Second edition. Interscience Publishers, New York, New York |
|
Body centered cubic, bcc, structure |
|
_database_code_amcsd 0011209 |
|
2.8839 2.8839 2.8839 90 90 90 Im3m |
|
atom x y z |
|
Cr 0 0 0 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromphyllite |
|
Evsyunin V G, Kashaev A A, Rastsvetaeva R K |
  |
Crystallography Reports 42 (1997) 571-574 |
|
Crystal structure of a new representative of Cr micas |
|
Locality: Slyudyanka, Irkutsk, Russia |
|
_database_code_amcsd 0012352 |
|
5.240 9.103 19.93 90 95.59 90 C2/c |
|
atom x y z occ Biso B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
K 0 .0947 .25 .82 1.54 .0132 .0040 .0010 0 .0003 0 |
|
Ba 0 .0947 .25 .14 1.54 .0132 .0040 .0010 0 .0003 0 |
|
Na 0 .0947 .25 .04 1.54 .0132 .0040 .0010 0 .0003 0 |
|
CrM2 .2495 .0833 .0000 .71 1.16 .0096 .0027 .0009 .0000 .0005 .0001 |
|
AlM2 .2495 .0833 .0000 .14 1.16 .0096 .0027 .0009 .0000 .0005 .0001 |
|
MgM2 .2495 .0833 .0000 .09 1.16 .0096 .0027 .0009 .0000 .0005 .0001 |
|
VM2 .2495 .0833 .0000 .06 1.16 .0096 .0027 .0009 .0000 .0005 .0001 |
|
SiT1 .4643 .9272 .1369 .75 .61 .0045 .0010 .0006 .0000 .0001 .0002 |
|
AlT1 .4643 .9272 .1369 .25 .61 .0045 .0010 .0006 .0000 .0001 .0002 |
|
SiT2 .4543 .2569 .1369 .75 .62 .0045 .0010 .0006 .0000 .0001 .0002 |
|
AlT2 .4543 .2569 .1369 .25 .62 .0045 .0010 .0006 .0000 .0001 .0002 |
|
O1 .4374 .0921 .1697 1.2 .0151 .0020 .0008 -.0003 .0010 .0011 |
|
O2 .2405 .3588 .1701 1.2 .0107 .0039 .0006 -.0003 .0004 .0033 |
|
O3 .2405 .8213 .1623 1.3 .0100 .0045 .0008 .0013 -.0004 -.0041 |
|
O4 .4544 .9361 .0547 .9 .0063 .0024 .0006 .0001 .0000 -.0001 |
|
O5 .3983 .2513 .0544 .7 .0076 .0016 .0005 .0002 -.0004 -.0003 |
|
O6 .4521 .5677 .0524 .85 1.0 .0099 .0025 .0006 -.0004 .0007 .0012 |
|
F6 .4521 .5677 .0524 .15 1.0 .0099 .0025 .0006 -.0004 .0007 .0012 |
|
H .082 0 .456 .85 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromio-pargasite |
|
Nishio-Hamane D, Ohnishi M, Minakawa T, Yamaura J, Saito S, Kadota R |
|
Journal of Mineralogical and Petrological Sciences 107 (2012) 1-7 |
|
Ehimeite, NaCa2Mg4CrSi6Al2O22(OH)2: The first Cr-dominant amphibole |
|
from the Akaishi Mine, Higashi-Akaishi Mountain, Ehime Prefecture, Japan |
|
Note: name has been changed from ehimeite |
|
Locality: Akaishi mine, Higashi-Akaishi Mountain, Ehime Prefecture, Japan |
|
_database_code_amcsd 0019938 |
|
9.91760 18.0057 5.28650 90 105.3950 90 C2/m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
SiT1 .28006 .085048 .30366 .53 .00536 .00520 .00515 .00567 -.00050 .00132 -.00034 |
|
AlT1 .28006 .085048 .30366 .47 .00536 .00520 .00515 .00567 -.00050 .00132 -.00034 |
|
SiT2 .28978 .172871 .81260 .00545 .00532 .00570 .00559 -.00049 .00190 .00004 |
|
MgM1 0 .08883 .5 .00386 .00487 .00380 .00330 0 .00175 0 |
|
MgM2 0 .175599 0 .53 .00993 .01022 .00978 .01005 0 .00318 0 |
|
CrM2 0 .175599 0 .30 .00993 .01022 .00978 .01005 0 .00318 0 |
|
AlM2 0 .175599 0 .09 .00993 .01022 .00978 .01005 0 .00318 0 |
|
FeM2 0 .175599 0 .07 .00993 .01022 .00978 .01005 0 .00318 0 |
|
TiM2 0 .175599 0 .01 .00993 .01022 .00978 .01005 0 .00318 0 |
|
MgM3 0 0 0 .00211 .00290 .00168 .00169 0 .00052 0 |
|
CaM4 0 .279689 .5 .94 .00836 .01032 .00687 .00942 0 .00532 0 |
|
NaM4 0 .279689 .5 .06 .00836 .01032 .00687 .00942 0 .00532 0 |
|
NaA 0 .5 0 .88 .135 .0238 .343 .0460 0 .0253 0 |
|
KA 0 .5 0 .07 .135 .0238 .343 .0460 0 .0253 0 |
|
O1 .10739 .08662 .21821 .00840 .00737 .00999 .00782 -.00104 .00196 .00007 |
|
O2 .11988 .17258 .73037 .00746 .00542 .00862 .00831 -.00001 .00180 .00028 |
|
O3 .10788 0 .71708 .00882 .00731 .0088 .0101 0 .00186 0 |
|
O4 .36554 .24948 .78665 .00925 .01063 .00770 .01030 -.00263 .00433 -.00075 |
|
O5 .34953 .14040 .11364 .01102 .00984 .01316 .00905 -.00081 .00073 .00472 |
|
O6 .34428 .11479 .61427 .01164 .00935 .01232 .01370 .00049 .00383 -.00506 |
|
O7 .34128 0 .27210 .01315 .0095 .0142 .0157 0 .0033 0 |
|
H .19670 0 .74370 .009 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromium |
|
Kimoto K, Nishida I |
  |
Journal of the Physical Society of Japan 22 (1967) 744-756 |
|
An electron diffraction study on the crystal structure of |
|
a new modification of chromium |
|
Locality: synthetic |
|
_database_code_amcsd 0014168 |
|
4.588 4.588 4.588 90 90 90 Pm3 |
|
atom x y z occ |
|
Cr1 0 0 0 |
|
Cr2 .5 .5 .5 |
|
Cr3 .248 .04 .51 .25 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromium |
|
Bradley A J, Ollard E F |
  |
Nature 117 (1926) 122-122 |
|
Allotropy of chromium |
|
Locality: synthetic |
|
_database_code_amcsd 0014671 |
|
2.714 2.714 4.410 90 90 120 P6_3/mmc |
|
atom x y z |
|
Cr 1/3 2/3 .25 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Chromium |
|
Hull A W, Davey W P |
  |
Physical Review 14 (1919) 540-540 |
|
Crystal structure of chromium |
|
_database_code_amcsd 0015114 |
|
2.91 2.91 2.91 90 90 90 Im3m |
|
atom x y z |
|
Cr 0 0 0 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
Multiple datasets can be concatenated into a single downloadable file by selecting the datasets and then clicking
Multiple datasets can be downloaded as individual files inside a ZIP archive by selecting the datasets and then clicking
Total number of retrieved datasets: