|
Oxy-chromium-dravite |
|
Bosi F, Reznitskii L, Skogby H |
|
American Mineralogist 97 (2012) 2024-2030 |
|
Oxy-chromium-dravite, NaCr3(Cr4Mg2)(Si6O18)(BO3)3(OH)3O, |
|
a new mineral species of the tourmaline supergroup |
|
Locality: Pereval marble quarry, Sludyanka, Lake Baikal, Russia |
|
_database_code_amcsd 0019734 |
|
16.1121 16.1121 7.3701 90 90 120 R3m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
NaX 0 0 .2270 .0240 .0255 .0255 .0212 .0127 0 0 |
|
CrY .123083 .061541 .63874 .650 .00487 .00427 .00430 .00604 .00213 -.00037 -.00019 |
|
VY .123083 .061541 .63874 .290 .00487 .00427 .00430 .00604 .00213 -.00037 -.00019 |
|
MgY .123083 .061541 .63874 .047 .00487 .00427 .00430 .00604 .00213 -.00037 -.00019 |
|
TiY .123083 .061541 .63874 .013 .00487 .00427 .00430 .00604 .00213 -.00037 -.00019 |
|
CrZ .297600 .261475 .60855 .562 .00455 .00414 .00464 .00480 .00215 -.00014 .00033 |
|
MgZ .297600 .261475 .60855 .322 .00455 .00414 .00464 .00480 .00215 -.00014 .00033 |
|
AlZ .297600 .261475 .60855 .116 .00455 .00414 .00464 .00480 .00215 -.00014 .00033 |
|
B .10930 .21861 .4548 .0063 .0054 .0056 .0080 .0028 .0004 .0008 |
|
Si .189436 .187762 0 .983 .00489 .00451 .00431 .00567 .00208 -.00024 -.00035 |
|
Al .189436 .187762 0 .017 .00489 .00451 .00431 .00567 .00208 -.00024 -.00035 |
|
O1 0 0 .7649 .54 .0059 .0048 .0048 .0080 .0024 0 0 |
|
F1 0 0 .7649 .46 .0059 .0048 .0048 .0080 .0024 0 0 |
|
O2 .06015 .12030 .49116 .00532 .0044 .0041 .0074 .0021 .00066 .0013 |
|
O3 .25501 .12751 .50900 .00814 .0096 .0089 .0062 .0048 .0013 .00064 |
|
H3 .2507 .1253 .376 .89 .012 |
|
O4 .09250 .18500 .07148 .0091 .0068 .0150 .0083 .0075 -.0002 -.0004 |
|
O5 .18209 .09105 .09007 .00848 .0138 .0060 .0081 .0069 .0007 .00035 |
|
O6 .19072 .18146 .78133 .00620 .0075 .0060 .0046 .0030 -.0001 -.0005 |
|
O7 .28246 .28199 .07220 .00794 .0067 .0059 .0084 .0011 -.0016 -.0015 |
|
O8 .20649 .26678 .43700 .00893 .0051 .0085 .0132 .0034 .0007 .0035 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
Multiple datasets can be concatenated into a single downloadable file by selecting the datasets and then clicking
Multiple datasets can be downloaded as individual files inside a ZIP archive by selecting the datasets and then clicking
Total number of retrieved datasets: