|
Mammothite |
 |
Effenberger H |
|   |
Tschermaks Mineralogische und Petrographische Mitteilungen 34 (1985) 279-288 |
|
The crystal structure of mammothite, Pb6Cu4AlSbO2(OH)16Cl4(SO4)2 |
|
Locality: Mammoth vein, Tiger, Arizona, USA |
|
18.93 7.33 11.35 90 112.44 90 C2/m |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Pb1 .21037 0 .17947 .0179 .0186 .0232 .0159 0 .0051 0 |
|
Pb2 .42277 .25855 .20296 .0189 .0226 .0173 .0216 -.0022 .0064 -.0004 |
|
Cu1 .25 .25 .5 .0155 .0190 .0142 .0154 -.0019 .0027 -.0001 |
|
Cu2 .1042 0 .3685 .0151 .0167 .0168 .0178 0 .0078 0 |
|
Al 0 0 .5 .009 .0010 .014 .004 0 .002 0 |
|
Sb 0 0 0 .0143 .0149 .0174 .0129 0 .0029 0 |
|
O .0021 0 -.1695 .015 .023 .013 .018 0 .013 0 |
|
OH1 .2386 0 -.4393 .019 .018 .013 .030 0 .006 0 |
|
OH2 .0872 0 -.3442 .017 .008 .017 .025 0 -.001 0 |
|
OH3 .0831 .1854 .0426 .019 .020 .024 .018 -.001 .005 .003 |
|
OH4 .0409 .1717 .4173 .016 .022 .013 .021 .006 .008 .008 |
|
OH5 .1695 .1833 .3398 .014 .020 .014 .013 -.004 .005 .002 |
|
Cl1 .3679 0 .3963 .030 .035 .030 .025 0 -.002 0 |
|
Cl2 .4491 0 -.1995 .023 .029 .019 .028 0 .008 0 |
|
S1 .2497 0 -.0953 .015 .013 .021 .014 0 .003 0 |
|
OS1 .1776 0 -.0709 .020 .005 .039 .021 0 .005 0 |
|
OS2 .3103 0 .0298 .036 .015 .064 .029 0 .000 0 |
|
OS3 .2482 .1596 -.1686 .034 .047 .028 .030 -.010 .006 .006 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure
|
|   |
Multiple datasets can be concatenated into a single downloadable file by
selecting the datasets and then hitting the "Download Selected Data" button.