|
Epidote |
 |
Ito T |
 |
American Mineralogist 32 (1947) 309-321 |
|
The structure of epidote (HCa2(Al,Fe)Al2Si3O13) |
|
_database_code_amcsd 0000041 |
|
8.96 5.63 10.20 90 115.40 90 P2_1/m |
|
atom x y z occ |
|
Ca1 .963 .25 .641 |
|
Ca2 .963 .75 .641 |
|
Al .789 .25 .814 |
|
Fe 0 0 0 |
|
Si1 .394 .25 .711 .75 |
|
Al1 .394 .25 .711 .25 |
|
Si2 .604 .75 .695 .75 |
|
Al2 .604 .75 .695 .25 |
|
Si3 .582 .25 .553 .75 |
|
Al3 .582 .25 .553 .25 |
|
Si4 .375 .75 .940 .75 |
|
Al4 .375 .75 .940 .25 |
|
O1 .042 0 .843 |
|
O2 .301 0 .742 |
|
O3 .783 0 .694 |
|
O4 .535 .25 .821 |
|
O5 .535 .75 .821 |
|
O6 .420 .25 .582 |
|
O7 .420 .75 .582 |
|
O8 0 0 .5 |
|
O9 .179 .75 .033 |
|
OH10 .179 .25 .033 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink) |
| |
|
Epidote |
|
Dollase W A |
|
American Mineralogist 56 (1971) 447-464 |
|
Refinement of the crystal structures of epidote, allanite and hancockite |
|
_database_code_amcsd 0000226 |
|
8.914 5.640 10.162 90 115.4 90 P2_1/m |
|
atom x y z occ Biso B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
Ca1 .7562 .75 .1510 .76 .0037 .0055 .0023 0 .0018 0 |
|
Ca2 .6042 .75 .4241 .92 .0036 .0103 .0014 0 .0005 0 |
|
Si1 .3396 .75 .0473 .41 |
|
Si2 .6851 .25 .2744 .48 |
|
Si3 .1844 .75 .3189 .42 |
|
Al1 0 0 0 .93 .51 |
|
Fe1 0 0 0 .05 .51 |
|
Al2 0 0 .5 .43 |
|
Fe3 .2946 .25 .2245 .76 .42 .0016 .0030 .0012 0 .0004 0 |
|
Al3 .2946 .25 .2245 .24 .42 .0016 .0030 .0012 0 .0004 0 |
|
O1 .2339 .9923 .0410 .70 |
|
O2 .3040 .9809 .3554 .63 |
|
O3 .7957 .0152 .3382 .79 |
|
O4 .0528 .25 .1294 .6 |
|
O5 .0417 .75 .1471 .6 |
|
O6 .0683 .75 .4078 .5 |
|
O7 .5164 .75 .1825 .6 |
|
O8 .5281 .25 .3099 .9 |
|
O9 .6265 .25 .0990 1.0 |
|
OH10 .0838 .25 .4298 .7 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink) |
| |
|
Epidote-(Pb) |
| |
Dollase W A |
|
American Mineralogist 56 (1971) 447-464 |
|
Refinement of the crystal structures of epidote, allanite and hancockite |
|
_database_code_amcsd 0000229 |
|
8.958 5.665 10.304 90 114.4 90 P2_1/m |
|
atom x y z occ Biso B(1,1) B(2,2) B(3,3) B(1,2) B(1,3) B(2,3) |
|
Ca .7639 .75 .1559 1.0 .0052 .0061 .0049 0 .0043 0 |
|
Pb .5898 .75 .4124 0.5 1.1 .0037 .0136 .0033 0 .0027 0 |
|
Sr .5898 .75 .4124 .25 1.1 .0037 .0136 .0033 0 .0027 0 |
|
Ca .5898 .75 .4124 .13 1.1 .0037 .0136 .0033 0 .0027 0 |
|
Mn .5898 .75 .4124 .12 1.1 .0037 .0136 .0033 0 .0027 0 |
|
Si1 .3370 .75 .0399 .9 |
|
Si2 .6872 .25 .2777 1.1 |
|
Si3 .1758 .75 .3119 1.0 |
|
Al1 0 0 0 .86 .9 |
|
Fe1 0 0 0 .14 .9 |
|
Al2 0 0 .5 .7 |
|
Fe3 .2903 .25 .2190 .84 .6 .0025 .0085 .0032 0 .0022 0 |
|
Al3 .2903 .25 .2190 .16 .6 .0025 .0085 .0032 0 .0022 0 |
|
O1 .235 .988 .040 1.1 |
|
O2 .290 .979 .342 1.1 |
|
O3 .796 .011 .347 1.6 |
|
O4 .052 .25 .129 .5 |
|
O5 .038 .75 .146 1.1 |
|
O6 .062 .75 .407 .9 |
|
O7 .517 .75 .169 1.7 |
|
O8 .524 .25 .309 1.8 |
|
O9 .642 .25 .110 1.5 |
|
OH10 .074 .25 .422 1.5 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink) |
| |
|
Epidote |
|
Gabe E J, Portheine J C, Whitlow S H |
|
American Mineralogist 58 (1973) 218-223 |
|
A reinvestigation of the epidote structure: Confirmation of the iron location |
|
sample HEP |
|
_database_code_amcsd 0000308 |
|
8.8877 5.6275 10.1517 90 115.383 90 P2_1/m |
|
atom x y z occ U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Si1 .33959 .75 .04766 .00434 .00411 .00490 0 .00186 0 |
|
Si2 .68429 .25 .27454 .00522 .00436 .00541 0 .00224 0 |
|
Si3 .18393 .75 .31837 .00399 .00483 .00468 0 .00204 0 |
|
Ca1 .75715 .75 .15156 .01115 .00770 .00855 0 .00665 0 |
|
Ca2 .60486 .75 .42399 .00993 .01667 .00660 0 .00278 0 |
|
Al1 0 0 0 .00427 .00331 .00520 -.00234 .00177 .00042 |
|
Al2 0 0 .5 .00459 .00390 .00618 0 .00204 -.00005 |
|
Fe3 .29386 .25 .22419 .84 .00482 .00643 .00625 0 .00182 0 |
|
Al3 .29386 .25 .22419 .16 .00482 .00643 .00625 0 .00182 0 |
|
H .043 .25 .325 |
|
O1 .23425 .99441 .04150 .00591 .00536 .01148 .00085 .00403 .00048 |
|
O2 .30396 .98255 .35529 .00830 .00746 .00820 -.00293 .00381 -.00082 |
|
O3 .79503 .01341 .33935 .00726 .00566 .01040 .00055 -.00013 -.00006 |
|
O4 .05292 .25 .12948 .00664 .00501 .00562 0 .00220 0 |
|
O5 .04158 .75 .14534 .00606 .00574 .00532 0 .00146 0 |
|
O6 .06715 .75 .40688 .00858 .00581 .00963 0 .00633 0 |
|
O7 .51486 .75 .18053 .00636 .01055 .00816 0 .00067 0 |
|
O8 .52547 .25 .30809 .01030 .01595 .01613 0 .00984 0 |
|
O9 .62769 .25 .09895 .01745 .02118 .00782 0 .00753 0 |
|
O10 .08228 .25 .42852 .00805 .00528 .00882 0 .00502 0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink) |
| |
|
Epidote |
|
Gabe E J, Portheine J C, Whitlow S H |
|
American Mineralogist 58 (1973) 218-223 |
|
A reinvestigation of the epidote structure: Confirmation of the iron location |
|
sample LEP |
|
_database_code_amcsd 0000309 |
|
8.8802 5.6043 10.1511 90 115.455 90 P2_1/m |
|
atom x y z occ U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Ca1 .75972 .75 .15373 .01127 .00944 .00885 0 .00629 0 |
|
Ca2 .60660 .75 .42363 .01032 .01609 .00721 0 .00333 0 |
|
Si1 .33880 .75 .04804 .00485 .00528 .00471 0 .00173 0 |
|
Si2 .68054 .25 .27507 .00595 .00560 .00502 0 .00202 0 |
|
Si3 .18304 .75 .31686 .00476 .00611 .00468 0 .00214 0 |
|
Al1 0 0 0 .00557 .00471 .00581 -.00048 .00197 -.00031 |
|
Al2 0 0 .5 .00549 .00464 .00599 .00028 .00181 .00017 |
|
Al3 .29085 .25 .22415 .60 .00472 .00669 .00574 0 .00162 0 |
|
Fe3 .29095 .25 .22415 .40 .00472 .00669 .00574 0 .00162 0 |
|
O1 .23427 .99603 .04377 .00683 .00662 .01011 .00067 .00375 .00079 |
|
O2 .30189 .98442 .35306 .00838 .00926 .00728 -.00268 .00390 -.00133 |
|
O3 .79037 .01259 .34346 .00675 .00611 .01011 .00075 -.00049 -.00051 |
|
O4 .05360 .25 .13082 .00691 .00620 .00430 0 .00222 0 |
|
O5 .04009 .75 .14389 .00634 .00609 .00407 0 .00186 0 |
|
O6 .06242 .75 .40295 .00792 .00604 .00734 0 .00511 0 |
|
O7 .51600 .75 .17858 .00640 .00995 .00789 0 .00141 0 |
|
O8 .51639 .25 .30150 .01241 .01338 .01708 0 .01108 0 |
|
O9 .63540 .25 .10181 .02130 .02206 .00855 0 .00944 0 |
|
O10 .07498 .25 .42501 .00916 .00609 .00699 0 .00544 0 |
|
H .079 .25 .338 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink) |
| |
|
Epidote |
|
Giuli G, Bonazzi P, Menchetti S |
|
American Mineralogist 84 (1999) 933-936 |
|
Al-Fe disorder in synthetic epidotes: A single-crystal X-ray diffraction study |
|
Sample: CC11c |
|
_database_code_amcsd 0002248 |
|
8.891 5.624 10.164 90 115.44 90 P2_1/m |
|
atom x y z occ U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
CaA1 .7574 .75 .1517 .0121 .0112 .0096 0 .0080 0 |
|
CaA2 .6047 .75 .4241 .0122 .0183 .0059 0 .0041 0 |
|
Si1 .3383 .75 .0467 .0046 .0026 .0100 0 .0035 0 |
|
Si2 .6832 .25 .2742 .0069 .0053 .0054 0 .0013 0 |
|
Si3 .1834 .75 .3183 .0042 .0047 .0028 0 -.0007 0 |
|
Fe1 0 0 0 .08 .0054 .0051 .0056 .0004 .0014 .0011 |
|
Al1 0 0 0 .92 .0054 .0051 .0056 .0004 .0014 .0011 |
|
Al2 0 0 .5 .0038 .0033 .0069 -.0003 .0030 .0006 |
|
Fe3 .2936 .25 .2247 .60 .0035 .0060 .0051 0 .0004 0 |
|
Al3 .2936 .25 .2247 .40 .0035 .0060 .0051 0 .0004 0 |
|
O1 .2345 .9942 .0416 .0154 .0023 .0086 .0013 .0056 .0025 |
|
O2 .3017 .9819 .3535 .0110 .0095 .0097 -.0043 .0053 .0001 |
|
O3 .7937 .0128 .3419 .0052 .0080 .0115 -.0020 -.0027 -.0038 |
|
O4 .0530 .25 .1298 .0104 .0045 .0114 0 .0090 0 |
|
O5 .0418 .75 .1449 .0061 .0091 .0045 0 .0025 0 |
|
O6 .0659 .75 .4059 .0118 .0060 .0051 0 .0066 0 |
|
O7 .5138 .75 .1807 .0061 .0102 .0100 0 -.0011 0 |
|
O8 .5230 .25 .3067 .0294 .0104 .0098 0 .0136 0 |
|
O9 .6295 .25 .0996 .0155 .0155 .0150 0 .0067 0 |
|
O10 .0796 .25 .4263 .0066 .0118 .0093 0 .0071 0 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink) |
| |
|
Epidote |
|
Nagashima M, Akasada M |
| |
American Mineralogist 95 (2010) 1237-1246 |
|
X-ray Rietveld and 57Fe Mossbauer studies of epidote and piemontite on the join |
|
Ca2Al2FeSi3O12(OH) - Ca2Al2MnSi3O12(OH) formed by hydrothermal synthesis |
|
Locality: synthetic |
|
Sample: q=1.0, run 41 |
|
_database_code_amcsd 0016949 |
|
8.8902 5.6366 10.1600 90 115.432 90 P2_1/m |
|
atom x y z occ |
|
Ca .7528 .75 .1498 |
|
Ca .6092 .75 .4222 |
|
AlM1 0 0 0 .84 |
|
FeM1 0 0 0 .16 |
|
AlM2 0 0 .5 |
|
AlM3 .2959 .25 .2262 .25 |
|
FeM3 .2959 .25 .2262 .75 |
|
Si .3380 .75 .0461 |
|
Si .6814 .25 .2766 |
|
Si .1885 .75 .324 |
|
O1 .235 .993 .041 |
|
O2 .305 .977 .355 |
|
O3 .798 .015 .342 |
|
O4 .052 .25 .129 |
|
O5 .036 .75 .151 |
|
O6 .062 .75 .411 |
|
O7 .516 .75 .173 |
|
O8 .524 .25 .309 |
|
O9 .646 .25 .104 |
|
OH10 .071 .25 .425 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink) |
| |
|
Epidote |
|
Nagashima M, Akasada M |
| |
American Mineralogist 95 (2010) 1237-1246 |
|
X-ray Rietveld and 57Fe Mossbauer studies of epidote and piemontite on the join |
|
Ca2Al2FeSi3O12(OH) - Ca2Al2MnSi3O12(OH) formed by hydrothermal synthesis |
|
Locality: synthetic |
|
Sample: q=0.75, run 27 |
|
_database_code_amcsd 0016950 |
|
8.8980 5.6549 10.1752 90 115.428 90 P2_1/m |
|
atom x y z occ |
|
Ca1 .7541 .75 .1498 |
|
Ca2 .6057 .75 .4247 |
|
AlM1 0 0 0 .90 |
|
FeM1 0 0 0 .08 |
|
MnM1 0 0 0 .02 |
|
AlM2 0 0 .5 |
|
AlM3 .2948 .25 .2245 .31 |
|
FeM3 .2948 .25 .2245 .50 |
|
MnM3 .2948 .25 .2245 .19 |
|
Si1 .3399 .75 .0475 |
|
Si2 .6812 .25 .2726 |
|
Si3 .1873 .75 .3225 |
|
O1 .2311 .988 .0362 |
|
O2 .3077 .978 .3570 |
|
O3 .8011 .019 .3476 |
|
O4 .055 .25 .140 |
|
O5 .0379 .75 .1464 |
|
O6 .0535 .75 .402 |
|
O7 .5207 .75 .1782 |
|
O8 .5222 .25 .3076 |
|
O9 .622 .25 .098 |
|
OH10 .076 .25 .429 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink) |
| |
|
Epidote |
|
Nagashima M, Akasada M |
| |
American Mineralogist 95 (2010) 1237-1246 |
|
X-ray Rietveld and 57Fe Mossbauer studies of epidote and piemontite on the join |
|
Ca2Al2FeSi3O12(OH) - Ca2Al2MnSi3O12(OH) formed by hydrothermal synthesis |
|
Locality: synthetic |
|
Sample: q=0.5, run 22 |
|
_database_code_amcsd 0016951 |
|
8.8817 5.6543 10.1630 90 115.435 90 P2_1/m |
|
atom x y z occ |
|
Ca1 .7571 .75 .1508 |
|
Ca2 .5988 .75 .4197 |
|
AlM1 0 0 0 .81 |
|
FeM1 0 0 0 .06 |
|
MnM1 0 0 0 .13 |
|
AlM2 0 0 .5 |
|
AlM3 .2941 .25 .2263 .27 |
|
FeM3 .2941 .25 .2263 .33 |
|
MnM3 .2941 .25 .2263 .40 |
|
Si1 .3431 .75 .0475 |
|
Si2 .6831 .25 .2734 |
|
Si3 .1881 .75 .3267 |
|
O1 .2376 .984 .0363 |
|
O2 .302 .982 .355 |
|
O3 .805 .017 .3479 |
|
O4 .062 .25 .135 |
|
O5 .049 .75 .153 |
|
O6 .063 .75 .415 |
|
O7 .523 .75 .172 |
|
O8 .518 .25 .307 |
|
O9 .615 .25 .102 |
|
OH10 .083 .25 .425 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink) |
| |
|
Epidote |
|
Nagashima M, Akasada M |
| |
American Mineralogist 95 (2010) 1237-1246 |
|
X-ray Rietveld and 57Fe Mossbauer studies of epidote and piemontite on the join |
|
Ca2Al2FeSi3O12(OH) - Ca2Al2MnSi3O12(OH) formed by hydrothermal synthesis |
|
Locality: synthetic |
|
Sample: q=0.5, run 21 |
|
_database_code_amcsd 0016952 |
|
8.8904 5.6606 10.1760 90 115.455 90 P2_1/m |
|
atom x y z occ |
|
Ca1 .7539 .75 .1492 |
|
Ca2 .6000 .75 .4229 |
|
AlM1 0 0 0 .79 |
|
FeM1 0 0 0 .08 |
|
MnM1 0 0 0 .13 |
|
AlM2 0 0 .5 |
|
AlM3 .2955 .25 .2261 .29 |
|
FeM3 .2955 .25 .2261 .31 |
|
MnM3 .2955 .25 .2261 .40 |
|
Si1 .3401 .75 .0469 |
|
Si2 .6828 .25 .2750 |
|
Si3 .1871 .75 .3245 |
|
O1 .2373 .985 .0349 |
|
O2 .3062 .981 .3566 |
|
O3 .8018 .018 .3487 |
|
O4 .062 .25 .1369 |
|
O5 .0464 .75 .1480 |
|
O6 .0612 .75 .408 |
|
O7 .5182 .75 .1773 |
|
O8 .5182 .25 .301 |
|
O9 .619 .25 .098 |
|
OH10 .079 .25 .428 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink) |
| |
|
Epidote-(Sr) |
| |
Minakawa T, Fukushima H, Nishio-Hamane D, Miura H |
| |
Journal of Mineralogical and Petrological Sciences 103 (2008) 400-406 |
|
Epidote-(Sr), CaSrAl2Fe(Si2O7)(SiO4)(OH), a new mineral from the Ananai mine, |
|
Kochi Prefecture, Japan |
|
Locality: Ananai mine, Kochi Prefecture, Japan |
|
_database_code_amcsd 0013136 |
|
8.928 5.652 10.244 90 114.46 90 P2_1/m |
|
atom x y z occ Biso |
|
CaA1 .764 .75 .156 .96 .76 |
|
SrA1 .764 .75 .156 .04 .76 |
|
SrA2 .595 .75 .422 .86 .92 |
|
CaA2 .595 .75 .422 .14 .92 |
|
AlM1 0 0 0 .90 .51 |
|
FeM1 0 0 0 .10 .51 |
|
AlM2 0 0 .5 .43 |
|
FeM3 .295 .25 .220 .78 .42 |
|
MnM3 .295 .25 .220 .20 .42 |
|
AlM3 .295 .25 .220 .02 .42 |
|
Si1 .338 .75 .037 .45 |
|
Si2 .685 .25 .274 .45 |
|
Si3 .174 .75 .315 .45 |
|
O1 .246 .999 .043 .70 |
|
O2 .292 .973 .336 .70 |
|
O3 .785 .013 .329 .70 |
|
O4 .041 .25 .117 .7 |
|
O5 .045 .75 .143 .70 |
|
O6 .072 .75 .418 .70 |
|
O7 .509 .75 .176 .70 |
|
O8 .532 .25 .316 .70 |
|
O9 .642 .25 .109 .70 |
|
OH10 .076 .25 .425 .70 |
|
|
| Download AMC data (View Text File)
Download CIF data (View Text File)
Download diffraction data (View Text File)
View JMOL 3-D Structure (permalink) |
| |
Multiple datasets can be concatenated into a single downloadable file by selecting the datasets and then clicking
Multiple datasets can be downloaded as individual files inside a ZIP archive by selecting the datasets and then clicking
Total number of retrieved datasets: 