|
Paraershovite |
|
Khomyakov A P, Camara F, Sokolova E, Abdu Y, Hawthorne F C |
|
The Canadian Mineralogist 48 (2010) 279-290 |
|
Paraershovite, Na3K3Fe3+2(Si4O10OH)2(OH)2(H2O)4, a new mineral species from the |
|
Khibina Alkaline massif, Kola Peninsula, Russia: Description and crystal structure |
|
Locality: the Khibina Alkaline massif, Kola Peninsula, Russia |
|
_database_code_amcsd 0006330 |
|
10.1978 12.0155 5.2263 103.439 96.020 91.683 P-1 |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
K(1) .56870 .13502 .8203 .96 .0285 .0437 .0226 .0181 -.0025 .0014 .0041 |
|
K(2) .5 .5 .5 .0339 .0355 .0427 .0279 .0247 .0082 .0125 |
|
Na(1) .9757 .8611 .4609 .81 .0318 .024 .023 .045 -.0001 -.0027 .0043 |
|
Na(2) .9901 .7410 .8855 .41 .031 .027 .035 .034 .009 .016 .011 |
|
Fe2+M .00552 .42473 .70056 .87 .0118 .0085 .0140 .0119 .0019 .0001 .0012 |
|
Mn2+M .00552 .42473 .70056 .68 .0118 .0085 .0140 .0119 .0019 .0001 .0012 |
|
TiM .00552 .42473 .70056 .38 .0118 .0085 .0140 .0119 .0019 .0001 .0012 |
|
MgM .00552 .42473 .70056 .07 .0118 .0085 .0140 .0119 .0019 .0001 .0012 |
|
Si(1) .73752 .28343 .4291 .0122 .0103 .0144 .0118 .0014 .0021 .0024 |
|
Si(2) .71648 .67365 .1360 .0133 .0099 .0152 .0148 .0032 .0017 .0033 |
|
Si(3) .73373 .41941 .9938 .0116 .0088 .0137 .0117 .0014 .0017 .0016 |
|
Si(4) .67806 .81252 .7010 .0172 .0191 .0167 .0157 .0035 .0034 .0027 |
|
O(1) .6735 .3522 .6954 .0159 .009 .023 .015 .0022 .0024 .004 |
|
O(2) .8952 .2965 .4822 .0166 .011 .021 .016 .0020 .0014 .0016 |
|
O(3) .6525 .7284 .8982 .0241 .018 .034 .023 .005 .001 .013 |
|
O(4) .8735 .6832 .1747 .0176 .010 .021 .022 .0018 .0008 .006 |
|
O(5) .8919 .4392 .0176 .0134 .009 .021 .010 -.0005 .0011 .0021 |
|
O(6) .8233 .8724 .7639 .0334 .019 .037 .039 -.003 .003 -.001 |
|
O(7) .6602 .5397 .0558 .0193 .011 .017 .029 .0033 .0024 .003 |
|
O(8) .6503 .7323 .4004 .0228 .018 .029 .018 .004 .004 -.001 |
|
O(9) .6832 .3468 .1941 .0179 .012 .027 .014 .0015 .0006 .006 |
|
O(10) .6773 .1541 .3523 .0202 .017 .019 .023 -.001 .003 .002 |
|
O(11) .5653 .9052 .7303 .0238 .020 .019 .031 .003 .002 .002 |
|
O(12) .8933 .5458 .5733 .0171 .015 .019 .017 .0053 .0033 .002 |
|
O(13) .8581 .9925 .2831 .066 .057 .040 .083 .020 -.026 -.012 |
|
O(14A) .889 .156 .904 .5 .051 .040 .058 .059 .005 .012 .018 |
|
O(14B) .856 .113 .822 .5 .051 .040 .058 .059 .005 .012 .018 |
|
H(1) .481 .875 .692 .03566 |
|
H(2) .882 .603 .714 .02569 |
|
H(3) .847 .953 .111 .09960 |
|
H(4) .789 .038 .31 .09960 |
|
H(5) .969 .179 .01 .5 .07653 |
|
H(6) .86 .079 .91 .5 .07653 |
|
H(7) .786 .13 .664 .5 .07653 |
|
H(8) .799 .13 .98 .5 .07653 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
Multiple datasets can be concatenated into a single downloadable file by selecting the datasets and then clicking
Multiple datasets can be downloaded as individual files inside a ZIP archive by selecting the datasets and then clicking
Total number of retrieved datasets: