|
Kihlmanite-(Ce) |
|
Yakovenchuk V N, Krivovichev S V, Ivanyuk G Y, Pakhomovsky Y A, Selivanova E A, |
|
Zhitova E A, Kalashnikova G O, Zolotarev A A, Mikhailova J A, Kadyrova G I |
|
Mineralogical Magazine 78 (2014) 483-496 |
|
Kihlmanite-(Ce), Ce2TiO2[SiO4](HCO3)2(H2O), a new rare-earth mineral from |
|
the pegmatites of the Khibiny alkaline massif, Kola Peninsula, Russia |
|
Locality: Khibiny alkaline massif, Kola Peninsula, Russia |
|
_database_code_amcsd 0020209 |
|
5.009 7.533 15.407 103.061 91.006 109.285 P-1 |
|
atom x y z occ Uiso |
|
Ce1 .2288 .38821 .19835 .973 .0223 |
|
Ce2 -.0536 -.17637 .19757 .966 .0241 |
|
Ti .3073 .6148 .99972 .76 .0176 |
|
Nb .3073 .6148 .99972 .24 .0176 |
|
Si .5023 .0684 .1289 .0178 |
|
O1 .282 -.1476 .0759 .015 |
|
O2 .467 .2281 .0762 .015 |
|
O3 .351 .1174 .2207 .022 |
|
O4 -.050 .5288 .9250 .014 |
|
O5 .615 .6098 .0747 .015 |
|
O6 .823 .0764 .1475 .024 |
|
O7 -.213 -.4933 .2369 .030 |
|
O8 .402 .7438 .2395 .033 |
|
O9 -.429 -.516 .3591 .057 |
|
O10 -.008 -.575 .3441 .065 |
|
O11 .271 .894 .3593 .088 |
|
O12 .769 .945 .3429 .090 |
|
C1 -.218 -.524 .3181 .042 |
|
C2 .494 .866 .3193 .055 |
|
Ca1 .312 .489 .4839 .22 .015 |
|
Ca2 0 0 0 .18 .033 |
|
Wat1 .304 .583 .4924 .52 .038 |
|
Wat2 0 0 .04 .32 |
|
CeQ1 .342 .370 .2025 .027 .007 |
|
CeQ2 .046 -.197 .206 .034 .021 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
Multiple datasets can be concatenated into a single downloadable file by selecting the datasets and then clicking
Multiple datasets can be downloaded as individual files inside a ZIP archive by selecting the datasets and then clicking
Total number of retrieved datasets: