|
Tsilaisite |
|
Bosi F, Skogby H, Agrosi G, Scandale E |
|
American Mineralogist 97 (2012) 989-994 |
|
Tsilaisite, NaMn3Al6(Si6O18)(BO3)3(OH)3OH, a new mineral species of the tourmaline |
|
supergroup from Grotta d'Oggi, San Pietro in Campo, island of Elba, Italy |
|
Note: this dataset represents the standard tourmaline model |
|
Locality: Grotta d'Oggi, San Pietro in Campo, island of Elba, Italy |
|
_database_code_amcsd 0018865 |
|
15.9461 15.9461 7.1380 90 90 120 R3m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
NaX 0 0 .2286 .67 .0269 .0299 .0299 .0209 .0149 0 0 |
|
CaX 0 0 .2286 .02 .0269 .0299 .0299 .0209 .0149 0 0 |
|
KX 0 0 .2286 .01 .0269 .0299 .0299 .0209 .0149 0 0 |
|
Mn2Y .12399 .061995 .62408 .447 .01130 .0108 .00802 .0160 .00540 -.00255 -.00127 |
|
AlY .12399 .061995 .62408 .380 .01130 .0108 .00802 .0160 .00540 -.00255 -.00127 |
|
LiY .12399 .061995 .62408 .180 .01130 .0108 .00802 .0160 .00540 -.00255 -.00127 |
|
TiY .12399 .061995 .62408 .013 .01130 .0108 .00802 .0160 .00540 -.00255 -.00127 |
|
AlZ .29803 .26129 .61115 .00602 .00627 .00725 .00470 .00351 -.00009 .00054 |
|
SiT .19190 .18997 0 .99 .00479 .00498 .00475 .00456 .00238 -.00002 -.00035 |
|
BT .19190 .18997 0 .01 .00479 .00498 .00475 .00456 .00238 -.00002 -.00035 |
|
B .10993 .21986 .4543 .0067 .0072 .0059 .0065 .0029 .0002 .0003 |
|
O1 0 0 .7794 .20 .0443 .064 .064 .0050 .0320 0 0 |
|
OH1 0 0 .7794 .39 .0443 .064 .064 .0050 .0320 0 0 |
|
F1 0 0 .7794 .41 .0443 .064 .064 .0050 .0320 0 0 |
|
O2 .06139 .12277 .4818 .0197 .0305 .0060 .0144 .0030 .0003 .0005 |
|
O3 .26843 .13422 .5100 .0115 .0237 .0104 .0047 .0119 -.0006 -.0003 |
|
H3 .259 .1297 .401 .017 |
|
O4 .09351 .18702 .0701 .0085 .0069 .0125 .0079 .0063 -.0007 -.0013 |
|
O5 .18698 .09349 .0917 .0084 .0142 .0066 .0071 .0071 .0018 .0009 |
|
O6 .19732 .18723 .77527 .00785 .0088 .0095 .0043 .0038 .0007 -.0004 |
|
O7 .28539 .28583 .08002 .00625 .0061 .0053 .0052 .0013 .0005 -.0006 |
|
O8 .21011 .27092 .44140 .00796 .0064 .0116 .0073 .0055 .0005 .0027 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
|
Tsilaisite |
|
Bosi F, Skogby H, Agrosi G, Scandale E |
|
American Mineralogist 97 (2012) 989-994 |
|
Tsilaisite, NaMn3Al6(Si6O18)(BO3)3(OH)3OH, a new mineral species of the tourmaline |
|
supergroup from Grotta d'Oggi, San Pietro in Campo, island of Elba, Italy |
|
Note: this dataset represents the split atom model |
|
Locality: Grotta d'Oggi, San Pietro in Campo, island of Elba, Italy |
|
_database_code_amcsd 0018866 |
|
15.9461 15.9461 7.1380 90 90 120 R3m |
|
atom x y z occ Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
NaX 0 0 .2290 .754 .0261 .0287 .0287 .0208 .0143 0 0 |
|
MnY .12400 .062000 .62407 .616 .01141 .0108 .00807 .0162 .00542 -.00265 -.00132 |
|
LiY .12400 .062000 .62407 .384 .01141 .0108 .00807 .0162 .00542 -.00265 -.00132 |
|
AlZ .29801 .26127 .61120 1.017 .00598 .00629 .00722 .00460 .00351 -.00009 .00057 |
|
B .10999 .21998 .4543 .0070 .0074 .0071 .0063 .0035 .0001 .0002 |
|
Si .19191 .18997 0 .00470 .00482 .00467 .00456 .00234 .00001 -.00041 |
|
O1 .0209 .01044 .7796 .3333 .0078 |
|
O2 .07115 .12293 .4819 .50 .0101 |
|
O3 .26862 .13431 .5100 .0114 .0235 .0105 .0044 .0118 -.0005 -.0003 |
|
H3 .256 .1280 .409 .017 |
|
O4 .09348 .18696 .07006 .0082 .0068 .0116 .0078 .0058 -.0006 -.0013 |
|
O5 .18697 .09349 .09176 .0083 .0145 .0064 .0067 .0072 .0014 .0007 |
|
O6 .19727 .18721 .77531 .00786 .0087 .0096 .0041 .0037 .0004 -.0007 |
|
O7 .28533 .28581 .08008 .00617 .0058 .0054 .0053 .0013 .0005 -.0006 |
|
O8 .21009 .27095 .44150 .00779 .0063 .0115 .0069 .0055 .0006 .0027 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
Multiple datasets can be concatenated into a single downloadable file by selecting the datasets and then clicking
Multiple datasets can be downloaded as individual files inside a ZIP archive by selecting the datasets and then clicking
Total number of retrieved datasets: